xX_Supaman_Xx

This page lists questions and answers that were posted by visitors named xX_Supaman_Xx.

Questions

The following questions were asked by visitors named xX_Supaman_Xx.

In FLAG FOOTBALL, how many players are allowed on the field at one time and what are their positions' names? Please help, I'm in Australia and Football just ain't as big as it is in some other countries.

when writing log b to base a, (log-a(subscript)-b), can a be less than 0?

Can you please check my answers. 1) What carries energy through wire? electrons 2) What happens to some of the energy when it moves through the wire? becomes lost due to the movement of energy requiring some kinetic energy 3) If a resistance is large, why...

How does sin(c+h)=sin(c)xcos(h)+cos(c)xsin(h) please explain

I've been told that sin(c+h)=sin(c)xcos(h)+cos(c)xsin(h) but how? please explain

Differentiate ln(x)-1 I have d/dx lnx-1 = d/dx(ln x)- d/dx1 = d/dx(ln x) = 1/x Could you tell me if this is right or not? If not, please suggest the right working out.

Solve d/dx x(ln(x)-1) I had: =d/dx xln(x) - d/dx 1 =d/dx ln(x)^x =x^(-x-1) [and this is wrong] Can someone show me the correct answer and working please?

how would i solve the differential equation dx/dt=-kx^2 i.e. solve for x as a function of t. I've been told to rearrange the equation to yield dx/x^2=-k dt but what can and should I do now?

What is the main linguistical difference between the phrases; 1. Je m'en vais and 2. J'y vais

Solve the following differential equation, i.e. solve for y: dy/dx - y/x = 1/x + y + 1 I have this so far, 1. dy/dx= (y + 1 + xy + x)/x 2. x dy = (y + 1 + xy + x)dx 3. Integrate both sides... xy + c = xy + x + .5x^2y + .5x^2 + k where c and k are constant...

hey guys, i follow you up to the point of intergrating the final line. How would I intergrate [x^-2.e^-x] dx thx

Can the words "les hommes du maison" be translated to both "the men of the house" and "the men from the house" or just one of them?

In terms of bomb calorimetry, can one assume the temperature of the water surrounding the cmopartment is equal to the temperature within the compartment? If not, how would one determine T for the reaction occuring inside the compartment?

In thermodynaics, what is the relationship between enthalpy (H) and heat (q) - [at constant pressure]?

In the formation of sulfur hexaflouride, does the reaction at constant pressure or volume proceed more spontaneously? I've done the calcs to show that at constant volume, it is slightly more spontaneous, but I can't seem to find a good reason why... it mi...

Answers

The following answers were posted by visitors named xX_Supaman_Xx.

diameter= sqr[(6^2+(-2)^2)+(4^2+0^2)] therefore, radius= (sqr[(6^2+(-2)^2)+(4^2+0^2)])/2 = ?

see my other response

HOCl forms from OCl- + H+ and vice versa. the anion is hypocholrite (OCl-). Given the attaching proton is positively charged and out of O and Cl, O is more nucleophilic (Cl has the highest electronegativity), the H will attach to the O atom making the oxy...

d/dx x^2+3x = 2x+3