Ask a New Question

(NH4)2CO3 + NH3+[CO(OH2)6](NO3)2+H2O2

(NH4)2CO3 + NH3+[CO(OH2)6](NO3)2+H2O2
1. 0 answers
2. asked by ALEXELBIANCONERO
3. 700 views
Consider the following decomposition reaction of ammonium carbonate ((NH4)2CO3):(NH4)2CO3 (s)  2 NH3 (g) + CO2 (g) + H2O (g)
1. 1 answer
2. asked by Ana
3. 1,768 views
complex reactions of Co(NO3)2.6H2O+(NH4)2CO3+NH4OH+H2O2
1. 1 answer
2. asked by SHLAW
3. 612 views
Ammonium carbonate decomposes upon heating according to the balanced equation: (NH4)2CO3(s) -> 2NH3(g)+CO2(g)+H2O(g)Calculate
1. 0 answers
2. asked by Stephanie
3. 1,181 views
H2O2→ O2 + 2H+ + 2e- OCl- + 2H+ + 2e-→ H2O+ Cl- H2O2(aq) + OCl-(aq) → H2O(l) + Cl- (aq) + O2(g)Assign oxidation numbers to
1. 1 answer
2. asked by B
3. 5,402 views
A galvanic cell is based on the following half-reactions at 25C:Ag+ + e- --> Ag H2O2 + 2H+ + 2e- ---> 2H2O (not H2O2) Predict
1. 2 answers
2. asked by Andrew
3. 4,833 views
For my Biology Lab I have to create a graph showing my results. We used an enzyme, and put in a substrate (H2O2). Every 10, 30,
1. 0 answers
2. asked by John
3. 543 views
Initial rate of rxn of H2O2(aq)->H2O+ 1/2 O2(g) is found at 1.7x10(-3)M/s and is constant for 2min. You start with 160ml of 16M
1. 2 answers
2. asked by Matt
3. 453 views
A 2.00 ml sample of an aqueous solution of hydrogen peroxide, H2O2 (aq) is treated with an excess of Kl (aq). The liberated I2
1. 1 answer
2. asked by Saira
3. 706 views
A 2.00 ml sample of an aqueous solution of hydrogen peroxide, H2O2 (aq) is treated with an excess of Kl (aq). The liberated I2
1. 3 answers
2. asked by Sara
3. 829 views