CH2=CH-CH2CH3+H2O What is the product

PROvide a systematic name for this compound : CH3CH2CH2CH(CH3)CH2CH(CH2CH3)CH(CH2CH2CH3)CH(CH3)CH2CH3
1. 1 answer
2. 73 views
What is the IUPAC name of the following compounds?a) ---CHO ---I CH3CCH3 ---I ---CH2CH3 b) -----------CH3 -----------I
1. 1 answer
2. asked by long
3. 848 views
CH2=CH-CH2CH3+H2OWhat is the product of the reaction above
1. 1 answer
2. asked by erica
3. 2,193 views
what is the major product of this reaction CH2=CH-CH2CH3+H2O H2SO4
1. 1 answer
2. asked by bryan
3. 1,536 views
The reaction are free radicals what are the product...1)CH3-CH2-CH2 +CH3-CH2CH3 2)CH3-CH2-CH3 +CH3-CH-CH3 3)CH3-CH2-CH2
1. 2 answers
2. asked by Wendy
3. 997 views
1. name this compound..........CH2CH3 ........../ hydrocarbon hectagon shaped ring ..........| ..........CH3 CH2CH3 are to the
1. 0 answers
2. asked by mary
3. 642 views
What is the IUPAC name for the following molecules:1. CH3CH2N(CH2CH2CH3)CH2CH3 2. CH3CH2N(CH3)CH2CH3 I tried
1. 1 answer
2. asked by George
3. 1,690 views
what is the name of (ch3)2chch2ch(ch2ch3)ch(oh)ch2ch3
1. 5 answers
2. asked by Marcos
3. 2,742 views
What is the name of this alkeneCH3-CH2-CH-CH=C-CH3 | | BR CH2CH3
1. 0 answers
2. asked by Jay
3. 462 views
please name this compoundCH3 | CH=C-CH-CH-CH3 | CH2 | CH3 H H \ / C=C / \ CH3 CH2CH3 CH3-CH2 H \ / C=C / \ H CH2-CH-CH3 | CH3
1. 1 answer
2. asked by mary
3. 1,077 views