Ask a New Question

Using IUPAC nomenclature, name the following compound: CH3CH(NH2)CH2CH(CH3)OH

1 answer

2-amino-2-methyl-3-hydroxybutane

Ask a New Question or answer this question.

Similar Questions

Using IUPAC nomenclature, name the following compound: CH3CH(NH2)CH2CH(CH3)OH
1. 3 answers
provide the iupac name,ch3ch(c3h7)ch2ch2ch2ch2ch(c4h8)ch2ch(ch3)ch3
1. 0 answers
name the following compound: CH3CH(NH2)CH2CH(CH3)OH
1. 1 answer
NOName this compound according to IUPAC nomenclature rules. Responses A nitrogen oxidenitrogen oxide B nitrogen oxygennitrogen
1. 1 answer

more similar questions