Write the balanced chemical equation for reaction the following chemical reaction

ozone gas , O3 , reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 , to produce carbon dioxide gas, CO2 , and water vapor, H2O

1 answer

.

O3 + CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 → CO2 + H2O
Similar Questions
    1. answers icon 1 answer
    1. answers icon 1 answer
  1. The substances after a chemical reaction occurs.a.Valence electrons b.Ion c.Law of Conservation of Matter d.Chemical bonds
    1. answers icon 1 answer
  2. The substances before a chemical reaction occurs.Column B a.Valence electrons b.Ion c.Law of Conservation of Matter d.Chemical
    1. answers icon 1 answer
more similar questions