Ask a New Question

Questions and answers by

Julia

Questions (336)

Anyone (Deaf or hearing) can give you a Deaf name.True False
1. 1 answer
2. 52 views
What has the biggest impact on your actions/behavior?Feelings Thoughts Situation Strategy
1. 1 answer
2. 45 views
Growth mindset is only applicable in the academic environment.True False
1. 1 answer
2. 37 views
Vanillin, the flavoring agent in vanilla, has a mass percent composition of 63.15%C, 5.30%H, and 31.55%O. Determine the
1. 1 answer
2. 138 views
The first three terms of the sequence 6;x;y;27 form an arithmetic progression and the last three terms form a geometric
1. 3 answers
2. 139 views
How did Aśoka’s rule lead to a prosperous India?
1. 0 answers
2. 233 views
In the xy-plane, what is the area of a parallelogram with vertices (0,0), (2,0), (3,-2), and (5,-2)?
1. 1 answer
2. 127 views
Calculate the gross profit ratio and the inventory turnover ratio for the fiscal year ended February 3, 2018. Compare Target’s
1. 0 answers
2. 195 views
Use collision theory and factors affecting the rate of reaction to explain why when heated in a flame, steel wool burns but a
1. 1 answer
2. 348 views
Which of the following were important achievements of the Kushites? Select TWO correct answers.A.)the defeat of the Assyrian
1. 0 answers
2. 295 views
Write the augmented matrix for the system of linear equations. (Do not perform any row operations.)4x − y = 9 x + y = 4
1. 1 answer
2. 759 views
What are the values of a, b and c for the following equation:2x^2 +9x = 18
1. 1 answer
2. 369 views
Sasha reads at a rate of 0.8 pages per minute in her favorite novel, but only 0.5 pages per minute in the autobiography she is
1. 1 answer
2. 494 views
At a certain car rental agency a compact car rents for $40 a day and 20¢ a mile.(a) How much does it cost to rent a car for 5
1. 1 answer
2. 1,044 views
The expression like a ton of bricks means “a crushing weight.” Would being hit by an actual ton of bricks hurt if it
1. 8 answers
2. 4,072 views
50 divided by negative 5
1. 2 answers
2. 320 views
Find the sum of the series the series from n equals 1 to infinity of the quotient of negative 1 raised to the n minus 1 power
1. 1 answer
2. 827 views
How many grams of calcium hydroxide will be needed to react completely with 10.0 g of phosphorus acid?
1. 1 answer
2. 1,257 views
∫[1,2] 3√u duI got 4 square root 2 - 2, is this right? Please help me
1. 1 answer
2. 160 views
Find the arc length on the interval for t between 0 and 1 inclusive for the curve described with the parametric equations: x = 1
1. 3 answers
2. 399 views
Which most accurately describes the involvement of Pericles in the political system of ancient Athens and its influence on later
1. 2 answers
2. 818 views
Which most accurately describes cultural practices of ancient Nubia?Nubian people introduced and traded silk to India in 500 BC
1. 4 answers
2. 1,481 views
Read the summary.The earliest humans originated in northern Europe (1) and traveled south via land bridges to Asia and Africa
1. 0 answers
2. 604 views
What is the importance of respiration?A.) it breaks down food that is ingested to its building blocks B.) it builds glucose
1. 3 answers
2. 727 views
What systems supply food and oxygen needed for respiration?A.) digestive, excretory, and cardiovascular B.) excretory,
1. 1 answer
2. 2,567 views
The sides of a cube are increasing in length at a constant rate of 5 cm/minute. At the moment that the surface area of the cube
1. 1 answer
2. 800 views
A rectangular box whose base is twice as long as it wide has volume of 256 cm^3. Material for the top costs 10 centavos per
1. 1 answer
2. 431 views
A rectangular box whose base is twice as long as it wide has volume of 256 cm^3. Material for the top costs 10 centavos per
1. 1 answer
2. 275 views
d/dx -x^3 =yFind the x intercepts
1. 1 answer
2. 265 views
What kind of function is x=10
1. 2 answers
2. 269 views
Use the graph of the combined function y=3^3 - x^3 - 1 below to determine an approximate solution to inequality 3^x < x^3 + 1
1. 1 answer
2. 633 views
Given f(x) = 1/x^2 -4 and g(x)= log, identify the steps you would take to determine the domain of (g ° f) (x). What is the
1. 1 answer
2. 377 views
Given f (x) = tan(x) and g(x)=1/2^2, provide a characteristic that the two functions have in common and a characteristic that
1. 1 answer
2. 452 views
A spherical balloon is being inflated. Given that the volume of a sphere in terms of its radius is V(r)= 4/3 πr^3 and the
1. 1 answer
2. 593 views
