Ask a New Question

Questions and answers by

Jake

Questions (1,018)

Hi, I have to write a 2 page paper about the book No-No Boy, rather than give a plot summary the teacher wants us to discuss
1. 1 answer
2. 582 views
Given the formula X=x to the power of 2 + y to the power of 2 can you find X if x=9,y=negative 4,z=1/2?
1. 2 answers
2. 308 views
Find the constant of proportionality for the following situation: "y is jointly proportional to x and z and inversely
1. 1 answer
2. 1,379 views
A person can have 1 of 4 blood types: A, B, AB, or O. A Student determined that the probability that a randomly selected person
1. 1 answer
2. 647 views
How many hydrogen atoms are in a molecule of C8H10N4O2? wouldnt it just be 10?
1. 1 answer
2. 393 views
How many hydrogen atoms are in a molecule of C8H10N4O2? wouldnt it just be 10?
1. 1 answer
2. 1,345 views
Hi, I have to write a short reaction paper (2 pages) about the book America is in the Hearth by Carlos Bulosan. I have to
1. 4 answers
2. 546 views
Write the expression (7 – 7i) + (–8 – 2i) in the form a + bi
1. 2 answers
2. 1,098 views
Why is iodine important to biological tissues such as the thyroid gland? Give a prediction for why iodine is added to the table
1. 2 answers
2. 561 views
if fluoride is considered toxic, then why do they put it in tooth paste and municipal drinking water supplies?
1. 1 answer
2. 599 views
The Greek base which means to burn isCla- Path- Sat- Cau(s)-
1. 3 answers
2. 1,095 views
The limit as x approaches infinity of (1+1/x)^x.I tried this twice and I got an answer of e both times, but the answer that my
1. 2 answers
2. 461 views
What are the 3 base languages in Europe? I know there's Slavic, Romance which is Italian and French, but I can't remember the
1. 2 answers
2. 1,122 views
The moon has a surface area of approximately 14,650,000 mi squared. Estimate its radius to the nearest mile.
1. 2 answers
2. 654 views
Simplify 5(y + 1)
1. 1 answer
2. 289 views
# Electron Pairs# Lone Pairs Electronic Geometry Molecular Geometry Lewis Structure Sketch of Shape I need to do the above
1. 1 answer
2. 1,374 views
Construct the data chart and the pH curve for the titration of 25 mL of 0.1 M CH3COOH with 0.1M NaOH. Add the titrant 1 mL at a
1. 1 answer
2. 506 views
balance the redox equations:IO3-(aq) -> I2(aq) and I-(aq) -> I2(aq) balance the redox equation: S2O3(-2) -> S4O2(2-) and I3- ->
1. 1 answer
2. 1,880 views
Hi, I have a calculus test tomorrow and I understand how to complete all of the problems, but I am unsure behind the reasoning
1. 1 answer
2. 698 views
the reaction with ammonium hydroxide with the following metals:Fe3+ Mn2+
1. 2 answers
2. 690 views
what is the reaction with sodium hydroxide for the following metals:Al3+ Fe3+ Mn2+ Ni2+ Zn2+
1. 1 answer
2. 491 views
how would I make a tslly table for the number of students in th third, fourth, and fifth-grade classes: 26, 25, 27, 27, 26,28,27
1. 2 answers
2. 1,003 views
Can a golden rectangle have a shorter base than height? I'm not sure how to answer this can you please help :)
1. 1 answer
2. 1,387 views
I can't figure out how to solve this problem:The Ka for hydroflouric acid is 4.5 *10^-4 at 298K. Calculate the amount of sold
1. 1 answer
2. 495 views
The Ka for hydroflouric acid is 4.5 *10^-4 at 298K. Calculate the amount of sold NaF that is required toprepare a 250. mL acidic
1. 1 answer
2. 955 views
True or False, Communication can involve language but not speech.
1. 5 answers
2. 539 views
