Ask a New Question

Question

What is the structure of the addition polymer that results from polymerization of 2-chloropropene.
15 years ago

Answers

Dr Russ
This is tricky to draw!!

C(CH3)(Cl)=CH2, will dimerise to

C(CH3)(Cl)-CH2-(CH3)(Cl)=CH2 and so on

so the repeat unit is

[C(CH3)(Cl)-CH2]n
14 years ago

Related Questions

1. How was the structure of state government changed under governor Governor Carroll Cambell? a. Bi... What structure(s) would be most helpful in studying the selective pressures in an environment? Expla... How might the structure of the first passage best be distinguished from that of the second passage?... Which structure should you use if you don’t know in advance how many times a loop should execute?... What is structure? just the answer what is the structure of an atom Genre and Structure Structure reflects the chosen genre and narrative type and any patterns assoc... How does the structure of a text influence the reader's understanding of the story? (1 point) Influe... How does the structure of a text influence the reader's understanding of the story? (1 point) Respo...
Ask a New Question
Archives Contact Us Privacy Policy Terms of Use