Ask a New Question

Questions and answers by

dan

Questions (264)

ratio of4
1. 1 answer
2. 13 views
Use the "My solution mode" in thesimulation to complete the activity. Acid-Base Solutions How could you adjust the settings of
1. 1 answer
2. 63 views
Read the following excerpt from the Fourteenth Amendment: “All persons born or naturalized in the United States and subject to
1. 1 answer
2. 79 views
Which example fulfills the educational requirements to apply for naturalization?A. Must be able to memorize and recite the Oath
1. 1 answer
2. 122 views
Solve for y, then find the value of y when given x = –2.6x = 7 – 4y A. -12 B. 7/4 C. 19/4 D. 24
1. 1 answer
2. 48 views
8 – (3 + b) = b – 9
1. 1 answer
2. 69 views
0.5b + 4 = 2(b + 2)A. b = 0 B. b = 0.5 C. no solution D. identity
1. 1 answer
2. 49 views
–6a + 3 = –3(2a – 1)A. a = 5 B. a = 10 C. no solution D. identity
1. 1 answer
2. 114 views
he core structure of the plasma membrane is a phospholipid bilayer. Phospholipids are molecules composed of a hydrophilic head
1. 1 answer
2. 180 views
Which 2 cranial nerves (ID them by NAME) innervate muscles of mastication?
1. 1 answer
2. 110 views
Which context describes a difference of rational numbers?(1 point)Responses comparing the daily high temperature and low
1. 9 answers
2. 153 views
In recent years, online learning has become a popular option for middle school students. With advances in technology, students
1. 23 answers
2. 213 views
BONUS QUESTION (1 point): Name one type of informational text.(1 point)
1. 7 answers
2. 77 views
What is 12 8/15 − 7 + 7/15 + 15? Simplify your answer.(1 point)Responses 20 15/15 20 Start Fraction 15 over 15 End Fraction 41
1. 1 answer
2. 85 views
Subtract −6−(−8).(1 point)Responses 2 2 14 14 −2 negative 2 −14
1. 3 answers
2. 75 views
Which organ in the excretory system filters blood?(1 point)Responses bladder bladder ureter ureter urethra urethra kidney
1. 7 answers
2. 254 views
A bee eating flowers nectar and picking up the flowers pollen is an example of which one?1 mutualism 2 parasitism 3 neutralism 4
1. 1 answer
2. 135 views
whats an easy way to learn the sum of two numbers is __ and their difference is ___
1. 1 answer
2. 320 views
A total charge of 6.01 mC passes through across-sectional area of a wire in 2.38 s. What is the current in the wire? Answer in
1. 1 answer
2. 1,052 views
Miss Jennifer is buying pencils in packs of 12, notebooks in packs of 16, and red pens in boxes of 20. She needs to have the
1. 1 answer
2. 940 views
Schmaltz, Inc. records its allowance for doubtful accounts based on an analysis of receivables. The current, unadjusted balance
1. 0 answers
2. 536 views
Particle 1 and 2 of charge q1 = q2 = +3.3*10-19 C are on the y-axis at distance d = 17cm from the origin. Particle 3 of charge
1. 0 answers
2. 588 views
Given the circuit below with unknown voltage source and a voltage drop of 2.233 v Volts on resistor R3, with (R1 = 2KΩ, R2 =
1. 0 answers
2. 441 views
Let S be the plane defined by 2x+4y+2z = 4, and let T be the plane defined by x+3y+3z = 2. Find the vector equation for the line
1. 1 answer
2. 1,419 views
Let L1 be the line passing through the points Q1=(3, −3, 4) and Q2=(−3, 6, 7). Find a value of k so the line L2 passing
1. 3 answers
2. 2,307 views
Let L1 be the line passing through the points Q1=(−2, −3, −4) and Q2=(−5, −2, −3) and let L2 be the line passing
1. 3 answers
2. 6,111 views
The parametric equations for a line L1 are as follows:x = −1−2t y = 4+4t z = 3−2t Let L2 be the line parallel to L1 and
1. 1 answer
2. 5,554 views
Starting from a trail 1.0m above the water level, you climb straight up a cliff to a point 15m above the water. You then shallow
1. 1 answer
2. 510 views
The space shuttle had a takeoff acceleration approximately 3.5 times the acceleration due to gravity. What was the speed of the
1. 3 answers
2. 673 views
Find the indicated nth partial sum of the arithmetic sequence.2, 10, 18, 26, . . ., n = 15
1. 1 answer
2. 1,945 views
Find the partial sum.100 Σ 2n n = 1
1. 1 answer
2. 472 views
A hardware store makes a profit of $41,000 during its first year. The store owner sets a goal of increasing profits by $9000
1. 1 answer
2. 1,263 views
jeff jogged 5/6km while jon joghed 7/12km whi jogged longer?by how manu kilometer?
1. 3 answers
2. 2,273 views
jeff jogged 5/6km while jon jogged 7/12km.who jogged longer bu how many kilometers?
1. 1 answer
2. 1,236 views
