Ask a New Question

Questions and answers by

Lillian

Questions (63)

What is the value of x in Na2CO3XH2O
1. 1 answer
2. 146 views
The total energy of motion in the molecules of a substance is called nuclear energy. true or false?
1. 1 answer
2. 473 views
Amir is trying to determine the author's purpose as he reads the article "The Great Molasses Flood" for history class. He
1. 17 answers
2. 1,485 views
Read the passage below and answer the question.A vague chill had descended on him and his head had seemed to swell, like a
1. 1 answer
2. 628 views
Line segment JM has endpoints with coordinates -2 and 14 on a number line. Points K and L are on segment JM. K has a coordinate
1. 2 answers
2. 1,286 views
Out of 350 students, 315 went on the field class trip. What percent of students did NOT go on the field trip?
1. 1 answer
2. 911 views
A scarf is made of 65% cotton. If the scarf weighs 18 ounces, then how much cotton is the scarf?
1. 1 answer
2. 318 views
Can you guys answer this question in the book Sasquatch Escape chapter 9. What do you think will happen next with Ben, Pearl and
1. 1 answer
2. 416 views
Jenna says that no row or column contains products with only odd numbers. Do you agree? Explain. Can you guys please make sure
1. 4 answers
2. 390 views
Lynn has 4 stacks of quarters. There are 8 quarters in each stack. How many quarters does Lynn have? Can you please make sure
1. 1 answer
2. 524 views
There are 6 teams in the basketball league. Each team has 8 players. How many players are there? Please make sure that the
1. 1 answer
2. 789 views
Lexi has 2 cans of tennis balls. There are 3 tennis balls in each can. She buys 2 more cans. How many tennis balls does she now
1. 4 answers
2. 1,001 views
Write the composite function in the form f(g(x)). [Identify the inner functionu = g(x) and the outer function y = f(u).] (Use
1. 3 answers
2. 14,116 views
Read the following paragraph and then answer the question that follows:Video games can kill! That is what many who support
1. 1 answer
2. 1,085 views
Compare and contrast the key features of Sunni and Shia Islam, and explain how differences between these two sects have
1. 0 answers
2. 2,706 views
1. Flavia tossed two six-sided number cubes and added the numbers together. Which outcomes have a probability of1/12? Select two
1. 18 answers
2. 3,979 views
1. Carey has a bag of marbles. There are 4 red marbles, 5 blue marbles, and 1 green marble. She conducted an experiment in which
1. 13 answers
2. 3,435 views
6. Describe the female reproductive system in a human.7. Describe the male reproductive system in a human. My question was
1. 2 answers
2. 1,221 views
Traditional healers should not allowed to prescribe medicine in hospitals or clinics
1. 1 answer
2. 509 views
A newly couple has $15,000 toward the purchase of a house. For the type and size of house the couple is interested in buying, an
1. 2 answers
2. 1,289 views
In a suburb of Houston, housing costs have been increasing at 5.2% per a year compounded annually for the past 8 years. A house
1. 0 answers
2. 784 views
How many possible lunch combinations can I choose from with 12 meats, 20 side items, 7desserts, and 8 drinks?
1. 2 answers
2. 495 views
Find the domain and range for y=x^2+9.Wouldn't the domain and range just be all real numbers since nothing else is really given
1. 1 answer
2. 655 views
Approximate e^-0.6 to 3 decimal places.I am not sure how to approach this without a calculator. I don't think we are allowed to
1. 2 answers
2. 4,435 views
Perform the indicated operation. Simplify the result, if possible.11 - \frac{5}{4x-5} would you multiply the denominator to both
1. 1 answer
2. 744 views
Evaluate the following expression:sin(cos^-1(12/13)) tan(sin^-1(3/5)) I do not know what the inverse values would be...how would
1. 1 answer
2. 564 views
Multiply and simplify. Assume any factors you cancel are not zero.8/(15x+24y) times (5x+8y)/10 = ?? I multiplied straight across
1. 1 answer
2. 718 views
Multiply and simplify. Assume any factors you cancel are not zero.8/(15x+24y) times (5x+8y)/10 = ?? I multiplied straight across
1. 2 answers
2. 800 views
Alicia wants to build a block pyramid similar to the one shown. block pyramid the top level will always have 2 blocks. Alicia
1. 1 answer
2. 1,164 views
The Genetic information Nondiscrimination Act applies to which insurer
1. 1 answer
2. 579 views
The 9th term of an arithmetic sequence is 12 and the 17th term is 28, find the 4th term of the arithmetic sequences
1. 1 answer
2. 1,089 views
Hello, I had to answer to some questions on the this paragraph of 'The Cask of Amontillado' by Edgar Allen Poe.The paragraph:
1. 1 answer
2. 952 views