What is the range and equation of axis for the function : y=3sin(-2x + Pi/3) - 1
1. 1 answer
2. 297 views
Prove the identity of the following equation:(cos 2x)/(1/(cos x)) * (sin(pi + x))/(tan x) = (sec(x) - csc(x)) * (csc(x))/(sec^2
1. 1 answer
2. 680 views
A Ferris wheel of diameter 18.5m rotated at a rate of 0.2rad/s. If passengers board the lowest car at the height of 3 m above
1. 2 answers
2. 2,045 views
Find the mistakes in the solution below & correctly solve the question.If it can’t be solved, explain why with reasoning?
1. 1 answer
2. 394 views
A singer is performing to a crows. How many times more intense is her singing at 70 dB, compared to a bird whose call is 34 dB?
1. 2 answers
2. 347 views
If log(2a+3b/2)=1/2log(2a)+1/2log(3b), where a> 0,b >0, show that 4a^2 + 9b^2 = 12ab Show all calculations
1. 1 answer
2. 828 views
What are the possible solutions of 2log2a = 10 – 2log2b, where a and b are integers? Show you’re calculations
1. 1 answer
2. 463 views
Marco purchased a large box of comic books for $300. He gave 15 of the comic books to his brother and then sold the rest on the
1. 1 answer
2. 911 views
Write the equation of the function that passes through the points (0,0) and (4, 8/9 (fraction) ); has the x-axis as a horizontal
1. 1 answer
2. 1,331 views
1. A 2.5 kg mass at rest on a horizontal surface is acted upon by an applied horizontal force of 150 N. A frictional force of
1. 1 answer
2. 1,106 views
Is 2,3,5,8,12
1. 1 answer
2. 314 views
What is the difference between plant and animal cell division besides Cytokinesis
1. 1 answer
2. 570 views
What are the complex solutions to the following equation? -3x^2 + 2x - 3 = 0
1. 2 answers
2. 641 views
A college survey was taken to determine where students study. Of 132 students surveyed, 78 studied in the cafeteria, 64
1. 2 answers
2. 692 views
At Frugal Foods a loaf of bread cost about $1 in 1980. In 2013, the loaf of bread cost $2.501. A ratio is a comparison of two
1. 1 answer
2. 1,740 views
Solve for x. 4(x-b)=x
1. 1 answer
2. 310 views
What is the sum of all the numbers less than 496 that devise equally into 496
1. 1 answer
2. 1,085 views
What is the sum of all numbers less than 496 that devise evenly into496
1. 3 answers
2. 2,763 views
Say every A in a letter is worth 1$ Every Bin a word is worth2$ And every C in a word is worth 3$And so on up to Z witch is 26$.
1. 1 answer
2. 403 views
Sondra has a lot of cats (witch have four legs )and a lot of parakeet (witch have two legs)among her pets she counted 57 heads
1. 2 answers
2. 630 views
Pls help due MondayOn what day of the year 1943 was the year 300000minutes old
1. 1 answer
2. 497 views
How to use and change dangling participle
1. 1 answer
2. 354 views
A carpenter needs 80cm of wood he cuts this from a plank 2cm long. What fraction did he use?
1. 3 answers
2. 872 views
A battery of e.m.f. 6.0 V, and internal resistance 1.0 ohms is connected to a resistor and drives a current of 125 mA through
1. 2 answers
2. 1,728 views
Say a women, who is a recreational Exerciser, weighs 132 pounds. How many grams of protein might be ideal for her?
1. 0 answers
2. 505 views
PLEASE HELP!!Choose three large cities. Explain what direction you would travel in a straight line to be cities from where you
1. 2 answers
2. 591 views
Suppose you have 3 pieces of string measuring 4 inches, 5 inches, and 10 inches. How many unique triangles can you form with
1. 2 answers
2. 1,063 views
What type of lead addresses the audiance as you? (I cant find anything anywhere on it)
1. 1 answer
2. 400 views
Where should you include the source attribution for information you have quoted in a article?A) in the lead paragraph of the
1. 3 answers
2. 929 views
You're driving down the highway late one night at 18 m/s when a deer steps onto the road 42 m in front of you. Your reaction
1. 1 answer
2. 1,478 views
You're driving down the highway late one night at 18 m/s when a deer steps onto the road 42 m in front of you. Your reaction
1. 1 answer
2. 3,631 views
A 63 kg astronaut on a spacewalk when his line breaks. He throws a 10 kg o2 tank away from the ship with a v=12 m/s. This
1. 1 answer
2. 1,116 views
I have to make a paper mache animal and show changes in that animal because they needed to adapt. I wanted to make a dog fly but
1. 0 answers
2. 586 views
I think it is a trick question as I can not balance this equation .Balance this equation Na(CO3)2+H2SO4=NA(SO4)2+H2O+CO2
1. 0 answers
2. 571 views
Zachary saved x nickels and y dimes last month. Lily saved x nickels and 2y dimes. Lily saved $2 more than Zachary and the total
