Ask a New Question

Question

Explain why this reaction is not feasible:CH3CHO^-Na^+ + CH3C(CH3)2Cl=CH3CH2O(CH3)2OCH3. ;->Becos of ion charge of Oxygen and Na in the cpd reacting with non ionic cpd
11 years ago

Answers

Destiny
Becos of the diffence form of cpd dat react
11 years ago

Related Questions

Explain the reaction mechanism of the following reaction by showing the types of bond splitting and... Explain the reaction that would occur in a galvanic cell between solutions of Al3+ and Pb2+. Identif... explain the reaction that occurred when a piece of steel wool is added to vinegar explain how allergic reaction occurs Explain the reaction of Asian producers to purchases by European consumers. (1 point) A. • They adj... Explain what the reaction of the Sioux to a good crop shows about the Sioux people Explain why this reaction is considered a redox reaction Explain: Why does the reaction proceed more quickly when the surface area is increased? Explain your reaction to your results. Health Science: Careers in this cluster involve patient car... Explain your reaction to your results.
Ask a New Question
Archives Contact Us Privacy Policy Terms of Use