Could you please help me locate the adjectives and adverbs in the below paragraph?St. Louis is most often considered to be
1. 9 answers
2. 696 views
I seen the help you gave other people and was wondering if you could help me idenify 5 adjectives and adverbs in my paragraph.St
1. 7 answers
2. 680 views
Input:4 and 6Output:12 and 17 What's the rule
1. 1 answer
2. 383 views
What is the freezing point of a solution of 1.17g of 1-naphthol, C10H8O, dissolved in 2.00ml of benzene at 20 degrees C? The
1. 1 answer
2. 1,765 views
An object with mass 0.250 kg is acted on by an elastic restoring force with force constant 10.8 N/m. The object is set into
1. 1 answer
2. 1,906 views
use FOIL (2x^5-6)(x^6-3)My answer is -10x^22-18...but I am not sure that is right. Could someone please help.
1. 1 answer
2. 332 views
HELP!!! I don't remember how to make a dam sonnet with 10 syllables?
1. 1 answer
2. 475 views
Hi do the following sets have the same cardinality, why or why not?N= 1,2,3,4,5,6,7... N-2= blank, blank, 3,4,5,6,7... So
1. 0 answers
2. 430 views
Write a balanced chemical equation (molecular equation). Write a total ionic equation. write a net ionic equation.(NH4)2
1. 2 answers
2. 711 views
A hot-air balloon is 180 ft above the ground when a motorcycle passes directly beneath it (travelling in a straight line on a
1. 1 answer
2. 986 views
A hot-air balloon is 180 ft above the ground when a motorcycle passes directly beneath it (travelling in a straight line on a
1. 2 answers
2. 3,405 views
Key difference/s between the 1929 Crash and previous stockmarket crashes was/wereA) The impact of the investor's pools B) That
1. 1 answer
2. 1,272 views
x/(x^2-16)-6/(x^2+5x+4)
1. 1 answer
2. 255 views
As the aggregate price level falls, the number of domestic products purchased by foreigners will [rise], causing the quantity of
1. 2 answers
2. 3,895 views
If i titrated 25.0mL of 0.500M HCl with 0.500M NaOH and then 25.0mL of 0.500M of an unknown weak acid HA with 0.500M NaOH. How
1. 2 answers
2. 2,700 views
I don't know how to get the mole ratios of the following:Copper to Chloride Zinc to Chloride Zinc to Copper There are the moles
1. 1 answer
2. 851 views
A question in Campbell's 8th edition study guide for AP Biology says:A multifactorial disorder _. Answer: has a collection of
1. 1 answer
2. 1,077 views
If you prepared a solution by adding 0.05mL (1drop) of 0.5M HCL to 5 x 10^7 mL of "pure" water. Calc the resultant PH. The
1. 1 answer
2. 2,420 views
A 0.250-g sample of a magnesium-aluminum alloy dissolves completely in an excess of HCl (aq) . When the liberated H2 (g) is
1. 8 answers
2. 7,208 views
Solve the differential equation:dy/dx= (x^2+y^2)/(2xy) I know how to solve this type of problem, but I am struggling getting all
1. 1 answer
2. 1,108 views
Sorry I know this should be easy, but what is the integral of U/du?
1. 0 answers
2. 340 views
Please find the integral for:(2^(-1/t))/(t^2) Thank you very much
1. 1 answer
2. 351 views
Find the indefinite Integral of:(e^(2x)-e^(-2x))/(e^(2x)+e^(-2x))dx Thank you very much for your help.
1. 1 answer
2. 350 views
Find the derivative of the inverse for the function f and real number a.f(x)=xrad(x-3) a=4 Please help. Thank you very much for
1. 0 answers
2. 386 views
A piece of dry ice (solid carbon dioxide) with a mass of 25.5 g is allowed to sublime (convert from solid to gas) into a large
1. 1 answer
2. 896 views
A piece of dry ice (solid carbon dioxide) with a mass of 25.5 g is allowed to sublime (convert from solid to gas) into a large
