Ask a New Question

Questions and answers by

chris

Questions (796)

Which of the following BEST describes the theory of natural selection?
1. 3 answers
2. 1,729 views
a(1,7),b(-3,1) coordinates of missing endpoint if b is the midpoint of ac
1. 2 answers
2. 2,350 views
A child bounces a 55 g superball on the side-walk. The velocity change of the superball is from 22 m/s downward to 14 m/s
1. 2 answers
2. 1,706 views
given the function f(x)= x+2, find each of the followingf(7), f(-6), f(0)
1. 1 answer
2. 312 views
Maria bicycles 5 km/h faster than Robert. In the same time it takes Robert to bicycle 60 km, Maria can bicycle 75km. How fast
1. 1 answer
2. 604 views
The perimeter of a rectangle is 44ft the length is 4ft longer than the width. Find the demensions. Write a system of linear
1. 1 answer
2. 655 views
Find the number of round trip commuter rail tickets sold.1.Thirty times as many round trip tickets as 12 ride tickets were sold.
1. 0 answers
2. 1,214 views
the length of a rectangle is twice its width w. A second triangle, which is 8cm longer and 3 cm narrower than the first
1. 0 answers
2. 783 views
a boat weighs 1500 lbs more than its motor and 1900 lbs more than its trailer. Together the boat and motor weigh five times as
1. 2 answers
2. 1,088 views
the greater of two consecutive integers is 20 more than twice the smaller. what are the integers
1. 1 answer
2. 829 views
Classify the variable as nominal, ordinal, discrete, or continuous, and explain:Customer’s driver’s license number
1. 2 answers
2. 3,029 views
Two angles are complemtary. The large angle is 1 less than 6 times the smaller angle. which system could be used to determine
1. 1 answer
2. 587 views
Refer to Figure 7-1 of Personal Finance. Why is it important to go through these steps when you are planning on making a large
1. 1 answer
2. 422 views
A student lifts a backpack with a force of 50 Newtons. She lifts the backpack 2 meters off the floor. Calculate the work that
1. 2 answers
2. 820 views
Which of the following changes will decrease the total amount of gaseous solute able to be dissolved in a liter of liquid water?
1. 2 answers
2. 670 views
Which of the following changes will decrease the total amount of gaseous solute able to be dissolved in a liter of liquid water?
1. 2 answers
2. 568 views
what are the differences between competitive and noncompetitive grants?
1. 0 answers
2. 1,052 views
i need an summary on The Home Front
1. 3 answers
2. 431 views
peter bought a computer that cost 1,500. The computer is on sale for 15% off. Peter paid 7% sales tax on the sale price of the
1. 1 answer
2. 744 views
What is the Pythagorean theorem? How is it used?
1. 1 answer
2. 361 views
what are some reading skills
1. 1 answer
2. 436 views
how do you think the existance of nearly 3000 ethnic groups and 800 languages affects life in countries south of the sahara
1. 1 answer
2. 454 views
At a certain temperature, the reactionCO(g) + 2H2(g) <===> CH3OH(g) has Kc = 0.500. If a reaction mixture at equilibrium
1. 3 answers
2. 3,372 views
Create a Flash movie that uses motion animation to change a figure from a large size to a small size and back as it moves from
1. 0 answers
2. 399 views
Decide if each of the following principles were first discovered during Thompson's cathode ray tube experiments, Rutherford's
1. 4 answers
2. 753 views
Solve the initial value problem(dy/dt)+2y=15 sin(t)+15 cos(t) with y(0)=3
1. 1 answer
2. 556 views
Solve the initial value problem(dx/dt)+2x=cos(2t) with x(0)=5
1. 1 answer
2. 960 views
How does the number game work. How does the number game use the skill of simplifying rational expressions?
1. 1 answer
2. 619 views
The weekly take-home pay (in dollars) for 20 graduate teaching assistants at University Z is as follows:500.75,217.43,488.25,405
1. 1 answer
2. 537 views
give an example of projectile motion;include in your explantion the term velocity , accleration and displacement orginality in
1. 1 answer
2. 434 views
Give an example of projectile motion;include in your explantion the term "velocity" , "accleration" and "displacement",
1. 1 answer
2. 445 views
Two person watch the same object move.Marty says it accelerates straight up downward,but joanne claims it falls along a curved
1. 1 answer
2. 430 views
