CH2=CH-CH2CH3+H2O What is the product

  1. PROvide a systematic name for this compound : CH3CH2CH2CH(CH3)CH2CH(CH2CH3)CH(CH2CH2CH3)CH(CH3)CH2CH3
    1. answers icon 1 answer
    2. views icon 109 views
  2. What is the IUPAC name of the following compounds?a) ---CHO ---I CH3CCH3 ---I ---CH2CH3 b) -----------CH3 -----------I
    1. answers icon 1 answer
    2. long asked by long
    3. views icon 901 views
  3. CH2=CH-CH2CH3+H2OWhat is the product of the reaction above
    1. answers icon 1 answer
    2. erica asked by erica
    3. views icon 2,232 views
  4. what is the major product of this reaction CH2=CH-CH2CH3+H2O H2SO4
    1. answers icon 1 answer
    2. bryan asked by bryan
    3. views icon 1,600 views
  5. The reaction are free radicals what are the product...1)CH3-CH2-CH2 +CH3-CH2CH3 2)CH3-CH2-CH3 +CH3-CH-CH3 3)CH3-CH2-CH2
    1. answers icon 2 answers
    2. Wendy asked by Wendy
    3. views icon 1,038 views
  6. 1. name this compound..........CH2CH3 ........../ hydrocarbon hectagon shaped ring ..........| ..........CH3 CH2CH3 are to the
    1. answers icon 0 answers
    2. mary asked by mary
    3. views icon 680 views
  7. What is the IUPAC name for the following molecules:1. CH3CH2N(CH2CH2CH3)CH2CH3 2. CH3CH2N(CH3)CH2CH3 I tried
    1. answers icon 1 answer
    2. George asked by George
    3. views icon 1,753 views
  8. what is the name of (ch3)2chch2ch(ch2ch3)ch(oh)ch2ch3
    1. answers icon 5 answers
    2. Marcos asked by Marcos
    3. views icon 2,788 views
  9. What is the name of this alkeneCH3-CH2-CH-CH=C-CH3 | | BR CH2CH3
    1. answers icon 0 answers
    2. Jay asked by Jay
    3. views icon 487 views
  10. please name this compoundCH3 | CH=C-CH-CH-CH3 | CH2 | CH3 H H \ / C=C / \ CH3 CH2CH3 CH3-CH2 H \ / C=C / \ H CH2-CH-CH3 | CH3
    1. answers icon 1 answer
    2. mary asked by mary
    3. views icon 1,107 views