Ask a New Question

CH2=CH-CH2CH3+H2O

What is the product of the reaction above

1 answer

Ch3-ch2ohch3

Ask a New Question or answer this question.

Similar Questions

what is the major product of this reaction CH2=CH-CH2CH3+H2O H2SO4
1. 1 answer
The reaction are free radicals what are the product...1)CH3-CH2-CH2 +CH3-CH2CH3 2)CH3-CH2-CH3 +CH3-CH-CH3 3)CH3-CH2-CH2
1. 2 answers
PROvide a systematic name for this compound : CH3CH2CH2CH(CH3)CH2CH(CH2CH3)CH(CH2CH2CH3)CH(CH3)CH2CH3
1. 1 answer
What is the IUPAC name of the following compounds?a) ---CHO ---I CH3CCH3 ---I ---CH2CH3 b) -----------CH3 -----------I
1. 1 answer

more similar questions