Ask a New Question

If CH3COOH is an acid,

Rank following acids frommost to least acidic:hydrocyanic acid (HCN) Ka = 6.2 × 10−10 hypoiodous acid (HOI) Ka = 2 × 10−11
1. 2 answers
2. asked by susan
3. 2,129 views
A buffer is prepared using acetic acid, CH3COOH, (a weak acid) and sodium acetate, CH3COONa (which provides acetate ions, the
1. 4 answers
2. asked by kevin
3. 3,808 views
A buffer is prepared using acetic acid, CH3COOH, (a weak acid, pKa = 4.75) and sodium acetate, CH3COONa (which provides acetate
1. 12 answers
2. asked by kevin
3. 3,259 views
The major component of vinegar is acetic acid CH3COOH. Which of the following reactions represents the balanced equation between
1. 1 answer
2. asked by GRACE
3. 871 views
Acetic acid is a weak acid with the formula , CH3COOH, the Ka for acetic acid is 1.76 x 10-5.In aqueous solution, acetic acid
1. 1 answer
2. asked by jhope
3. 1,415 views
the acid-dissociation constanstant for acetic acidCH3COOH(aq)<->H+(aq)+CH3COO-(aq) is known to be 1.8X10^-5 at 25C Caclulate G0f
1. 0 answers
2. asked by o
3. 645 views
1 (A) This relation gives the dissociation constant of acetic acid (CH3COOH)Ka = [H3O+][CH3COO-]\[CH3COOH] Starting from this
1. 2 answers
2. asked by Petty
3. 840 views
The [H3O+] of a solution with pH = 3 is-10 M. 10 M. 1 x 10-3 M. 1 x 103 M. 1 x 10-11 M. Identify the acid(s) and base(s) in the
1. 1 answer
2. asked by amanda
3. 728 views
ChemsitryThe IUPAC name of acetic acid, CH3COOH(aq), is ethanoic acid. It ionizes in water as shown below: CH3COOH (aq) + H2O
1. 5 answers
2. 133 views
he IUPAC name of acetic acid, CH3COOH(aq), is ethanoic acid. It ionizes in water as shown below:CH3COOH (aq) + H2O (l) →
1. 1 answer
2. 147 views