Ask a New Question

Questions and answers by

Jana

Questions (62)

How do artists create a sense of depth
1. 1 answer
2. 160 views
In The Fever Van, how has Lowry created a sense of depth?
1. 1 answer
2. 105 views
Andy spends 2/5 of his pocket money on food. He spends 1/3 of what is left on clothes. He saves the rest.What fraction of his
1. 1 answer
2. 161 views
The table shows one student's results from spinning the pointer 30 times. Find the experimental probability that the pointer
1. 1 answer
2. 843 views
Which factor allows earth to have a comfortable temperatureA.atmosphere B.energy C.plate tectonics D.water
1. 3 answers
2. 1,171 views
The cable of a suspension bridge has supporting towers which are 50 ft high and 400 ft apart and is in the shape of a
1. 2 answers
2. 3,210 views
A scuba diver's vertical position in relation to the surface of the water changes by -90 Ft in 3 min. What is the average change
1. 1 answer
2. 754 views
Can someone clarify where I'm going wrong with this?Kw for pure water is 1.2 x 10-15 at 5°C. The pH of pure water at 5°C? I
1. 1 answer
2. 624 views
describe the preparation of 12 mL of a 0.050 M solution of each of the halogens, using the reactions in the preceding question.
1. 2 answers
2. 1,405 views
Circular motion:Not sure if I did this right. I need to find the speed that a spaceship needs to rotate to create an artificial
1. 1 answer
2. 514 views
How do humans grow crops on land that would naturally be either too dry or too wet ? Explain
1. 1 answer
2. 630 views
I don't need somone to fully answer this questions, but I need help as to where to get started.Occasionally a severe leg break
1. 1 answer
2. 770 views
Given (f+g)(x)=10-3x and (f-g)(x)=5x-14) find f(x) and g(x).So I was told to do: (f+g)(f-g)=2f 2f=(10-3x)+(5x-14)=2x-4 f(x)=x-2
1. 1 answer
2. 463 views
Given (f+g)(x)=10-3x and (f-g)(x)=5x-14, find f(x) and g(x).I'm not sure how to go about this.
1. 4 answers
2. 487 views
A true false test has 15 questions. How many answer keys are possible of the answer to 6 of the questions is false and 9 are
1. 2 answers
2. 3,688 views
In how many ways can a school president, a vice-president, and secretary be chosen from 21 students?I'm not sure to find this
1. 1 answer
2. 666 views
BC Place has 16 gates. In how many ways can you enter and leave the stadium by any gate?I'm not sure if this this is a
1. 1 answer
2. 1,820 views
Calculate the normal force for a 2 kg object at rest on an inclined surface, α=42 degreesHow much is the static coefficient of
1. 2 answers
2. 687 views
I need to prove this identity:cot(x)+tan(x)=csc(x)sec(x) I get as adding them together, but then I get stuck.
1. 1 answer
2. 498 views
I'm not sure how to get the final answer for this question I get stuck halfway thru.Simplify using sum and difference
1. 1 answer
2. 557 views
I'm not sure how to solve this equation algebraically:38=20sin((2pi(t))/36)+22 I know the answer should be about 5.3 since I
1. 2 answers
2. 564 views
Write an expression for the x-values where the the maximum in the expression occurs:y=6cos((2pi/14)x)-2 I know that the maximum
1. 2 answers
2. 1,217 views
Write the expression as a single logarithm: 3log(a)-log(b)-(1/2)log(c)I want to check my answer. I got log(a^3/bc^(1/2))
1. 3 answers
2. 669 views
Find x:2(5)^x=3^(x+1) I'm not sure what to do with the 2. I think I need to write the equation as log5^2x=log3^(x+1), but I
1. 2 answers
2. 510 views
Factor 2x^4-62x^2+60xI get: 2x(x^3-31x+30) 2x(x-30)(x^2-1) 2x(x-30)(x-1)(x+1) But that's wrong. It should be (I think):
1. 2 answers
2. 547 views
Solve this algebraically for the exact values (Meaning find the x-intercepts):(1/x)=x/(3x+18) I'm not sure what to write as the
1. 1 answer
2. 518 views
1. Before the Industrial Revolution, the concentration of CO2 in Earth’s atmosphere was about 275 ppm. Considering the effect
1. 1 answer
2. 836 views
If the terminal side of angle theta passes through point (-3, -4), what is the valuse of sec theta?1) 5/3 2) -5/3 3)5/4 4)-5/4
1. 2 answers
2. 6,408 views
I'm going as this question again as it seems to far down the list to be answered now. Sorry if this is considered spam.
1. 3 answers
2. 523 views
We are learning about proteins and their structure, but one thing is confusing me.At what structural point is something
1. 2 answers
2. 883 views
Which of the following integrals cannot be evaluated using a simple substitution?the integral of the square root of the quantity
