Ask a New Question

calculate the bond dissociation energy for the following reaction:

C5H10O(s)+5O2=5CO2(g)+5H2O(I)

1 answer

The bond dissociation energy for this reaction is 890 kJ/mol.

Similar Questions

Methane burns in oxygen. the equation below represents this reactionCH^4 + 2O^2 -> CO^2 + 2H^2O O=O bond = 500 k/J C=O bond =
1. 1 answer
Calculate ∆H˚ for the following reaction using the given bond dissociation energies.CH4 (g) + 2O2 (g) --> CO2 (g) + 2H2O (g)
1. 1 answer
Use the table to answer the question:Bond Bond Energy H-H 432 Cl-Cl 239 H-Cl 427 Explain how you would calculate the total
1. 1 answer
BondBond Energy H-H 432 CI-CI 239 H-CI 427 2:26 • I LTE (36) Mark as Complete Use the table to answer the question: Explain
1. 1 answer

more similar questions