Answers by visitors named: anna

i think you would not circle lunchroom

as a cell prepares to divide ,a dna molecule and its associated proteins

why would you add (8^2 + 15^2)

how did u get the 4?

nevermind my calculator was being stupid. thanks

sorry one more question. so... a road climbs at an 8 degree angle with the horizontal. what is the grade of the road? the answer would be 5?

well this is what i did can someone tell me what i did wrong: tanx= 5/2 since diagonals of a parallelogram bisect each other x= 68 and the other angle would be 22 the angles of the rhombus would be 136 and 44 because the diagonals of a rhombus bisect the angles

THATS WHY I COULDN'T GET THE RIGHT ANSWER! i didn't convert the meters! thank you

yes that's the answer i got drwls thanks the m km messed me up =]

write at least one important fact each person listed. Constine: Crusades: John Wycliffe:

can you find a problem for me plesea

the answers 24. i looked at the answers cus i thought it was 12 too

nope. i figured it out. you have to use pi to find the areas of both pizzas and then their ratio is 1:4 so 6*4 = 24

What is a Comet Star?

is it a comet?

what if i look up adolf hitler wat would it be???

answer

subtract .2b from both sides. 0.3b + 3.4 = 12.4 subtract 3.4 from both sides 0.3b = 9.0 divide both sides by 0.3 b= 30

u might love it but I HATE IT!

ya so Get over the Fact u cant get a life drop out of school.

obvisley cause It is preschool

get a life you dork

can't be done. unless you have more information?

could you provide a link to the painting/sculpture?

for which question? i think there's more than one answer for each, though i'm not sure.

those were three different questions. which one was the answer for?

Some of the post didn't show up. 8.The gold standard would take away monetary regulatory power from the Federal Reserve Bank. True 9.Deflation is good for everyone. False 10.Required reserves are determined by the market demand for loans. True This question involves the Quantity Theory of Money. If the amount of money in circulation increases by 200%, the velocity of money increases by 50%, and there is no change in the number of transactions, how have prices changed? When I did the math I got 450. would that mean that the price increased 350%? I have a feeling I did that one wrong. This question involves value of money: a. Assume that prices have increased 33% from the base year of 2005 to 2009. How much is a dollar worth compared to 2005? I know the equation to use is value of money = 100/ new price index. I'm just confused on how to calculate the new price index. b. How much has the value of the dollar changed by since 2005? ii. This question involves the creation of new money. Suppose TrustUs Bank has a policy of always keeping $30,000 from daily new deposits in reserves in addition to their required reserves. Now assume that throughout the day TrustUs Bank received new deposits totaling $150,000 and the Fed has set the reserve ratio at 15%. (6 points) ii.a. What will be the increase in required reserves, excess reserves, and legal reserves for TrustUs Bank on this particular day? For this I was going to use the new money equation: new money = (new deposits/ reserve ratio)- new deposits. I'm lost on this and would very much like hints. b. Now suppose TrustUs bank again receives $150,000 in new deposits. However, this day they abandon their policy of keeping the extra $30,000 from new deposits in reserves (i.e. they loan out everything other than their required reserves). What is the maximum amount of new loans that will be created in the entire banking system from TrustUs Bank’s new deposits for the day?

9.Deflation is good for everyone. False 10.Required reserves are determined by the market demand for loans. True

I'm sorry for the amount of post some of my post is not showing up. This question involves the Quantity Theory of Money. 1. If the amount of money in circulation increases by 200%, the velocity of money increases by 50%, and there is no change in the number of transactions, how have prices changed? When I did the math I got 450. would that mean that the price increased 350%? I have a feeling I did that one wrong. This question involves value of money: 2. a. Assume that prices have increased 33% from the base year of 2005 to 2009. How much is a dollar worth compared to 2005? I know the equation to use is value of money = 100/ new price index. I'm just confused on how to calculate the new price index. b. How much has the value of the dollar changed by since 2005? ii. This question involves the creation of new money. 3. Suppose TrustUs Bank has a policy of always keeping $30,000 from daily new deposits in reserves in addition to their required reserves. Now assume that throughout the day TrustUs Bank received new deposits totaling $150,000 and the Fed has set the reserve ratio at 15%. a. What will be the increase in required reserves, excess reserves, and legal reserves for TrustUs Bank on this particular day? For this I was going to use the new money equation: new money = (new deposits/ reserve ratio)- new deposits. I'm lost on this and would very much like hints. b. now suppose TrustUs bank again receives $150,000 in new deposits. However, this day they abandon their policy of keeping the extra $30,000 from new deposits in reserves (i.e. they loan out everything other than their required reserves). What is the maximum amount of new loans that will be created in the entire banking system from TrustUs Bank’s new deposits for the day?