1. 1 answer
2. 834 views
what is a minor transtion of a text?
1. 1 answer
2. 454 views
. Read the following line from Romeo’s monologue in Act II, Scene 2 of Romeo and Juliet, where Shakespeare employs
1. 8 answers
2. 11,763 views
What would be a creative title for an essay paper over the causes of wildfires?
1. 3 answers
2. 635 views
For vocabulary workshop, Unit 11 # 19. Her ability to _______ the words and gestures of prominent Americans makes her an
1. 1 answer
2. 532 views
1. On July 1, 2010, Harris Co. issued 6,000 bonds at $1,000 each. The bonds paid interest semiannually at 5%. The bonds had a
1. 1 answer
2. 629 views
In a survey of 1233 people, 917 people said they voted in a recent presidential election. Voting records showed that 72% of
1. 0 answers
2. 601 views
An engineer is going to redesign an ejection seat for an airplane. The seat was designed for pilots weighing between 140 lb and
1. 2 answers
2. 2,019 views
In a genetics experiment on peas, one sample of offspring contained 421 green peas and 166 yellow peas. Based on these results,
1. 4 answers
2. 9,286 views
The probability of a randomly selected car crashing during a year in a certain country is .0479. If a family has three cars,
1. 2 answers
2. 1,721 views
An airline has a policy of booking as many as 17 persons on an airplane that can seat only 16. (Past studies have shown that
1. 2 answers
2. 1,833 views
How do I figure out the answer to this ? It's been a while since I came across one like it; On a test, 6.25% of the questions
1. 1 answer
2. 709 views
0.015 moles of a compound are dissolved in 18 fl. oz. of water. At what temperature will the solution begin to freeze? The
1. 2 answers
2. 567 views
CaCO3(s)+2HCl(aq)-->CaCl2(aq)+H2O(l)+CO2 (g)How many grams of calcium chloride will be produced when 31g of calcium carbonate
1. 2 answers
2. 1,853 views
calculate the wavelength in nm of the spectral line produced when an electron in an hydrogen atom undergoes the transition from
1. 1 answer
2. 1,860 views
A light beam has a frequency of 5 x 1015 Hz. What is its wavelength?
1. 0 answers
2. 580 views
Another term that means the same thing as "insurance company" is:
1. 2 answers
2. 560 views
What is the amount of water needed to obtain a saturated solution using 27g of barium nitrate? What mass of water is present
1. 0 answers
2. 521 views
A picture frame measure 5 inches wide and 7 inches long . What is the perimeter of the frame ? (16-3)
1. 2 answers
2. 1,717 views
How can the number 39 be divided into two parts in order that the sum of 2/3 of one part and 3/4 of the other part is 28?
1. 4 answers
2. 610 views
The U C C dose not apply in cases where both parties are merchants. True or False
1. 0 answers
2. 534 views
If the standard deviation of a population is 56 and we want the standard error (the standard deviation of the sample mean) to be
1. 2 answers
2. 1,085 views
The average age of a vehicle registered in the U.S. is 8 years, or 96 months. If a random sample of 36 vehicles is selected,
1. 1 answer
2. 2,223 views
1. if you double the distance over which a force moves an object,the work will be multiplied by??2.if emily doubles her
1. 1 answer
2. 504 views
revising these sentences so the subject and verb agree with one another. One of my friends want to attend my graduation
1. 2 answers
2. 614 views
revising sentences to remove these pronouns When a police officer fires his gun, he mustfill out a lot of paperwork. When a
1. 3 answers
2. 548 views
Write a sentence of at least 150 words—no substituting semicolons or conjunctions for periods and no stream of consciousness.
1. 3 answers
2. 853 views
How do you divid whole numbers by decimals?EX: 20/0.5 -decimals in general? Thank you!
1. 2 answers
2. 599 views
Iformation on columbus? what was china called at the time??
1. 1 answer
2. 548 views
3 Examples of Mission statements or human services organizations.Show how each one of the mission statements does or does not
1. 3 answers
2. 769 views
46. Find the five-number summary of the following set of numbers.0.16, 0.08, 0.27, 0.20, 0.22, 0.32, 0.25, 0.18, 0.28, 0.27 A)
1. 2 answers
2. 607 views
I have to create a 5-layer density column, using liquids that are not flammable or chemicals, so basically you have to be able
1. 0 answers
2. 814 views

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2025