Search: mathematically, how to prove we

mathematically, how to prove we cant divide by zero. and why multiplication of zero with any number... I know mathematically I can write chemical reactions this way but in chemistry can I if now why?... mathematically Evaluate without using tables 2 log base 10 raised 2 power 5 + log base 10 36 - log b... I have two mathematically similar shapes, one of which has a volume of 1 litre and one which has a v... THESE TINS ARE MATHEMATICALLY SIMILAR. ONE HOLDS 400ml AND THE OTHER HOLDS 800ml. THE HEIGHT OF THE... Show mathematically that to produce an image that is the same size as the object in a concave mirror... Can lotto be win mathematically? If yes what is the formula to produce genuine Numbers differentiate mathematically, between resistances in series and in parrallel Using mathematically and graphically define utility Mathematically, why is a manhole cover round? Using mathematically precise language, explain in detail how you would multiply the complex number... Mathematically determine the resultant force if two forces A and B act on an object. Force A is 85N... I asked "Show mathematically that to produce an image that is the same size as the object in a co... A mathematically inclined friend emails you the following instructions: "Meet me in the cafeteria th... A mathematically defined curve that is the comparison distribution used in ANOVA is called the:... Prove each of the following identities. a)tan^2x = 1 – cos^2x/cos^2x b)sinx/1 – sin^2x = tanx/cosx... If x+y=45°, prove that {(cotx+1)(coty+1)}/{cotx×coty}=2 Please help me in this TRIGONOMETRY pro... Prove 3(x+1)(x+7)-(2x+5)² is never positive So, 3(x+1)(x+7)-(2x+5)(2x+5) =3(x²+8x+7)-(4x²+20x+... . Prove that -x - y = -y – x; for all integers x and y. Given:AD=20 AC=15 Prove:CD=5 Sn=(n^2+n)^1/2 - n Prove that Sn < 1/2 for all n If A+B+C=2S then prove that cos (S-A) + cos (S-B) + cos (S-C) + cos S = 4 cos A/2 cos B/2 cos C/2. if a,b,c, are in h.p. prove that a^2+c^2> 2b^2 ? answer= 1/a,1/b, and 1/c are in h.p. =1/b-1/a=1/c-1... prove that x^6-x^5-x^4-x^3-x^2-x+1>0 is true for any number Please someone explain to me this, I... Prove that |x+y+z| is less than or equal to |x|+|y|+|z|. Please try to show working and explain if A+B+C=π prove that sin(B+2C)+sin(C+2A)+sin(A+2B)=4sin(B-C)/2 sin(C-A)/2 sin(A-B)/2 Prove that: x - tan^-1(x) = tan^-1{(tanx - x)/(xtanx + 1)} plz help if x=1/(2-3^1/2) prove that x^3-2x^2-7x+5=3 prove that : cos^3(θ)sin^2(θ)=1/16[2cos(θ)-3cos(θ)-5cos(θ)] Prove if f(p) = 0 where abs(f) is continuous at p, then f is continuous at p. Note: we have only lea... prove that b^2=4ac prove the ff: a.) sin(x/2) - cos(x/2) = +-sqrt(1 - sin(x)) b.) tan(x/2) + cot(x/2) = 2csc(x) IfA=340°, prove that 2cosA/2 = -(v1+sinA) - (v1-sinA) IfA=340°, prove that 2sinA/2 = -(v1+sinA) + (v1-sinA) prove that tan^2x+ sec^2x =1 Prove that cos(A+B) + sin(A-B) = 2sin(45°+A)cos(45°+B) Prove that cos^6A+sin^6A=1/4(1+3cos^22A) prove sin(x+y)+sin(x-y)/cos(x+y)+cos(x-y)=tanx prove that (2×4×6×8×....2016)-(1×3×5×...2015)is divisible by 2017 Prove that:sin(x+2y)+sin(y+2z)+sin(z+2x)=4sin(x-y)/2sin(y-z)/2sin(z-x)2 I want to prove that JM is parallel to KL. Prove that if 3n^2+5 is odd, then n is even. Please post a detailed answer. Thank you. prove cos(x+y) / cos(x-y) = (1-tan x tan y)/(1+tan x tan y) prove that tan(π/4+x/2)+tan(π/4-x/2)=2sec x How do I prove the following Identity? sec x(sec x-cos x)=tan^2x If there is a certain