1. 2 answers
2. 413 views
Hi, could someone please help me with this question? ThanksCalculate the Maclaurin series of f(x)=4x^3*sin(x^4). Explicitly use
1. 1 answer
2. 594 views
In what fields would a lab technician need to separate & identify organic items?I looked it up and it said organic chemistry,
1. 2 answers
2. 603 views
The voltage generated by the zinc concentration cell described by,Zn(s)|Zn2 (aq, 0.100 M)||Zn2 (aq, ? M)|Zn(s) is 24.0 mV at 25
1. 1 answer
2. 1,038 views
The voltage generated by the zinc concentration cell described by,Zn(s)|Zn2 (aq, 0.100 M)||Zn2 (aq, ? M)|Zn(s) is 24.0 mV at 25
1. 1 answer
2. 868 views
In a reaction Mg(s) + 2HCl(aq) → H2(g) + MgCl2(aq), 6.00 g of Mg was present at 0.00 min. After 3.00 min, 4.50 g of Mg
1. 3 answers
2. 3,440 views
To what extent did economic factors, national identity, and the federal government maintain continuity and foster change in the
1. 1 answer
2. 504 views
Which of the following is not a use for radioactive isotopes?a.as tracers for diagnosing a disease b.as an additive to paints to
1. 0 answers
2. 663 views
a basketball team won 60% of the first 70 games it played. there are 40 games still to be played in the season. How many of the
1. 1 answer
2. 504 views
Determne the boiling point of 16.3g of calcium chloride dissolved in 250. g water.My work: 16.3 g CaCl2 *(1 mole CaCl2/110.984 g
1. 1 answer
2. 840 views
if I have a package of 470 beads and the package costs $8.90 how much is each individual bead?
1. 1 answer
2. 341 views
How much heat (in kilojoules) is required to warm 11.0 g of ice, initially at -14.0 ∘C, to steam at 112 ∘C? The heat
1. 1 answer
2. 2,150 views
ughhhhhh! PA is so hard! my teacher is constantly comparing us to the regular math saying that if we can't figure it out then we
1. 1 answer
2. 517 views
What are the rights of public official/figures vs a private citizen?Thanks for the help!
1. 4 answers
2. 582 views
Find the range of f(x)=-4.7+1 for the domain {-1,3,5,8}^thats all the problem says, HELP^
1. 1 answer
2. 406 views
A 55.0 kg diver steps off a diving board and drops straight down into the water. The water provides an upward average net force
1. 1 answer
2. 3,261 views
When a chemist dilutes pure acid with another substance, the resulting mixture is no longer pure acid. Consistent with the
1. 1 answer
2. 633 views
To increase the acidity of soil, you can add peat, which contains a complex acid mixture known as humic acid. The complexity of
1. 0 answers
2. 697 views
One manufacturer needs to calculate the net price of an order with a list price of $700 and a trade discount series of 11/9/6
1. 1 answer
2. 1,223 views
One manufacturer needs to calculate the net price of an order with a list price of â€‹$700 and a trade discount series of
1. 1 answer
2. 732 views
A tree that sheds its leaves in the fall is exhibiting. A geotropismB photomotropism C phototropism D photoperiodism
1. 7 answers
2. 2,415 views
Assume: A 78 g basketball is launched at anangle of 54.5 ◦ and a distance of 10.4 m from the basketball goal. The ball is
1. 1 answer
2. 917 views
If a solution containing 107.68 g of mercury(II) perchlorate is allowed to react completely with a solution containing 17.796 g
1. 1 answer
2. 1,738 views
B2O3(s) + 3C(s) + 3Cl2 (g) ---> 2 BCl3(g) + 3CO(g)How many moles of chlorine are used up in a reaction that produced 0.35 kg of
1. 1 answer
2. 1,227 views
2NO(g) + O2 (g) --> 2NO2How many grams of NO are required to react fully with 5.00 mol of O2? I do not understand any of this
1. 1 answer
2. 2,045 views
What is the meaning behind the poem "you are reading this too fast" by ken norris?
1. 1 answer
2. 774 views
Triangle XYZ below is an isosceles triangle with legs XY and ZY. QR and QS are perpendicular bisectors of triangle XYZ. Find the
1. 1 answer
2. 922 views
Hi, I have been trying to figure this one math problem for awhile and I am stuck. I believe the answer is between A or B.Skip is
1. 1 answer
2. 497 views
What is the cordinates for the midpoint with the endpoints given?(3,5) (-2,0)
1. 1 answer
2. 410 views
Concentrated nitric acid is 70% HNO3 and 14.7 M. What is the density of the solution?
1. 1 answer
2. 964 views
What is the oxidation state of chromium in cr2o7^-2
1. 3 answers
2. 779 views
1. Which of the following could be an engineering project that could better protect the planet?-finding a new landfill site
1. 5 answers
2. 984 views

Pages

1
2
3
4

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2025