Ask a New Question

the acid-dissociation constanstant for acetic acid

CH3COOH(aq)<->H+(aq)+CH3COO-(aq) is known to be 1.8X10^-5 at 25C

Caclulate G0f forCH3COO-(aq).
G0f=-396.56KJ/mol for CH3COOH (aq), 0 Kj/mol for H+
explain your answer

Ask a New Question or answer this question.

Similar Questions

1 (A) This relation gives the dissociation constant of acetic acid (CH3COOH)Ka = [H3O+][CH3COO-]\[CH3COOH] Starting from this
1. 2 answers
Acetic acid is a weak acid with the formula , CH3COOH, the Ka for acetic acid is 1.76 x 10-5.In aqueous solution, acetic acid
1. 1 answer
What is the equilibrium expression for the following acid dissociation reaction?CH3COOH + H2O CH3COO- + H3O+ A.
1. 0 answers
What is the equilibrium expression for the following acid dissociation reaction?CH3COOH + H2O --><-- CH3COO- + H3O+ A.
1. 3 answers

more similar questions