Question

Is this a correct structure?

CH3CH2
CH3CHCHCH2CH3
CH3

with a name of 3-ethyl 4-methyl hexane?
I don't know how you have it bonded, but it appears to me to be pentane (only five in the long chain
For 3-ethyl 4-methyl its : CH3-CH2-CH(C2H5)-CH(CH3)-CH2-CH3

Related Questions

What are the condensed structure of each of the following: a.)2-pentene b.)1chloro 3 metyl 2 -penten... Name the compound (CH3)2CHCCCH3 1. 2-methyl-3-pentyne 2. 3-methyl-1-pentyne 3. 5-methyl-2-penty... what does the structure of 2-ethyl- 3-methyl-4-ethyl -heptane look like? IS a correct name for it...