I mean what is the k-selected population characterized by?

thanks, but i still can't find any i still can't find any information about the northwestern Florida

please go to this website called angles

oh! thank you. the answer was apalachhee,creek and seminole.

list 3 things that ict covers by coypright and patent act

1. 2-methylpentane 2. 3-methylpentane 3. 1,5-dichloroheptane 4. 1-butanol 5. Pentanoic Acid 6. 2,4-dimethyl-1-pentene 7. 2-chloropropane 8. 2,2,4,4-tetramethylheptane 9. 2,2,4-trimethyl-3-hexene 10. 2-butyne

1. CH3C(CH3)=C(CH3)CH3 2. CH3C(triple bond)CCH(C2H5)CH2CH3 3. CH3CH2C(CH3)2CH2CH2CH(CH3)CH2CH2CH3 4. CH3CH2CH(C2H5)CH(C3H7)CH2CH2CH3 5. CH3CH2CHOHCH2CH2CH2CH2CH3 6. CH3C(CH3)=CHCH2CH3 7. CH2=CHCH2CH2CH(CH3)CH3 8. CH3C(CH3)2CH2CH(CH3)CH(CH3)CH3 9. CH3CH2COOH 10. CH3C(triple bond)CCH2CH3

thanks you!

thank you, where did you get this information?

oh, thank you so much, you have helped me alot :)

thanks for helping me

can you give me some on china?

thanks

thanks alot!

ok. thank you ms.sue :)

umm, do you happen to know the patterns?

i meant the population density patterns

can you please list some sites that would help me get the answer?

would it be under economy?

oh, ok thank you!!

is there a chart or information showing where these people immigrate/migrate the most?

that isn't the absolute location. is it??

i was looking for the absolute location... so it is 35 degrees North and 105 degrees East?

thank you :)

how did mountains both help and hurt ancient greece ?

can it be c

i am sorry ms. sue i still don't get it could you please give me an explanation for 'dummies' thank you

but these are the only answers and there is 26 letters in the alphabet

but these r the only choices a-8 b-92 c-676000 or d-6760000 so what would it be

you take away the y and add an i and then add es and i am sorry :(

yeah because there is a lot of questions but luckily i am almost done :)

THANK YOU MS. SUE ,YOU ARE ALWAYS ANSWERING MY QUESTIONS :)

but my teachers didn't tell me anything to study oh and btw is there anything online that has similar test questions and is there any tips that would help me on the test **i am in the 7th grade**

i worked hard this year thank you all for your help ;)

t=5

any body? need help a.s.a.p

i got this: -the--hirl--se-ies the '-' are blank spaces in the worksheet;) i do not get all of them, but this is helping:D

i need the 5 sentences

What is the probability of rolling a sum that exceeds four with two dice

actualy you can factor out 2

huh?

A. some undiscovered third variable that is independent of nature and nurture has the largest influence on development

use the distributive property so 100*20 and 100*40 then multiply them :)

you just have to add w w w to the website

can u explain to me what you mean by y direction is equal to and for the force *distance *the angle i don't know the angle for the question

okay but can you explain to me how to find N1 and N2

can you please Anonymous and bobpursley explain this to me. Please and thank you

how are elephant and dinosaur and whales are alike

i think its fluorine but im not sure if its right but i do believe that it is not right

f(x)={-x+3, if x <1

In the second segment sent from Host A to B, what are the sequence number, source port number and destination port number

• Write two paragraphs explaining the changes that you would make to revise the paper. The minimum word count for these two paragraphs is 400 words.

could you please help me with this problem

thank you

why living in the country is beter than living in the city i think would be more informal.

Thanks hon!

where did the 12 come from?

oops sorry never mind

How do you know to use cos and not sine?

oh I see thank you very much I totally get it now

of course! thanks!

no because 3*1=3

determine all trig functions of theta using the given info, state the answers correct to the nearest hundredth. cos (theta) = -5/13; tan (theta) < 0

72g

thanks!

and what is the theoretical yield?

A 747 jetliner lands and begins to slow to a stop as it moves along the runway. If its mass is 3.5 x 10^5 kg, its speed is 27.0 m/s and the net braking force is 4.30 x 10^5 N, (A) what id its speed 7.50 s later? (b) how far has it traveled in this time?

(x^9)^0(x^7)^2

does this equal the same amount of moles of HO2CCO2H?

How do you calculate delta T for H2O?

its two i'm looking for it to equal 10