two perons watch the sameobject move marty says it accleartes downward but joanne clams it falls along a curved path describe
1. 3 answers
2. 453 views
give an example of projectile motion;include in your explantion the term velocity , accleration and displacement orginality in
1. 0 answers
2. 386 views
In order to dilute 1L of 6M solution of NaOH to .5M solution, how much water must be added?
1. 2 answers
2. 1,400 views
what is the Molecular equation for the preparation of tetra-aminocopper(II)sulfate hydrate - Cu(NH3)4SO4*H20in the experiment
1. 0 answers
2. 451 views
100- 4 Px + Py +40 = 0100- 4 Py + Px +40 = 0 Solve the above two equations to get Py = Px = 140/3. How would you solve the two
1. 1 answer
2. 407 views
Why is potassium hydrogen phthalate (KHP) a primary standard but sodium hydroxide is not?
1. 1 answer
2. 677 views
Explain vertices and edges
1. 1 answer
2. 381 views
Explain vertices and edges
1. 1 answer
2. 423 views
Use integration by parts to verify|(from -pi to +pi)cosmxcosnxdx = pi when m=n and |(from -pi to +pi)cosmxcosnxdx = 0 when m and
1. 1 answer
2. 516 views
integration of x^2 * cos^2(x)
1. 1 answer
2. 499 views
If 22 grams of water are saturated at 75 degrees celsius with potassium nitrate and then cooled to 40 degrees celsius, how much
1. 0 answers
2. 1,141 views
Why does the inequality sign change when both sides ar multiplied or divided by a negative number?
1. 1 answer
2. 504 views
a boy walks 50m from the bottom of a building lies down and notes that he has to raise his eyes through 42 degree from the
1. 2 answers
2. 369 views
-7x-22=-24 1/3could someone help me Im confused
1. 1 answer
2. 332 views
what issues did the compromise of 1850 leave unsettled
1. 2 answers
2. 555 views
"The truth is that the reader is always right. Chances are, if something you’re reading doesn’t make sense, it’s not your
1. 2 answers
2. 671 views
radius of 4 centimeters and length of 12 centimeters, how many cubic centimeters?
1. 0 answers
2. 373 views
a bag contains 12 black checkers and 12 red checkers. What is the probability of choosing two red checkers?
1. 2 answers
2. 898 views
what action on our part is neccesary to make the dryiceblock move faster and faster,that is accelerate continuosly?if you are
1. 1 answer
2. 396 views
suppose the dry ice block is moving to begin with and we exert a steady force,either speeding up or slowing down.how does the
1. 0 answers
2. 433 views
What is dry ice behavior when acted on by a steady push that keeps up with the block and when it is a given a quick shove.
1. 0 answers
2. 432 views
i have to find a & c, b=2.489*10 to the nineth power and i have one degree 25
1. 1 answer
2. 349 views
A heat pump is proposed that uses 50 degree F ground water to heat a house to 70 Degree F. The groundwater experiences a
1. 1 answer
2. 2,120 views
Calculate the work necessary to compress air in an isolated cylinder with initial and final volumes of 6.0 and 1.2 ft^3,
1. 1 answer
2. 916 views
An air tank with a volume of 20m^3 is pressurized to 10 MPa. The tank eventually reaches room temperature of 25 degree C. If the
1. 1 answer
2. 613 views
One Kg steam with a quality of 0.2 is heated in a piston / cylinder vessel at a constant pressure of 200 KPa unit the
1. 1 answer
2. 490 views
N2 is described by its state properties of temperature @ - 100 Degree C, and pressure @10.0 MPa. Determine if it is reasonable
1. 0 answers
2. 1,282 views
Two cards are drawn without replacement from a deck of 52 cards.Determine P(A and B) where A : the first card is a spade B: the
1. 3 answers
2. 518 views
The air 10 cm diameter cylinder, as shown below, is heated until the spring is compressed 50mm. Find the work done by the air on
1. 0 answers
2. 550 views
What potential problems can arise if a company incorrectly classifies costs? Example, what if an inventoriable cost is
1. 0 answers
2. 463 views
The air 10 cm diameter cylinder, as shown below, is heated until the spring is compressed 50mm. Find the work done by the air on
1. 1 answer
2. 955 views
Energy is added to a piston-cylinder arrangement. The piston is withdrawn in such a way that the temperature remains constant.
1. 2 answers
2. 5,166 views
N2 is described by its state properties of temperature @ -100 degree C, and Pressure @ 10.0 MPa. Determine if it is reasonable
1. 0 answers
2. 448 views
