Question

What is the equilibrium expression for the following acid dissociation reaction?
CH3COOH + H2O --><-- CH3COO- + H3O+

A. [CH3COO-][H3O+]/[CH3COOH][H3O]
B. [CH3COOH][H2O]/[CH3COO-][H3O+]
C. [CH3COOH]/[CH3COO-][H3O-]
D. [CH3COO-][H3O+]/[CH3COOH]

How do you do this problem. Can somebody help me out please?
DrBob222
In equilibrium expressions it's the right hand side divided by the left hand side with each concentration raised to a power indicated by the coefficient in the balanced equation. Did you make a typo in A? Did you intend to write
[CH3COO-][H3O+]/[CH3COOH][H2O]
Anonymous
The answer is D
ortaga
DrBob sucks tbh