Ask a New Question

What is the correct name of the compound that is incorrectly named 1-chloro-3-pentyne?

1 answer

Is that ClCH2CH2C(triplebond)CCH3?
How about 5-chloro-2-pentyne?

Similar Questions

Name the compound (CH3)2CHCCCH31. 2-methyl-3-pentyne 2. 3-methyl-1-pentyne 3. 5-methyl-2-pentyne 4. 4-methyl-2-pentyne 5.
1. 3 answers
Name the compound(CH3)2CHCCCH3 1. 2-methyl-3-pentyne 2. 3-methyl-1-pentyne 3. 5-methyl-2-pentyne 4. 4-methyl-2-pentyne 5.
1. 1 answer
Explain how to draw their structure?1. 2-methyl-3-pentyne 2. 3-methyl-1-pentyne 3. 5-methyl-2-pentyne 4. 4-methyl-2-pentyne 5.
1. 1 answer
what would the chemical equation look like for each IUPAC name 4-phenyl-2-pentyne b. 2-phenyl-3-pentyne c. 3-phenyl-4-pentyne d.
1. 1 answer

more similar questions