CH3-COOH-CH-COO- 3-hydroxybutyrate or β-hydroxybutyrate I

CH3-COOH-CH-COO-3-hydroxybutyrate or β-hydroxybutyrate I have no idea why this is named what it is named. I know that the COO
1. 2 answers
2. asked by Lena
3. 784 views
Which of the following acids is expected to be the strongest acid?CH2F-COOH CF3-COOH CH3-COOH CCl3-COOH CBr3-COOH i chose
1. 2 answers
2. asked by danny
3. 811 views
One chirality of CH3CHCICOOH is shown below.COOH | C H3C/ \CI - - - H Identify the image(s) below that excibit the opposite
1. 1 answer
2. asked by Anonymous
3. 597 views
What is the conjugate base of the following substances:a. (CH3)3NH /(CH3)3N b. H3N-CH2-COOH / H3N-CH2-COO c. H3N-CH2-COO /
1. 1 answer
2. asked by help
3. 974 views
Which of the following carboxylic acids is the least soluble in water?Question 22 options: a) CH3 COOH b) CH2 H5COOH c) C3H7COOH
1. 3 answers
2. 120 views
Rank from decreasing to increasing the effect the functional groups have on the melting point of compound x:-OH or -COOH i think
1. 2 answers
2. asked by un
3. 973 views
From the following information, determine ΔH°f of malonic acid, CH2(COOH)2(s).CH2(COOH)2(s) + 2O2(g) → 3CO2(g) + 2H2O(l);
1. 1 answer
2. asked by Jake
3. 3,019 views
what is the name of the compound (cooh)ch=ccl(cooh)
1. 1 answer
2. asked by mak
3. 407 views
An impure sample of (COOH)2 · 2 H2O that has a mass of 4.3 g was dissolved in water and titrated with standard NaOH solution.
1. 2 answers
2. asked by Big Boy
3. 702 views
An impure sample of (COOH)2 ·2 H2O thathas a mass of 3.4 g was dissolved in water and titrated with standard NaOH solution. The
1. 3 answers
2. asked by lois
3. 2,852 views