A cylinder contain 3 kg of water and water vapor mixture in equilibrium at a pressure of 500 KN/m^2. If the volume of the
1. 1 answer
2. 1,274 views
If the smaller leg of a 30-60-90 triangle is 4 m, what are the lengths of the longer leg and the hypotenuse?
1. 2 answers
2. 826 views
divide 6358 by 100
1. 1 answer
2. 320 views
Write the trigonometric expression in terms of sine and cosine, and then simplify.cot(x)/csc(x)-sin(x)
1. 1 answer
2. 827 views
The natural stride up a certain staircase has a slope of 3/5, meaning that a run of 5 inches has a rise of 3 inches.The model
1. 1 answer
2. 1,210 views
1.He lived with his parents, brothers, and sisters.2.Those in this small Mexican American community were worried and frightened.
1. 1 answer
2. 629 views
what is slope and y intercept for y=22.048x-19.464
1. 1 answer
2. 308 views
find exact value cos(13pi/15)cos(-pi/5)-sin(13pi/15)sin(-pi/5)
1. 1 answer
2. 1,188 views
find exact value using sum or differnce equations. tan(19pi/12)
1. 1 answer
2. 3,812 views
When a card is selected from a deck, find the probability of getting a diamond, a face card or a diamond, or a club and a king?
1. 1 answer
2. 575 views
an atwoods machine has a solid cylindrical pulley with a mass of 200g and a radius of 10cm. a 1.2 kg mass is hung on one side
1. 1 answer
2. 627 views
�ãx8y5
1. 1 answer
2. 222 views
need to find square root 292
1. 1 answer
2. 335 views
Solve for z4(4-2z)+1=7(x+2(1-z))
1. 1 answer
2. 332 views
determine the distance betwen the two points (5,12) and (11,-4)
1. 1 answer
2. 326 views
what was the acceleration of an object between 8 and 10 seconds if velocity at 8 seconds is 10 mi/hr and 0 mi/hr at 10 seconds?
1. 1 answer
2. 357 views
find a ratio equivalent to the ratio 7 over 9 then use the ratio to write a proportion
1. 6 answers
2. 620 views
Calculations and Data:Angle: As measured by protractor:7.63 degrees As measured by using inverse sin:7.4 degrees Percent error:
1. 1 answer
2. 360 views
if cos Q=5/9, find 5/9
1. 2 answers
2. 488 views
a computer company can sell 1000 computers if they price them at $500. The number sold will increase by 10 for every 1$ decrease
1. 2 answers
2. 949 views
I need help with parametric equations, locus problems, tell me how to solve all questions if you can. Need help with one below:T
1. 1 answer
2. 575 views
bayside insurance offers two health plans. under plan A, Giselle would have to pay the first $130 of her medical bills, plus 40
1. 0 answers
2. 559 views
if you simplify the expression 3x+4(x-2)-3x into the expression 3x+ 4x -8-3x, what property did you useassociative property
1. 1 answer
2. 645 views
What pressure (atm) is exerted by a column of ethanol 65.0 cm high? The density of ethanol is 0.789 g/cm3 and 9.8m/s2 as your
1. 1 answer
2. 823 views
The relationship between volume and pressure (at constant temperature) is directly proportional.my answer- True The relationship
1. 1 answer
2. 714 views
What pressure (atm) is exerted by a column of ethanol 65.0 cm high? The density of ethanol is 0.789 g/cm3 and 9.8m/s2 as your
1. 1 answer
2. 540 views
need some help, A ball with an initial angular velocity of 20.0 rads /s and a rotational inertia of 0.4kgm rolls uphill with an
1. 0 answers
2. 432 views
You can invest in 10 corporate bonds paying 7 percent interest 20 conservative stocks that pay substantial dividends(typically 5
1. 0 answers
2. 520 views
do you believe there are opportunity costs to furthering your education. if so what are they if not why
1. 0 answers
2. 350 views
A ship sets out to sail to a point 174 km due north. An unexpected storm blows the ship to a point 132 km due east of its
1. 1 answer
2. 731 views
Your friend has a cube of gold. You have a cube of gold that weighs twice as much. Your cube is 1.26as long as your friends, and
1. 1 answer
2. 784 views
explain how the wage can adjust to balance the supply and demand for labor while simultaneously equaling the value of the
1. 0 answers
2. 1,077 views
Do you feel there are any imbalances to our wage structure in our economy?
1. 1 answer
2. 368 views
At three pm i will be feeding the ducks.At the park. is this sentence a fragment
1. 1 answer
2. 375 views
Choose two competitor companies that are U.S. GAAP publicly traded companies.
1. 1 answer
2. 505 views

Pages

1
2
3
4
5
6
7
8

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2025