Ask a New Question
(NH4)2CO3 + NH3+[CO(OH2)6](NO3)2+H2O2
Similar Questions
Consider the following decomposition reaction of ammonium carbonate ((NH4)2CO3):
(NH4)2CO3 (s) 2 NH3 (g) + CO2 (g) + H2O (g)
1 answer
complex reactions of Co(NO3)2.6H2O+(NH4)2CO3+NH4OH+H2O2
1 answer
Ammonium carbonate decomposes upon heating according to the balanced equation: (NH4)2CO3(s) -> 2NH3(g)+CO2(g)+H2O(g)
Calculate
0 answers
H2O2→ O2 + 2H+ + 2e- OCl- + 2H+ + 2e-→ H2O+ Cl- H2O2(aq) + OCl-(aq) → H2O(l) + Cl- (aq) + O2(g)Assign oxidation numbers to
1 answer
more similar questions