jeff jogged 5/6km while jom jogged 7/12km.who jogged longer? by how many kilomteres?
1. 1 answer
2. 506 views
A railroad car with a mass of 1.98 ✕ 104 kg moving at 2.92 m/s joins with two railroad cars already joined together, each with
1. 1 answer
2. 609 views
1. A 57 g tennis ball is moving to the left at 36.2 m/s. It collides with a wall and rebounds to the right. The tennis ball is
1. 2 answers
2. 775 views
The spring is compressed against the floor a distance of 1.6 cm and released. If the spring constant is 60 N/m, what is the
1. 1 answer
2. 547 views
In an arcade game, a 0.12 kg disk is shot across a frictionless horizontal surface by being compressed against a spring and then
1. 2 answers
2. 1,902 views
a uniform plank of lenght 5m and a mass1kg support two masses of 500g and 300g . determine the centre of gravity
1. 0 answers
2. 571 views
find the error??The client’s hospital stay was prolonged, do to a superinfection. client’s/stay was/do to
1. 3 answers
2. 1,057 views
Tarzan tries to cross a river by swinging from one bank to the other on a vine that is 11.2 m long. His speed at the bottom of
1. 5 answers
2. 596 views
A pendulum clock has a pendulum shaft made of aluminum which has a coefficient of linear expansion of 24.0*10^-6K^-1. At 22
1. 3 answers
2. 1,122 views
the dollar price for a barrel of oil sold at a certain oil refinery tends to follow the demand equation below where x is the
1. 2 answers
2. 1,081 views
-7-14 :(-7)=
1. 1 answer
2. 251 views
When you add sugar to it, your cup of coffee becomes not only sweet, also fattening.which part is wrong??
1. 4 answers
2. 2,743 views
which part is wrong?When a person finds itself in stressful situation, it helps to breath deeply.
1. 3 answers
2. 499 views
The bottle of tablets has an expired expiration date.which part is wrong???
1. 4 answers
2. 489 views
The physician started to perform the operation but the patient was not yet completely under anesthesia. which part of sentence
1. 3 answers
2. 881 views
A tuberin skin test should be read within 24 hours administered. since-from-as
1. 2 answers
2. 391 views
A term investment of 85000, is madr for 10 years at 4.25% interest. Find the value of the investment at maturity if interest is
1. 0 answers
2. 447 views
solve the equation log(y)/log(2) + log(y)/log(4) = 6
1. 1 answer
2. 422 views
The graph of y=x^2 is transformed by a stretch of scale factor 2 parallel to the x axis, followed by a translation of (0 3).
1. 2 answers
2. 2,245 views
the spanish club is selling t-shirts and baseball caps as a fund raiser if the baseball cap cost $1.13 to make and sell the
1. 0 answers
2. 426 views
Name and draw the molecular structure of this compound CH3CH(C2H5)CH(CH3)CH(C3H7)CH2CH3
1. 1 answer
2. 1,298 views
A boy can row 18km. downstream and return a distance of 16 km. upstream in 5hrs. If the rate of the current is 6km/hr, What is
1. 1 answer
2. 553 views
A boy can row 18km. downstream and return a distance of 16 km/hr upstream in 5hrs. If the rate of the current is 6km/hr, What is
1. 0 answers
2. 493 views
Estimate the speed in mph with which water comes out of a garden hose using your past observations of water coming out of garden
1. 1 answer
2. 541 views
Indicate if subjonctive or infinitif1) Je suis certain qu'il trouve le passeport 2) Est-ce que tu penses qu'il trouve le
1. 11 answers
2. 533 views
Is "where the light falls like rain" an example of an oxymoron?
1. 1 answer
2. 438 views
I have to analyze a poem using figure of speeches.. How do i start it. I found all the figure of speeches in the poem. but im
1. 1 answer
2. 532 views
In the poem Dejeuner du matin, how do we know that there is a problem with the two people
1. 2 answers
2. 852 views
A constant torque of 30m⋅N is applied to the rim of a 6.0-kg uniform disk of radius 0.20m .What is the angular speed of the
1. 1 answer
2. 723 views
What types of flaws does Snowball have in the book Animal Farm?
1. 5 answers
2. 564 views
An object is launched at 9.8 meters per second from a 73.5-meter tall platform. The object's height s (in meters) after t
1. 2 answers
2. 1,108 views
A proton has an initial speed of 7·105 m/s. It is brought to rest by an electric field.a.) What is the magnitude of the voltage
1. 1 answer
2. 810 views
if you get cut a type of metal in two pieces do they both have the same density
1. 2 answers
2. 362 views
