Ask a New Question
Menu

Diethylamine, (C2H5)2NH, is a weak

  1. Diethylamine, (C2H5)2NH, is a weak base with Kb = 6.92Ɨ10āˆ’4 at 25 oC.For a 0.133 mol Lāˆ’1 solution of (C2H5)2NH at 25 oC,
    1. answers icon 1 answer
    2. sara asked by sara
    3. views icon 1,317 views
  2. Diethylamine (C2H5)2NH, is a weak base that ionizes in water,a 0.600 M solution of (C2H5)2NH is 4.65% ionized at 25 degrees
    1. answers icon 1 answer
    2. Chris asked by Chris
    3. views icon 1,219 views
  3. It is important that diethylamine used in during the DEET (mosquito synthesis) reaction was dry (free from water). Why is this
    1. answers icon 1 answer
    2. Johnny asked by Johnny
    3. views icon 481 views
  4. 5. The tetraethyl lead [Pb(C2H5)4] in a 25.00-mL sample of aviation gasoline was shaken with 15.00mL of 0.02095M I2. The
    1. answers icon 1 answer
    2. robie miranda asked by robie miranda
    3. views icon 1,648 views
  5. CH3(C2H5)CHC(C2H5)UCH(CH3)CH((C2H5)2)Looking for skeletal diagram and formula
    1. answers icon 3 answers
    2. Swati asked by Swati
    3. views icon 684 views
  6. What is the IUPAC name of CH3CH(C2H5)CH=CH(C2H5)CH3?
    1. answers icon 2 answers
    2. Izzy asked by Izzy
    3. views icon 1,729 views
  7. A 4.86 kg sample of a solution of the solute chloroform in the solvent (C2H5)2O that has a concentration of 1.91 pph by mass
    1. answers icon 2 answers
    2. Scott asked by Scott
    3. views icon 742 views
  8. What compounds gives diethylamine, on reduction with lithium aluminum hydride?
    1. answers icon 1 answer
    2. johny asked by johny
    3. views icon 419 views
  9. How can weak acid nitrous acid HNO2 form a buffer solution with equal concentrations and volumes with weak base NH3?I thought
    1. answers icon 1 answer
    2. mike asked by mike
    3. views icon 820 views
  10. Which statement about weak bonds is correct?A. Weak bonds are transient and easily reversible. B. Weak chemical bonds form only
    1. answers icon 1 answer
    2. views icon 39 views