1. 2 answers
2. 1,574 views
A block rides on a piston that is moving vertically with simple harmonic motion.(a) If the SHM has period 3.1 s, at what
1. 0 answers
2. 854 views
Students are to read up on the role of Hezbollah as a political force in Lebanon. Due to Lebanon's geographical position,
1. 1 answer
2. 462 views
A particular kind of emergency breathing apparatus-often placed in mines, caves, or other places where oxygen might become
1. 1 answer
2. 1,304 views
A particular kind of emergency breathing apparatus-often placed in mines, caves, or other places where oxygen might become
1. 0 answers
2. 773 views
What is the Cl concentration just as Ag2CrO4 begins to precipitate when 1.0 M AgNO3 is slowly added to a solution containing
1. 0 answers
2. 986 views
How do you find the rate(mole rxn/L s) from .00014 M or Iodine, .57 M or acetone, and .18 M of H+ and 16.8 seconds?
1. 0 answers
2. 292 views
A dockworker applies a constant horizontal force of 79.0 N to a block of ice on a smooth horizontal floor. The frictional force
1. 2 answers
2. 2,349 views
A dockworker applies a constant horizontal force of 79.0 N to a block of ice on a smooth horizontal floor. The frictional force
1. 2 answers
2. 1,574 views
If y=cos^2x-sin^2x, then y'=a) -1 b) 0 c) -2(cosx+sinx) d) 2(cosx+sinx) e) -4(cosx)(sinx) I thought the answer was C but the
1. 0 answers
2. 476 views
An equation to the graph of y=x^3+3x^2+2 at its point of inflection is:a) y=-3x+1 b)y=-3x-7 c)y=x+5 d)y=3x+1 e)y=3x+7 Please
1. 1 answer
2. 3,031 views
For x≠0, the slope of the tangent to y=xcosx equals zero whenever:(a) tanx=-x (b) tanx=1/x (c) sinx=x (d) cosx=x Please help.
1. 1 answer
2. 4,572 views
For x≠0, the slope of the tangent to y=xcosx equals zero whenever:(a) tanx=-x (b) tanx=1/x (c) sinx=x (d) cosx=x Please help.
1. 0 answers
2. 558 views
Find the value of the constant t such that the triangle formed by A (2,2) ,B (4,-5) ,C (6,t) is right angled at B(4,-5).
1. 1 answer
2. 437 views
In triangle abc, ab=5 bc=9 and ac=8Choose the angle measures from greatest to least
1. 2 answers
2. 1,066 views
Camilla has 3 times as many points as Lynn. Lynn has 5 more points than Kim. Camilla, Lynn, and Kim combined have twice as many
1. 2 answers
2. 948 views
how did helen thomas feel about watergate?if u could also tell me where u found the answer that would help, thanks
1. 1 answer
2. 441 views
If a polonium-210 (Po-210) atom has just decayed, how close can the ejectedalpha particle get to a neighboring Po-210 nucleus?
1. 0 answers
2. 557 views
Tom's mother pays him $.50 for each problem his gets correct on his test, but he has to give her .25 for each problem he gets
1. 1 answer
2. 510 views
In right triangle ABC, the median to the hypotenuse has length 15 units and the altitude to the hypotenuse has length 12 units.
1. 3 answers
2. 877 views
A train sounds its horn as it approaches an intersection. The horn can just be heard at a level of 42 dB by an observer 10 km
1. 0 answers
2. 902 views
what is the wavelength of an electron traveling at 1.65% of the speed of light?
1. 1 answer
2. 496 views
An alloy of metals is 25% copper .Another alloy is 50% copper. How much of each alloy should be used to make 1000grams of an
1. 1 answer
2. 744 views
The strongest intermolecular forces present in a sample of pure I2 areA. covalent bonds. B. covalent network bonds. C. metallic
1. 1 answer
2. 1,769 views
