Ask a New Question

Questions and answers by

jennifer

Questions (397)

I need help in figuring out the topic sentence I think that the topic sentence is I have never understood my mom's obsession
1. 1 answer
2. 792 views
I am looking for help. I have read this article on They Shut the door on My Grandmother; By Andrew Lam
1. 1 answer
2. 498 views
What is your opinion on the article by Andrew Lam; They Shut the Door on My Grandmother.
1. 2 answers
2. 1,074 views
Which of the following is true of the Internet A. It's an excellent means for filing information. B. It's always going to
1. 2 answers
2. 545 views
The key to maintaining a strong self-esteem isA. being able to bounce back quickly from disappointments. B. not pursuing
1. 4 answers
2. 1,462 views
You have an inactive file. How do you decide if it must be sent to the archives or if it should be destroyed?A. Check the
1. 1 answer
2. 1,143 views
10.5 g sample of copper metal at 25.0°C is heated by the addition of 150.0 J of energy. The final temperature of the copper is
1. 1 answer
2. 865 views
A lactic acid/lactate ion buffer solution contains 0.43M HC3H5O3 and 0.90M C3H5O3-. The value of lactic acid is 1.4*10-4
1. 1 answer
2. 838 views
What mass of HNO3 is needed to prepare 400mL of 0.25N solution?
1. 1 answer
2. 598 views
How many equivalents of an acid or base are in the following? 0.43mol Mg(OH)2 and 2.8g Mg(OH)2?
1. 1 answer
2. 414 views
What volume of 0.076M HNO3 is required to titrate 20.0ML of 0.25M Ba(OH)2 solution? use 2 sig figures
1. 1 answer
2. 690 views
If 32.9mL of 0.170M BaCl2 are needed to react completely with 35.0mL of 0.160M Na2SO4 . How many grams of BaSO4 will be formed?
1. 1 answer
2. 571 views
how many grams of methanol must be added to 5.00kg of water to lower its freezing point to -12.0 degrees C? for each mole of
1. 2 answers
2. 1,231 views
what is the freezing point of a solution that contains 20.2g of urea CO(NH2)2 in 295mL water? Assume a density of water of
1. 1 answer
2. 1,341 views
Prove that 2sin150*cos315*cos(90-x)/sin(360-x)cos(-240)sin135=2
1. 3 answers
2. 528 views
Chemical reaction between solid ammonium chloride and solid barium hydroxide octahydrate
1. 1 answer
2. 982 views
for N2O4(g)-><-2NO2(g) the value of K at 25 degrees C is 7.19*10-3. calculate N2O4 at equilibrium when NO2 =2.80*10-2 mol/L.
1. 1 answer
2. 1,783 views
4HCl(g)+O2(g)-><-2Cl2(g)+2H2O(g) with Hcl=0.80M, Cl2=3.0M, O2=0.20M H2O=3.0M what is the equilibrium constant
1. 1 answer
2. 761 views
I2(g)+Cl2(g)-><-2ICl(g) molar concentrations are I2=1.5M, Cl2=0.60M and ICl=5.0M calculate the ratio of products to reactants
1. 1 answer
2. 1,231 views
Fe3O4 can be reduced by treatment with hydrogen to yield iron metal and water vapor write the balanced equation. this process
1. 1 answer
2. 1,191 views
methanol CH3OH is used as race car fuel write the balanced equation for the combustion of methanol. change in heat= -174kcal/mol
1. 1 answer
2. 2,023 views
How much heat in kilocalories is absorbed in the reaction of 1.94g of Na with H2O? 2Na(s)+2H2O(l)->2NaOH(aq)+H2(g) change in
1. 3 answers
2. 833 views
During the combustion of 5.00g of octane C8H18, 239.5 kcal is released. Write a balanced equation for the combustion reaction.
1. 2 answers
2. 3,507 views
24,8% of potassium ,34,77% of Mn,40,5% of oxygen how do i find the emperical formular thanks in advance
1. 2 answers
2. 389 views
seems to justify a departure from traditional presentations of music and culture of the Caribbean?
1. 1 answer
2. 567 views
Water is falling on a surface, wetting a circular area that is expanding at a rate of 9 mm2/s. How fast is the radius of the
1. 1 answer
2. 1,075 views
A rectangular field is to be enclosed on four sides with a fence. Fencing costs $8 per foot for twoopposite sides, and $2 per
1. 2 answers
2. 3,573 views
What is denoted by "Caribbean music in a new mode."
1. 1 answer
2. 1,029 views
how do prove that this equation has rational roots for all rational values of K 3x^2+kx-k=3x
1. 1 answer
2. 1,716 views
why is the poem "Fable for when there's no way out" a good example of "seeing common things in an uncommon way?"
1. 4 answers
2. 2,472 views
what lines show alliterations in the poem "Fable for when there's no way out"
1. 2 answers
2. 2,325 views
Describe how the separation of (1) authorization of production transactions, (2) recording of these transactions, and (3)
1. 1 answer
2. 678 views
