In equilibrium expressions it's the right hand side divided by the left hand side with each concentration raised to a power indicated by the coefficient in the balanced equation. Did you make a typo in A? Did you intend to write
[CH3COO-][H3O+]/[CH3COOH][H2O]
What is the equilibrium expression for the following acid dissociation reaction?
CH3COOH + H2O --><-- CH3COO- + H3O+
A. [CH3COO-][H3O+]/[CH3COOH][H3O]
B. [CH3COOH][H2O]/[CH3COO-][H3O+]
C. [CH3COOH]/[CH3COO-][H3O-]
D. [CH3COO-][H3O+]/[CH3COOH]
How do you do this problem. Can somebody help me out please?
3 answers
The answer is D
DrBob sucks tbh