Three forces act on a moving object. One force has a magnitude of 62.6 N and is directed due north. Another has a magnitude of
1. 1 answer
2. 1,478 views
20 mL of 0.125 M potassium iodide solution is mixed with 10 mL of 0.1 g L–1 sodiumthiosulfate solution and 0.2 g of solid
1. 1 answer
2. 1,547 views
A long, ideal solenoid has a diameter d=12cm and n=1200turns/meter carrying current I=20A. If the current is lowered at
1. 0 answers
2. 556 views
Plan how you would make 100mL of a buffer solution with a pH of 10.80 to be made using only sodium carbonate, sodium hydrogen
1. 1 answer
2. 732 views
Not sure if i posted this butNeed help with my pH calculations? 0.10 mol of solid sodium hydrogen carbonate and 0.20 mol of
1. 1 answer
2. 937 views
Need help with my pH calculations?1) 0.10 mol of solid sodium hydrogen carbonate and 0.20 mol of solid sodium carbonate are
1. 1 answer
2. 941 views
using pseudocode debug the following 3 programs// A high school is holding a recycling competition // This program allows a user
1. 0 answers
2. 918 views
The Hyperloop is a hypothetical new fast transport system between cities, which works by launching pods that carry people
1. 1 answer
2. 470 views
the class room had 100 students.in 200, there were 6 few men than there were woman.how man women were in the classroom in 2010?
1. 1 answer
2. 400 views
A company was recently formed with $ 50,000 cash contributed to the company by stock-holders. The company then borrowed $ 20,000
1. 0 answers
2. 800 views
102 = 3.14 x 42.25 x h solve for h
1. 1 answer
2. 435 views
What adjective could i use for the following sentence? What a_______ maps this atlas has!
1. 1 answer
2. 763 views
An airplane approaches a runway at a 3 degree angle of depresssion. If the plane is flying at 30,000 ft., find the ground
1. 0 answers
2. 615 views
An airplane approaches a runway at a 3 degree angle of depresssion. If the plane is flying at 30,000 ft., find the ground
1. 0 answers
2. 583 views
cos 17pi/6 + tan 17pi/6
1. 1 answer
2. 754 views
what is 0.0678/100
1. 1 answer
2. 404 views
steve can you explain step by step please8x=5y and 3y=14z then 12x= how many z's
1. 3 answers
2. 460 views
if 8x=5y and 3y=14z then 12x= how many z's
1. 1 answer
2. 1,076 views
compare two cell phone companies and determine which is the better deal. Needs to be in a y=mx+b equation for each company.compa
1. 1 answer
2. 482 views
a 12x12-inch square is divided into n^2 congruent squares by equally spaced lines parallel to its sides. circles are inscribed
1. 1 answer
2. 742 views
a rectangular sheet of paper is folded in half, with the crease parallel to the shorter edge. it happens that the ratio of
1. 2 answers
2. 1,796 views
i have a list of 5 different numbers. the sum of 2 of the numbers is 0. the sum of 2 of the numbers is 1. the sum of 2 of the
1. 2 answers
2. 418 views
is that the area of big or small triangle?
1. 1 answer
2. 354 views
the midpoints of the sides of a triangle are (1,1),(4,3),and (3,5). find the area of the triangle. please answer and show how u
1. 1 answer
2. 542 views
the midpoints of the sides of a triangle are (1,1),(4,3),and (3,5). find the area of the triangle. please answer and show how u
1. 4 answers
2. 451 views
the midpoints of the sides of a triangle are (1,1),(4,3),and (3,5). find the area of the triangle. what is the answer and can u
1. 2 answers
2. 533 views
a rectangular box measures 4 by 5 by 2 meters. what is the length of the longest pole that can fit into the box?
1. 1 answer
2. 469 views
a rectangular box measures 4 by 5 by 2 meters. what is the length of the longest pole that can fit into the box?
1. 1 answer
2. 490 views
amee, ben, carly, and darrien are friends. darrien has no money. amee gives darrien 1/4 of her money. ben gives darrien 1/5 of
1. 1 answer
2. 458 views
describe the picture you would get by graphing the solutions(if there are any!) to the equation (x+y)^2=x^2+y^2
1. 2 answers
2. 405 views
there are 15 boys and 18 girls in fifth grade. Find the ratio of boys to girls in fifth grade.(how do I get the answer) can
1. 7 answers
2. 2,070 views
an object released from rest will fall 16t^2 feet, t seconds after it is dropped. 2 pebbles are dropped, one after the other,
1. 3 answers
2. 608 views
consider the equation x^2+kx+1=0a single fair die(dice)is rolled to determine the value of the middle coefficient, k. the value
1. 1 answer
2. 1,191 views

Pages

1
2
3

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2025