what is an equation of a parabola with the given vertex and focus? Vertex: (-2,5); focus: (-2,6)
1. 6 answers
2. 12,350 views
Given the equation y equals one third x + 7 what would it be easy y value for the corresponding x value of 18
1. 1 answer
2. 409 views
sarah is twice as old as katie. 10 years ago, the sum of their ages was 23. How old are they now
1. 1 answer
2. 525 views
What is Eugenics and what were the goals and policies of the American Eugenics movement?
1. 1 answer
2. 545 views
A card is chosen at random from a deck of 52 cards It is then replaced and then a second card is chosen.What is the probability
1. 5 answers
2. 4,966 views
Mr snider is tiling a floor .The floor is 16 tiles long and 5 toles wide.How many tiles are in the border section?
1. 1 answer
2. 598 views
I need some help please 7/10 / 1/8+4/5*1/2
1. 1 answer
2. 345 views
it takes a runner 10 seconds to run 100 yards. the runners speed is ?
1. 2 answers
2. 1,547 views
a 12 year old boy presents with his father to er due to open wounds to his arm, hand, and upper leg. the injury occurred when
1. 1 answer
2. 804 views
in general on what stage of the writing process should you spend most of your timea. analyzing your audience b .writing your
1. 1 answer
2. 2,178 views
i need help with the following i need the info to be for OHIO LAWSParticipants Sally Bright asked her husband, John, to move out
1. 2 answers
2. 862 views
Five points lie in the same plane with no three points on the same line. A circle can be drawn through any three of the five
1. 2 answers
2. 721 views
how much sale tax in due for a payment of 993.91
1. 1 answer
2. 360 views
A 236 kg block is released at a 4.2 m height as shown. The track is frictionless except for a portion of length 6.2 m . The
1. 0 answers
2. 557 views
You must show your work for full credit.) Calculate the circular speed of an object that orbits the Sun at a distance of 0.2 AU
1. 0 answers
2. 536 views
There are 6 terms in an A.P. 6th term is 3 times the second term and 4th term is 4 times the first term. if the 5th term is 15
1. 1 answer
2. 608 views
The molar mass of HCl is 36.5g use the fact that 1 amu = 1.6605x 10-24g power g to calculate Avogradro’s number.
1. 1 answer
2. 633 views
solve for -4x=3y=37x-9y-6
1. 1 answer
2. 364 views
alaine has a ribbon that is 14 and one half feet long how long will each strip be if she cuts it into four equal parts
1. 1 answer
2. 399 views
An X-ray binary consists of 2 stars with masses m1 (the accreting compact object) and m2 (the donor). The orbits are circular
1. 1 answer
2. 555 views
Did Neil Perry make any accomplishments in the movie?Also what did Todd Anderson sacrifice to reach his goal of pleasing his
1. 2 answers
2. 428 views
The typical amount of sleep per night for undergraduate college students has a bell shaped distribution with a mean of 7 and a
1. 1 answer
2. 767 views
howard has 3 m of ribbon. how many centimeters is that
1. 1 answer
2. 317 views
two third of a blueberry pie is left in the refrigerator. If the leftover pie is cut in 6 equal size, which fraction of the
1. 4 answers
2. 1,441 views
rectangular prism with a volume of 72 cubic inches; sum of the 3 lengths is 13; width is half of the height; the length is one
1. 4 answers
2. 2,595 views
help- e^1-5x=3find solution to 4 decimal places. I don't know how to type it in to my calculator!
1. 1 answer
2. 402 views
From a survey of 100 college students, a marketing research company found that 50 students owned iPhones, 45 owned cars, and 35
1. 1 answer
2. 1,161 views
A solution is prepared by dissolving 25 grams of sodium sulfate in enough water to give a total volume of 500. mL. The molar
1. 1 answer
2. 841 views
8x/y2*4y/7x
1. 1 answer
2. 280 views
equation d=55h the distance a person drives when traveling 55mph. (h=time in hours, d+ distance in miles.Use equation to
1. 1 answer
2. 694 views
the sum of a number and 14.5
1. 5 answers
2. 740 views
(y^2)^-4y^8 simplify
1. 2 answers
2. 352 views
Which of the following is true of the function of glucagon?A. Glucagon regulates insulin secretion. B. Glucagon increases
1. 2 answers
2. 3,267 views
An April 15, 2002 report in Time Magazine stated that the average age for women to marry in the United States is now 24.9 years
1. 1 answer
2. 993 views
First graders who misbehave in school may be more likely to be regular smokers as young adults according to a new study
1. 0 answers
2. 575 views
