Asked by M
What is the correct name of the compound that is incorrectly named 1-chloro-3-pentyne?
Answers
Answered by
DrBob222
Is that ClCH2CH2C(triplebond)CCH3?
How about 5-chloro-2-pentyne?
How about 5-chloro-2-pentyne?
There are no AI answers yet. The ability to request AI answers is coming soon!
Submit Your Answer
We prioritize human answers over AI answers.
If you are human, and you can answer this question, please submit your answer.