Given:JG/HG =KG/IG, ∠1 ≅∠2Prove: EF ll HI /Users/szeringue/Documents/#6.doc
1. 1 answer
2. 598 views
The normal boiling point of a liquid isA. the temperature at which all three phases are in equilibrium. B. the only temperature
1. 1 answer
2. 1,320 views
All of the following are postulates of the kinetic molecular theory of gases exceptA. The gas molecules are in constant motion.
1. 1 answer
2. 3,172 views
Which of the following compounds has the highest vapor pressure at 25°C?A. CH3CH2OH B. CH3OCH3 C. CH3CH2CH2Cl D. CH3CH2CH3 E.
1. 2 answers
2. 6,437 views
Exposure to high doses of microwaves can cause tissue damage. Estimate how many photons with a wavelength = 12cm, must be
1. 3 answers
2. 1,127 views
CaO(s) + 3C(s) > CaC2(s) + CO(g)deltaHrxn = +464.8 kJ/mol-rxn Is the reaction endothermic or exothermic? What is the enthalpy
1. 2 answers
2. 4,991 views
The A string of a violin is 31 cm long between fixed points with a fundamental frequency of 440 Hz and a mass per unit length of
1. 2 answers
2. 1,374 views
Write a nuclear equation for the following:Iodine 131 undergoes beta decay two times Plutonium 239 is an alpha emitter Th 234
1. 0 answers
2. 759 views
Calculate the energy changes associated with each of the following reactions. Label each as endothermic or exothermic.A.)
1. 0 answers
2. 548 views
K*T=K*TI need help solving for T. How would I do it?
1. 0 answers
2. 296 views
K*T=K*THow would I solve for T?
1. 1 answer
2. 303 views
The intensity of an earthquake wave passing through the Earth is measured to be 2.5×106 J/m^2 at a distance of 48 km from the
1. 1 answer
2. 1,375 views
/Users/szeringue/Desktop/SCAN0001.JPGCan you help me solve this problem, Please AB=27 BC=x CD=4/3x AD=x AC=? How do I get what
1. 3 answers
2. 541 views
/Users/szeringue/Desktop/SCAN0001.JPGCan you help me solve this problem, Please AB=27 BC=x CD=4/3x AD=x AC=? How do I get what
1. 0 answers
2. 414 views
/Users/szeringue/Desktop/SCAN0001.JPGCan you help me solve this problem, Please AB=27 BC=x CD=4/3x AD=x AC=? How do I get what
1. 0 answers
2. 373 views
/Users/szeringue/Desktop/SCAN0001.JPGCan you help me solve this problem, Please AB=27 BC=x CD=4/3x AD=x AC=? How do I get what
1. 0 answers
2. 358 views
One reaction of iron with hydrochloric acid is represented by the following thermochemical equation.Fe(s) + 2HCl(aq) →
1. 2 answers
2. 779 views
Consider the following metals.Metal Specific Heat copper 0.385 J/(g · °C) magnesium 1.02 J/(g · °C) mercury 0.138 J/(g ·
1. 2 answers
2. 2,097 views
From the following information, determine ΔH°f of malonic acid, CH2(COOH)2(s).CH2(COOH)2(s) + 2O2(g) → 3CO2(g) + 2H2O(l);
1. 1 answer
2. 3,008 views
what is non convective rain?
1. 0 answers
2. 380 views
Write the balanced equation and solubility product expression for the solubility equilibrium of Mn3(PO4)2: i thought the answer
1. 1 answer
2. 699 views
Write the balanced equation and solubility product expression for the solubility equilibrium of Mn3(PO4)2: i thought the answer
1. 1 answer
2. 2,884 views
The net ionic equations for the following1. Dissolution of silver oxalate with nitric acid 2. Complexation of the iron(III) by
1. 2 answers
2. 2,319 views
for what values of _ is 2,3_1 divisible by 9? by 3?
1. 1 answer
2. 341 views
If I'm travelling with a bag of objects on the seat next to me and I turn right, which direction does the bag fall and why? What
1. 0 answers
2. 366 views

Pages

1
2
3
4
5
6
7
8
9
10

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2025