In Weeks 9 and 10, you will develop an essay using definition as the rhetorical strategy. This week, you will complete your
1. 1 answer
2. 901 views
The route followed by a hiker consists of three displacement vectors , , and . Vector is along a measured trail and is 1060 m in
1. 0 answers
2. 852 views
Cherenkov radiation is light emitted by a particle moving through a medium with a speed greater than the speed of light in the
1. 0 answers
2. 471 views
I wrote an essay because i'm apply to get into the honor's program.I'm supposed to write about who i was, who i am now, and who
1. 1 answer
2. 1,021 views
A teaching method that uses computers to help children learn is called ?
1. 2 answers
2. 801 views
A sample of 64 statistics students at a small college had a mean mathematics ACT score of 28 with a standard deviation of 4.
1. 1 answer
2. 701 views
A government survey conducted to estimate the mean price of houses in a metropolitan area is designed to have a margin of error
1. 0 answers
2. 564 views
A researcher wishes to estimate the proportion of college students who cheat on exams. A poll of 490 college students showed
1. 1 answer
2. 703 views
the weight of a symetry ball varies directly with the cube of it's radius a ball with the radius of 2 inches weighs 5.60. find
1. 1 answer
2. 675 views
18 young adults you need 108 cups of water and 72 cups of water show how to sclae down this ratio to feed 3 young adults
1. 1 answer
2. 1,069 views
Objects of masses m1 = 4.00 kg and m2 = 9.00 kg are connected by a light string that passes over a frictionless pulley as in the
1. 0 answers
2. 847 views
A researcher has collected statistics pretest scores for students representing 3 different age groups18-30 31-45 45 and up 3 5
1. 1 answer
2. 580 views
a 30 foot ladder leans against a wall at a 71 degree angle of elevztion find the distance of a ladder's base to the wall
1. 1 answer
2. 2,394 views
If scores are normally distributed with a mean of 3.06 and a standard deviation of 0.84, what percent of the scores is: (a)
1. 1 answer
2. 502 views
If scores are normally distributed with a mean of 3.06 and a standard deviation of 0.84, what percent of the scores is: (a)
1. 0 answers
2. 436 views
rectangular roof of hospital has width of80ft, and area of 16,000sq ft. what is length and perimeter of roof
1. 1 answer
2. 1,360 views
give the answer to two decimal places: 89 / 43 =
1. 1 answer
2. 308 views
what is the gist of proximate cause? why do courts struggle with its concept?
1. 0 answers
2. 823 views
p^2+p+4=0
1. 1 answer
2. 241 views
a ball is thrown up with an initial velocity 20m/s. using g=10m/s2,a) what's the maximum height it can reach. b) what is the
1. 2 answers
2. 1,989 views
_ _ _ _ _ _ _ _ _1. Information used to conduct our lives _ _ _ _ _ _ _ _ _ 2. To solve a problem by collecting the necessary
1. 1 answer
2. 513 views
keith scored 75,86,79,91 what score must he receive on on the fifth test to have a mean of 85 ?
1. 1 answer
2. 354 views
3. Indicate whether each of the given statements could apply to a data set consisting of 1,000 values that are all different.a.
1. 2 answers
2. 747 views
need help
1. 1 answer
2. 278 views
using "a,b,c,d,e,f,g" notation, explain the ryme schem of "let me not to the marriage of true minds.
1. 1 answer
2. 416 views
what is the next number in the pattern 5,3,7,5,9,7,11?
1. 5 answers
2. 248 views
what are 3 benifits of food imports into ireland?
1. 1 answer
2. 316 views
When ammonium carbonate decomposes, what would happen to a glowing splint in the presence of the gases that are evolved. Explain
1. 1 answer
2. 3,045 views
In the Atwood's machine of Figure 8-23, the two masses shown are initially at rest at the same height. After they are released,
1. 1 answer
2. 1,555 views
an insulated circular ring of diameter 6.50cm carries a 12.0 A current and is tangent to a very long, straight insulated wire
1. 0 answers
2. 887 views
a college conducted a survey and determined that 68% of the students attending the college owned a car.what is the ratio of the
1. 2 answers
2. 718 views
The angle of depression from the top of a 320 foot office building to the top of a 200 foot office building is 55degrees. How
1. 3 answers
2. 1,667 views
I need to outline a step process to prepare a deposit from multiple payers. can you help?
1. 0 answers
2. 397 views

Pages

1
2
3
4

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2025