website... Prove That 0/0=2 prove that cos 52 + cos 68 + cos172 = 0 Prove: sin^212+sin^221+sin^239+sin^248=1+sin^29+sin^218 Prove csc(pi/2-x)=sec x. a. csc(pi/2-x)=1/sin(pi/2)cosx+cos(pi/2)cosx=sec x b. csc(pi/2-x)=1/sin... Prove that- tan^-1(1/2tan 2A)+tan^-1(cotA)+tan^-1(cot^3A) ={0,ifpi/4<A<pi/... prove dat Cos(18°) = 1/4√10+2√5 Prove that if c^2 = a^2 + b^2, it does not follow that a = b + c. Any help would be appreciated.... Prove that cos(A+B+C)+cos(-A+B+C)+cos(A-B+C)+cos(A+B-C)/sin(A+B+C)+sin(-A+B+C)-sin(A-B+C)+sin(A+B-C... prove (a) A(+B)=AB & (b) A+B=A+B both algebraically and using the truth table. Prove that {NOT, AND, NOR} are universal... Prove (A1 + A2 +...+ An)^T = A1^T + A2^T +...+ An^T using Mathimatical Induction. How to prove that the {The integral with limit a to b *(the integral with limit x to b f(t)dt}dx=in... Prove that a^3 ≡ a (mod 3) for every positive integer a. What I did: Assume a^3 ≡ a (mod 3) is... 2k+3=15 k=4 but prove why this is true using what you already know prove that 1+1/4+.........+1/n^2<2-1/n Prove that 20^22 - 17^22 + 4^33 - 1 is divisible by 174. Prove 3+4+5+...+(n+2) = [n(n+5)]/2 for n>4 Do the first step in a proof by induction. How to prove this (e^(2^-1 i3pi) - e^-(2^-1 i3pi))/(2i) = -1 if you could show me this that wo... Prove that sin(A+B+C+)cos(B+C)-cos(A+B+C)sin(B+C)=sinA (1) Prove: If AB = 5x, BC = 2x –4, and AC = 52, then x = 8. (2) Prove: If AB = CD, then AC = BD. how to prove that (a^2-b^2)^3+(b^2-c^2)^3+(c^2-a^2)^3=3 (a^2-b^2)(b^2-c^2)(c^2-a^2) please help If x : y = a : b, prove that x : y : (x + y) = a : b : (a + b) Prove that (a,0),(0,b) and (1,1) are collinear,if 1/a+1/b=1. prove that 2 2 2 2 (n-1) + n + (n+1) = 3n +2 Someone please help me prove these A) cos^4x-sin^4x=cos2x B)tanx=sin^2x/1+cos^2x Pl... Prove that 0! = 1 Prove that if A∩B = A∪B then A=B. Having troubles figuring this one out. If A + B + C = π, prove that: ( sin2A + sin2B + sin2C ) / ( sinA + sinB + sinC ) = 8 sin(A/2) sin(B... If xy log(x+y) = 1, prove that dy/dx = -y(x^2y +x+ y)/x(xy^2 + x + y) Prove cos^2 α + cos?^2 β + cos^2 γ = 1 . Thank You prove that (sin^4x-cos^4x)/(sinx-cosx) = sinx+cosx prove (tan^3x/1 tan^2x) (cot^3x/1 cot^2) = (1-2sin^2x cos^2x)/sinx cosx Prove the following to be an identity (cotx + cscx)*(1-cosx)=sin x Prove that ab=(a,b)[a,b] Prove that if x ∉ B and A ⊆ B, then x ∉ A. Prove that, H^2=P^2+B^2 Prove that (2a,4a), (2a,6a) and (2a+a root3,5a) are vertices of an equilateral triangle. Why 0!=1 Plz help me to prove this statement. prove that 1-t^2/1+t^2 AB = AE BC = DE prove 1 = 2 prove cot x -tan x = 2 cot 2x 6.Prove that tan y cos^2 y + sin^2y/sin y = cos y + sin y 10.Prove that 1+tanθ/1-tanθ = sec^2θ+... Can you please help me prove that ((1-cosx)/(1+cosx))=(cscx-cotx)^2? I can only do work on one si... Prove: 2 - sec^x / 1+ tan ^x = cos 2x prove that 2+2=5 6. Prove that tan λ cos^2 λ + sin^2λ/sin λ = cos λ + sin λ 10. Prove that 1+tanθ/1-tanθ = sec... 7. Prove that tan B sin B + cos B = sec B. 11. Prove that tanλ cos^2λ +sin^2λ/sinλ = cos λ... How do I prove that tan(x/2) =( plus/minus) sqrt(1-cos(x/1+cos(x)) prove that 1/2 * 1/3 * 1/4 * ... ..... ... ..... ..... .... ....... .... ... ....1/99 < 1/2 if abc=1 prove that 1/(1+a+b^-1) + 1/(1+b+c^-1) +1/(1+c+a^-1) =1 how to prove cos^2A(1+tan^2 A)=1 I can't seem to prove these trig identities and would really appreciate help: 1. cosx + 1/sin^3x... Prove: if a>0 and b>0, and a^2>b^2, then a>b. Prove that tan 22 1/2 ° = √2 - 1