Find the theoretical and actual yield of 25.0g Pb(NO3)2+15.0g2NaI=PbI2+2Na(NO2)
1. 1 answer
2. 551 views
if you have a jar filled with candy and every time you take one candy out you put the wrapper back into the jar. the wrapper
1. 0 answers
2. 591 views
Pedro has two options: he can enter raffle number 1, OR raffle number 2 along with raffle number 3. If Pedro chooses to enter
1. 0 answers
2. 993 views
A steamer goes 91 mi up a river in 6.5 h. The return trip is scheduled for 3.5 h. What is the rate of the water?
1. 1 answer
2. 363 views
HelloI am doing a project about the spanish colonial Floridians Time during the time when there was the 13 original colonies.For
1. 3 answers
2. 561 views
According to Kleiber's Law, the metabolic rate P (in kilocalories per day) and body mass m (in kilograms) of an animal are
1. 1 answer
2. 3,193 views
for thr reation: 2AlCl3 + 3H2SO4= Al2(SO4)3 + 6 HClHow many grams of H2SO4 are needed to produce 27.0 grams of Al2(SO4)3
1. 4 answers
2. 938 views
For the reation: C3H8+5 02 =3 CO2+4 H2OHow many moles of C3H8 are needed to make 3.60 grams of H2O? I think the ans is 0.05
1. 3 answers
2. 748 views
For the reation: C3H8+5 02 =3 CO2+4 H2OHow many moles of C3H8 are needed to make 3.60 grams of H2O? I think the ans is
1. 2 answers
2. 633 views
For the reation: C3H8+5 02 =3 CO2+4 H2OHow many moles of C3H8 are needed to make 3.60 grams of H2O? I think the ans is
1. 0 answers
2. 511 views
For the reaction C3H8+5CO2=3CO2+4H2OHow many grams of co2 will be produced by buring 0.15 moles of c3h8?i thoink the ans is
1. 1 answer
2. 569 views
For the reaction C3H8+5CO2=3CO2+4H2OHow many moles of c3h8 are needed to make 3.6 grams of c3h8? I think the ans is
1. 2 answers
2. 1,390 views
For the reaction C3H8+5CO2=3CO2+4H2OHow many grams of O2 react with 8.80grams of C3H8? I think the ans is 32.0gO2
1. 1 answer
2. 995 views
for the reaction: c3h8+5o2=3co2 +4h2o how many moles of o2 will be produced in the complete combustion of 0.75 moles of c3h8?I
1. 2 answers
2. 3,337 views
for the reaction: c3h8+5o2=3co2 +4h2o how many moles of o2 will be produced in the complete combustion of 0.75 moles of c3h8?
1. 1 answer
2. 806 views
Medallion Cooling Systems, Inc., has total assets of $10,000,000, EBIT of $2,000,000, and preferred dividends of $200,000 and is
1. 0 answers
2. 1,354 views
A car is driven at 80km/h on a horizontal road. If the car is now driven up 10m high rise, what speed would it have at the top
1. 1 answer
2. 635 views
I need some explanation about fonts and how to use them. Need to complete an assignement requesting that fonts are used for
1. 1 answer
2. 499 views
Is there a model to measure the letters/fonts so that each letter is the same size? Or, do I need to measure each letter
1. 2 answers
2. 607 views
When and where did people still believe the world is flat?I thought they did in Columbus's time, but I guess that was a myth?
1. 7 answers
2. 978 views
Could someone explain the concept of judicial review and its impact on the balance of power in the United States Government?Judi
1. 0 answers
2. 1,074 views
Can someone suggest any poems that somehow encapsulates the sentiments of Huckleberry Finn" by Mark Twain?I know of none, but
1. 0 answers
2. 640 views
Hi. I was wondering if someone could help me grasp a concept. The concept is that soon the world will run out of natural
1. 0 answers
2. 634 views
Hi. I have to pick a book by Edward Abbey to read. Then I have to write a paper that covers:-what Ed was trying to accomplish
1. 0 answers
2. 618 views
Can someone please help me with these problems?Write (27a^-3)^-2/3 in simplest form. Solve log(6x+11)=2. thanks Let me see your
1. 0 answers
2. 916 views
write (27a^-3)^(-2/3) in simplest form.solve log(6x+11)=2 please and thanks I am not going to give you the answers. I will be
1. 0 answers
2. 638 views
write (27a^-3)^(-2/3) in simplest form.solve log(6x+11)=2 please and thanks I need to see your work on the first. On the second,
1. 0 answers
2. 565 views
It decreases?If the air pressure increased, wouldn't that make the diver go down? What happens when you press on the pressure
1. 0 answers
2. 982 views
What is the name for the condition when a person feels dizzy and passes out at the sight of blood?Thank you for using the Jiskha
1. 0 answers
2. 1,028 views
why does a can of soda explode in a hot car?As the temperature rises, the gas (carbon dioxide that make the fizzle in soda
1. 0 answers
2. 815 views
Does anyone know what advantage there is to using hot water to make ice cubes?Validated tests indicate it is faster to freeze
1. 0 answers
2. 673 views

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2025