Ask a New Question

Questions and answers by

joel

Questions (81)

According to Marc, why did he and his first wife split up?
1. 0 answers
2. 89 views
Solve the equation or formula for the variable indicated.7 t = x , for t
1. 1 answer
2. 110 views
what is the mean absolute deviation? 8 2 2 5 3 7 8
1. 1 answer
2. 284 views
there are 135 people in a sports center73 people use the gym 73 people use the swimming pool 67 people use the track 36 people
1. 1 answer
2. 874 views
Find the following limits analytically if they exist.Enter INF for positive infinity and -INF for negative infinity. If a limit
1. 1 answer
2. 394 views
a(b-x)=CX
1. 1 answer
2. 136 views
There are 231 cubic inches in a gallon. A rectangular pitcher has a 4-inch by 5-inch base and a height of 10 inches. How many
1. 3 answers
2. 587 views
calculate the tax paid by a single person earning #110 600per annum
1. 1 answer
2. 399 views
Question 1 of 10Multiple Choice: Please select the best answer and click "submit." A closet contains 8 pairs of pants, 10
1. 2 answers
2. 899 views
What is the ratio for the surface areas of the cones shown below, given that they are similar and that the ratio of their radii
1. 1 answer
2. 3,242 views
How many centavos are equal to P2.50?
1. 1 answer
2. 444 views
I am a 2-digit number. My ones is 3 more than my tens and the sum of my digits is 11. What number am I ?
1. 6 answers
2. 3,080 views
.) Dino gathered 72 eggs from one poultry house and 48 from another. How many more eggs did he gather from the first house?
1. 1 answer
2. 514 views
I am a 2 digits number. My ones is 3 more than my tens and the sum of my digits is 11. What number am I?
1. 3 answers
2. 555 views
how many centavos are equal to P2.50
1. 3 answers
2. 421 views
how many numbers are greater than 22 but less than 32?
1. 2 answers
2. 439 views
Which of the sentences below is an excerpt taken from "In Another Country" by Ernest Hemingway is an example of irony? A. My
1. 0 answers
2. 814 views
use the method of substitution to solve the following pairs of simultaneous equation. 2m+n=0,m+2n=3
1. 1 answer
2. 559 views
c. What do the slope and y-intercept mean in the context of this problem?Hint: What do you pay when you step into the cab?
1. 0 answers
2. 1,055 views
Prove that in any triangle ABC Sin2A+Sin2B+Sin2C/SinA+SinB+SinC=8Sin(A/2)Sin(B/2)Sin(C/2)
1. 1 answer
2. 1,078 views
A variable tangent to the ellipse (x/a)^2 +(y/b)^2 meets the parabola y^2=4ax at L and M. Find the locus of the midpoint of LM.
1. 1 answer
2. 650 views
Prove That Sin2A+SIN2B+SIN2C/SINA+SINB+SINC=8SinA/2SINB/2SINC/2
1. 1 answer
2. 961 views
if a 3 gram French fry accelerating at 5 meter's per second. what is he fries force?
1. 2 answers
2. 498 views
light that has a frequency of 1.5 x 1015 Hz.
1. 1 answer
2. 668 views
A sequence has the following pattern 3/2,4,15/2,12,35/2,24.Starting n=1 find the general term for the sequence?
1. 1 answer
2. 486 views
Solutions of sodium carbonate and silver nitrate react to form solid silver carbonate and a solution of sodium nitrate. A
1. 1 answer
2. 2,350 views
A locomotive is running at a constant speed of 100 km/ h. The diameter of driving wheels is 1.8 m. Thestroke of the piston of
1. 0 answers
2. 756 views
A flywheel is making 180 r.p.m. and after 20 seconds it is running at 140 r.p.m. How many revolutionswill it make, and what time
1. 5 answers
2. 6,984 views
A cage descends a mine shaft with an acceleration of 0.5 m/s2. After the cage has travelled 25 metres,a stone is dropped from
1. 1 answer
2. 4,233 views
find the area under the curve y=3log1.2x between x = 1.2 and x = 3
1. 0 answers
2. 399 views
if i have abook of 30 pages and i number each pages, how can i figure the digit number
1. 1 answer
2. 327 views
if i have a book of 30 pages and i want to number each pages what will be the digit for the thirty pages
1. 3 answers
2. 1,085 views
The Horizontal Assymptote for the graph of f(x) = (-6x3 +2x + 5)/(x3-1) is the horizontal line with equation y=___
1. 1 answer
2. 415 views
is it possible for one molecule of salicylic acid to form an ester with a second molecule of the same substance? Use equations
1. 1 answer
2. 448 views
is it possible for one molecule of salicylic acid to form an ester with a second molecule of the same substance? Use equations
1. 1 answer
2. 423 views
A bond that has a $1000 par value (face value) and a contract or coupon interest rate of 11.5. The bonds have a current value of
1. 1 answer
2. 752 views
1) Salary levels are determined by a number of important factors such as the years of experience, education level, job
1. 0 answers
2. 436 views
use each of the digits 0 1 3 4 5 exactly once to write a decimal subtraction problem.the difference must be the same as one of
1. 1 answer
2. 794 views
the amount of metal in the nut?
1. 1 answer
2. 318 views
The average mass of half the number of crabs in a basket is 350g, the average mass of the remaining crabs is 300g. If the total
1. 2 answers
2. 504 views
the moon orbits the earth in a circle (near enough) of radious 3.8x10^8 m, taking 27.3 days to make a complete orbit.what is the
