write the balanced chemical equation for reaction the following chemical reaction

ozone gas, O3 , reacts with 3,3,4,4,5,5-hexamethyl-1-hexyne, H-C�ßC-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas , H2O .

When balancing the equation , use the molecular formula of the organic compound

I am not sure how to write the initial equation:

O3 + ?? --> CO2 + H20

1 answer

For the ?? in your equation, substitute the formula you have in the problem. Then it's just a matter of balancing it.
Similar Questions
    1. answers icon 1 answer
    1. answers icon 1 answer
    1. answers icon 4 answers
  1. The substances before a chemical reaction occurs.Column B a.Valence electrons b.Ion c.Law of Conservation of Matter d.Chemical
    1. answers icon 1 answer
more similar questions