Please write the balanced chemical equation for reaction the following chemical reaction

ozone gas, O3, reacts with 3,3,4,4,5,5-hexanmethyl-1-hexyne, H-C≡C-C(CH3)2-C(CH3)2-C(CH3)2-CH3 to produce carbon dioxide gas, CO2 , and water gas, H2O

When balancing the equation , please use the molecular formula of the organic compound

1 answer

3C12H22 + 35 O3 ==> 36CO2 + 33H2O
Similar Questions
    1. answers icon 1 answer
    1. answers icon 1 answer
    1. answers icon 4 answers
  1. The substances before a chemical reaction occurs.Column B a.Valence electrons b.Ion c.Law of Conservation of Matter d.Chemical
    1. answers icon 1 answer
more similar questions