What is the equilibrium expression for the following acid dissociation reaction?

You need to indicate your thoughts on these. What do you the answers are and why. For example, this looks straight forward to me; i.e., you just plug in the definition.

The correct equilibrium expression for the given acid dissociation reaction:

CH3COOH + H2O ⇌ CH3COO- + H3O+

is:

A. [CH3COO-][H3O+]/[CH3COOH]

so the answer is A.

To determine the equilibrium expression for the given acid dissociation reaction, we need to write the expression using the concentrations of the products and reactants.

The balanced equation for the reaction is: CH3COOH + H2O -> CH3COO- + H3O+

The equilibrium expression is written by multiplying the concentration (or partial pressure for gases) of the products and dividing it by the concentration (or partial pressure) of the reactants. The coefficients in the balanced equation represent the stoichiometry of the reaction.

Thus, the correct equilibrium expression for the given acid dissociation reaction is:

A. [CH3COO-][H3O+]/[CH3COOH]