Ask a New Question

Calculate the change in entropy. enthalpy and Gibbs energy under standard conditions for the reaction of the formation of glycine

CH3 (NH2)COOH1>CH2(NH2)CONHCH2COOH1+H2O1.298 k

glycine

1 answer

Indicate your specific subject in the "School Subject" box, so those with expertise in the area will respond to the question.

Similar Questions

For the reaction,3C2H2(g) ===> C6H6 at 25°C, the standard enthalpy change is -631 kJ and the standard entropy change is -430
1. 4 answers
Give the enthalpy change and entropy change values shown below calculate the free energy change for this reaction at 25 degrees
1. 1 answer
for the reaction 3C2H2=> C6H6 at 25 C, the standard enthalpy change is -631 KJ and the standard entropy change is -430 J/K.
1. 1 answer
for the reaction 2C2H2(g)=>C6H6(l) at 25 C, the standard enthalpy change is -631 kJ and the standard entropy change is -430 J/K.
1. 2 answers

more similar questions