Balance and complete equation H2SO4

  1. Balance and complete equationH2SO4 + Na2CO3 ---> Na2SO4 + H2O + CO2
    1. answers icon 1 answer
    2. Amily asked by Amily
    3. views icon 957 views
  2. complete and balance chemical equation for each of the follA CH3_CHOH_CH3 --H2SO4--> B CH3_CHBr_CH3+koH-->
    1. answers icon 0 answers
    2. rebu asked by rebu
    3. views icon 402 views
  3. complete and balance chemical equation for each of the follA CH3_CHOH_CH3 --H2SO4--> B CH3_CHBr_CH3+koH-->
    1. answers icon 0 answers
    2. rebu asked by rebu
    3. views icon 473 views
  4. Complete and balance the equations for each of the following reactions. Express your answer as a chemical equation. Identify all
    1. answers icon 1 answer
    2. Lisa asked by Lisa
    3. views icon 923 views
  5. Complete and balance the equation for the following reaction in which acid are neutralized.a. HNO3 + Na2O => b. HCl + CaCO3 =>
    1. answers icon 1 answer
    2. views icon 48 views
  6. help me with this...For each of the chemical reactions below, complete and balance the reactions: 19. HI + Ca(OH)2 → 20. H2SO4
    1. answers icon 1 answer
    2. views icon 92 views
  7. complete and balance NaHCO3 (aq) + H2SO4 (aq)
    1. answers icon 0 answers
    2. Angele asked by Angele
    3. views icon 528 views
  8. I think it is a trick question as I can not balance this equation .Balance this equation Na(CO3)2+H2SO4=NA(SO4)2+H2O+CO2
    1. answers icon 0 answers
    2. Julia asked by Julia
    3. views icon 601 views
  9. Use the equation to answer the question.H2SO4 + HI → H2S + I2 + H2O Which option shows a correctly balanced chemical equation?
    1. answers icon 1 answer
    2. views icon 126 views
  10. Complete and balance the following equations: 1.1 HCl + NaOH→ 2.2 H₂SO₄ + NaHCO3→ 2. Write a balanced equation between
    1. answers icon 1 answer
    2. views icon 51 views