.
O3 + CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 → CO2 + H2O
ozone gas , O3 , reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 , to produce carbon dioxide gas, CO2 , and water vapor, H2O
O3 + CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 → CO2 + H2O
The balanced chemical equation for this reaction is:
O3 + CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 -> CO2 + H2O
Please note that this equation represents the overall reaction, but the actual reaction might involve multiple steps and intermediates.
Step 1: Write the chemical formulas for all the reactants and products.
Ozone gas: O3
2,3,4,5-tetramethylheptane: CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3
Carbon dioxide gas: CO2
Water vapor: H2O
Step 2: Write the unbalanced equation by using the chemical formulas from Step 1.
O3 + CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 -> CO2 + H2O
Step 3: Balance the equation by adding coefficients to the molecules to ensure equal numbers of atoms on both sides of the equation.
Looking at the atoms present in the equation:
Oxygen (O): There are 3 oxygen atoms in the ozone gas (O3) and 2 oxygen atoms in the carbon dioxide (CO2) product.
Carbon (C): There is 1 carbon atom in the heptane reactant and 1 carbon atom in the carbon dioxide product.
Hydrogen (H): There are 18 hydrogen atoms in the heptane reactant, and 2 hydrogen atoms in the water product.
To balance the oxygen atoms, we need to add a coefficient of 2 to the ozone gas and carbon dioxide:
2 O3 + CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 -> 2 CO2 + H2O
To balance the hydrogen atoms, we need to add the coefficient 9 to the water vapor:
2 O3 + CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 -> 2 CO2 + 9 H2O
And now the balanced chemical equation for the given reaction is:
2 O3 + CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3 -> 2 CO2 + 9 H2O