1. 1 answer
2. 1,171 views
There are 2 packets of flour, Y & Z.The ratio of the mass of Y to Z is 4:1. If 26g is added to Z,the ratio of the mass of Y to Z
1. 2 answers
2. 475 views
Essay; show all work. Consider that the age, x, of a unicorn in human equivalent years can be given by the formula f(x) = -
1. 1 answer
2. 494 views
Essay; show all work. Bob’s Barber Shop estimates their gross revenue for the second quarter to be given by the polynomial 2x3
1. 1 answer
2. 544 views
Dresden was a German city destroyed by the allies in WWII. Which of the following most likely describes the allusion to Dresden?
1. 2 answers
2. 1,245 views
Copán is one of the most impressive sites for ruins of the ancient Maya civilization. Situated in western Honduras, Copán is
1. 4 answers
2. 1,233 views
What is the historical allusion?For the last several months, Rebecca had been working with her team on raising money in her
1. 4 answers
2. 660 views
what is the allusion.Last year our school’s finances were in shambles. Overspending and little control over money has resulted
1. 5 answers
2. 865 views
n 1946, Albert Einstein said if he had known the Germans wouldn't succeed in constructing the atom bomb, he "would never have
1. 1 answer
2. 608 views
"One day I'm going to be an astronaut," Adelle told her sister.Did I punctuate correctly?
1. 2 answers
2. 649 views
Jocelyn asked her mom, "What was it like when you were a child?"Did I punctuate correctly?
1. 1 answer
2. 734 views
What did the philosopher Aristotle mean when he said, "To perceive is to suffer"?Did I punctuate correctly?
1. 1 answer
2. 1,788 views
"Maybe we should wait to begin until everyone is seated," Ana said to her band mates.did I punctuate this correctly?
1. 3 answers
2. 703 views
"Ouch, that hurts!," Kadra said after stubbing her toe.is this correct?
1. 2 answers
2. 665 views
When Marcos walked into the room, we turned on the lights and yelled, "Happy birthday!"is this correct punctuation?
1. 2 answers
2. 589 views
Antony invited us over to check out his, "awesome new board."is this correct
1. 3 answers
2. 1,064 views
My mom says "Never wear anything but a suit to a funeral or a wedding."is this correct punctuation?
1. 8 answers
2. 590 views
Ms. Sardelis said we must "absolutely and without delay" turn in our permission slips by tomorrow or we can't go on the class
1. 2 answers
2. 1,074 views
The defendant stated that she was, "not guilty."is this correct punctuation?
1. 2 answers
2. 526 views
we are really stuck on this one we searched the website that you suggested but are still stuck this is what we came up with is
1. 1 answer
2. 916 views
I'm going to be asking for the help for all of usdoes this have correct punctuation? two of us said no and the other two says
1. 1 answer
2. 497 views
Did I punctuate this correctly? "Daddy, why is the sky blue?" Martinique asked her father.the quotation mark goes behind the
1. 2 answers
2. 739 views
Select the set of equations that represents the following situation: Mike invested $706 for one year. He invested part of it at
1. 2 answers
2. 581 views
Write a missing addend addition sentence to help solve 78-49.explain how you would use it.
1. 1 answer
2. 718 views
Tyrell says $750 is about $800.Sara says $750 is about $700.who is correct?explain.
1. 4 answers
2. 812 views
in which number does 4 have the greatest value 9499 4391 2240 1944
1. 1 answer
2. 439 views
I need the complete predicate in this sentence? Ida B. Wells was born into slavery in 1862 in Holly Springs, Mississippi.
1. 1 answer
2. 1,248 views
what is the tan of 25 degrees and 01 minute
1. 2 answers
2. 406 views
Axum's conversion to Christianitya. beneficial b. a drawback c. first a drawback then beneficial d. first beneficial then a
1. 5 answers
2. 846 views
An airplane left an airport and flew east 174 miles. Then it turned northward flying along a bearing of N22E. When it was 254
1. 2 answers
2. 2,025 views
If sinu = -5/7 and pie<u<3pie/2 find 2uDoes anyone know the answer to this (not the steps for solving I know that my answer just
1. 1 answer
2. 510 views
what are the zeroes of the graph 2sin(squared)x + cosx-3 = 0
1. 1 answer
2. 424 views
Given sina= 3/4 and cosB = (-5)/13 and this is Quad II find cos(a+B)
1. 1 answer
2. 560 views
Given sina= 3/4 and cosB = (-5)/13 and this is Quad II find cos(a+B)
1. 1 answer
2. 563 views
how do geologists determine the texture of a rock
1. 0 answers
2. 548 views
what is gnama artea it means Kings must follow laws too.
1. 1 answer
2. 404 views
find the integral of square root of 1+x^3 dx or sqrt(1+ x^3)dx
1. 1 answer
2. 912 views
find the integral of square root of 1+x^3 dx or sqrt(1+ x^3)dx
1. 0 answers
2. 323 views
evaluate: integration of x^2 (square root of (1-2x^3))dx
1. 1 answer
2. 398 views
evaluate: integration of x^2 (square root of (1-2x^3))dx
1. 2 answers
2. 435 views
Question 4. (50 points)In an auction in the market for wholesale electricity, producers of electricity submit bids for each
1. 0 answers
2. 465 views

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2025