provide the iupac name,ch3ch(c3h7)ch2ch2ch2ch2ch(c4h8)ch2ch(ch3...

I am trying to synthesize CH3CH2CH2CH2CL from only 2HC=CH2, and am unsure about which mechanism to u...

CH3CH2CHO + 2Ag(NH3)2OH = CH3CH2COONH4+2Ag+H20+3NH3 yield of Ag obtained = 75% calculate minimum...

provide the appropriate IUPAC name for the following alcohol. designate e or z 8 carbon chain do...

name the compound CH3CH=C(CH3)CH(CH3)2.

What is the IUPAC name of CH3CH(C2H5)CH=CH(C2H5)CH3?

Name of CH3CH(Br)CH=CHCH(CH3)2.

Are CH3CHICH3 and CH3CH(I)CH3 the same? I saw websites that used CH3CHICH3.

23.780 g of acetaldehyde (CH3CHO) reacts completely with oxygen to produce acetic acid (HC2H3O2) usi...

Provide the correct IUPAC name for (NH₄)₂C₂O₄

Provide the correct IUPAC name for AgC₂H₃O₂

Asked by shakirudeen