provide the iupac name,ch3ch(c3h7)ch2ch2ch2ch2ch(c4h8)ch2ch(ch3)ch3

Similar Questions

1. Using IUPAC nomenclature, name the following compound: CH3CH(NH2)CH2CH(CH3)OH
   1. 3 answers
2. Using IUPAC nomenclature, name the following compound: CH3CH(NH2)CH2CH(CH3)OH
   1. 1 answer
3. name the following compound: CH3CH(NH2)CH2CH(CH3)OH
   1. 1 answer
4. Name and draw the molecular structure of this compound CH3CH(C2H5)CH(CH3)CH(C3H7)CH2CH3
   1. 1 answer

more similar questions