Questions and answers by

sh

Questions (141)

Act2 scene4Macduff:They were suborn'd: Malcolm and Donalbain, the King's two sons, Are stol'n away and fled, which puts upon
1. 2 answers
2. 636 views
In how many ways can 4 students from a group of 9 be seated in a row of 4 chairs?I tried 9C4 = 126, 126C4 am I going the right
1. 2 answers
2. 738 views
Write the expression without using the factorial symbol.(n+1)!/(n-1)! my work: (n+1)!/((n+1)(n-1)!) =1/(n-1)? Thanks in advance.
1. 4 answers
2. 823 views
write each expression without using the factorial symbol.1)(n-3)! ----- n! 2) (n+4)! ------- (n+2)!
1. 2 answers
2. 549 views
determine the domain of the function y=log(subscript/little x)(8-x)so x^y = 8-x how do I find the domain?
1. 0 answers
2. 857 views
Aluminum is burned in O2 to give Al2O3. 74g of aluminum are mixed and reacted with 56g O2. What mass of aluminum oxide is
1. 5 answers
2. 804 views
suppose sinx=1/5, cosy=2/3, and x and y are in the first quadrant. determine sin (x+y)
1. 1 answer
2. 668 views
as-tu eu mal a la tête?this one you don't replace "a la tête" with y right?
1. 2 answers
2. 389 views
reply in pronounsas-tu donné des papiers a tes amis a l'école? tu leur y en as donné is this right? or is it tu les leur y as
1. 2 answers
2. 456 views
solve algebraically, express the roots in exact form2sinxcosx-1=0 I got: 2sinxcosx=1 sin^2x=1 what do I do next? thanks in
1. 0 answers
2. 491 views
verify the pythagorean identity numerically, for the value:2.4 cos^2 2.4 + sin^2 2.4 = 1 is this is a special angle? :S thanks
1. 3 answers
2. 617 views
ab+cd=34ac+bd=38 ad+bc=43 what is a+b+c+d=? multiple choice: a)15 b)16 c)17 d)18 e)19 First, I tried guessing and testing, but
1. 2 answers
2. 2,771 views
acetic acid + copperCH3COOH + Cu -> CuCH3COOH? hyrdrogen peroxide (catalyzed by manganese dioxide) H2)2 -(MnO2)> H2 + O2? thanks
1. 3 answers
2. 587 views
solve for 0=/<x<2pi6sin^2x + sinx - 1 = 0 Ahh, forgot how to factor. 3cos^2 - 2cos - 1 = 0 (3cosx + 1 )(cosx - 1) cosx= -1/3, 1
1. 3 answers
2. 555 views
solve each equation for 0=/<x=/<2pisin^2x + 5sinx + 6 = 0? how do i factor this and solve? 2sin^2 + sinx = 0 (2sinx - 3)(sinx
1. 7 answers
2. 945 views
Solve each equation , then write the general solutioncos(pi/2(x+1))=cospi/2 x x=1.5, 3.5 general solution: 1/2+4n but the back
1. 3 answers
2. 846 views
What evidence suggests the carbon-carbon bonds in benzene are different from bonds in alkanes and alkenes?Currently, I have 2
1. 2 answers
2. 785 views
why is it possible to use fractional distillation to separate hydrocarbons in petroleum?Is it because the temperature is high
1. 6 answers
2. 715 views
On a typical day at an ocean port, the water has a maximum depth of 20m at 8:00AM. The minimum depth of 8m occurs 6.2h later.
1. 2 answers
2. 2,044 views
I have the same question as Chopsticksdetermine the emperical formula of the compound 25.3%copper, 12.9%sulphur, 25.7% oxygen,
1. 2 answers
2. 592 views
Not sure about some grammarmerci beaucoup Un moment mémorable de mon enfance était avec mon grand-père et moi(do i need "et
1. 3 answers
2. 748 views
Calculate the molar mass of the compound3.01x10^23 molecules of compound Z have a mass of 9g is it 3.01x10^23molescules x
1. 2 answers
2. 635 views
If you had one mole of pennies to divide among all the people in the world, how many dollars would each person receive? Use
1. 4 answers
2. 762 views
How many carbon atoms contain the same amount of mass as one molybdenum atom?I don't think I learned about molybdenum atoms.
1. 2 answers
2. 1,101 views
hmm..are the tenses correct? It is still a bit difficult on when to use passe compose and when to use imparfait, eventhough I
1. 4 answers
2. 988 views
how many moles of zinc atoms are need to supply the same number of atoms as 56.0g of argon?#mol Zn=56.0gAr x 1mol/40g = 1.40mol
1. 2 answers
2. 610 views
a pundit is a---person and is often a critic in their line of work. a.bad,b.good,c.learned,d.fat. my answer is (c)
1. 1 answer
2. 987 views
the mom left the room with a modicum of respect after her baby began---. a.sleeping,b.screaming,c.praying ,d.singing.my answer
1. 1 answer
2. 628 views
there is nothing miniscule about our --let alone our universe. a.planet,b.cars,c.doors, d.monitors.my answer is (a)
1. 1 answer
2. 619 views
a walk would invigorate you after a tiring day,especially if you are---... a.hungry,b.smelly,c.injured,d.tired.my answer is (d)
1. 1 answer
2. 855 views
teaching was innate to mrs.johnes as both her parents had been----. a.cruel,b.students,c.dull,d.teachers. my answer is (d)
1. 1 answer
2. 493 views
the room was gaudy with it's----leather couch and purple walls.a.soft,b.bright pink,c.black,d.small.my answer is (b)
1. 2 answers
2. 1,421 views
the denouement of the --- proved to be a total surprise. a.mother,b.house,c.movie,d.candy.
1. 3 answers
2. 940 views
the ---were flouting the rules when they took home more deer than they had licenses for.
1. 1 answer
2. 1,001 views
the--- was able to dissemble himself as a friendly car salesman.a.little old man,b.women,c.farmer,d.criminal.my answer is (d)
1. 1 answer
2. 1,733 views
the denouement of the --- proved to be a total surprise. a.mother,b.house,c.movie,d.candy.
1. 3 answers
2. 689 views
the---was a conflagration,causing several buildings great damage. a.fire,b.smoke ,c.snow,d.flood.my answer is (a)
1. 1 answer
2. 986 views
the---- showed no change during the photosynthesis process .a.dogs, b.plants,c.pictures,d.babies.my answer is (b)
1. 2 answers
2. 715 views
the couple orderd ---- for hors d' oeuvres at the wedding. a.soup, b.cake, c.pumpkin pie, d.stuffed mushrooms. my answer is (d).
1. 1 answer
2. 2,320 views
the new employee had aplomb,he required ---- assistance. a.no , b.much,c.huge,d.alot.my answer is (a)
1. 3 answers
2. 1,418 views
please explain how to figure out subshellsThe number of subshells is the same as N. If N = 1 we have 1 subshell If N = 2, we
1. 0 answers
2. 602 views