Ask a New Question

Questions and answers by

Elle

Questions (123)

Which statement describes an impact of the Pan-Africanism movement?a. It has led to more colonies being formed. b. It worsened
1. 1 answer
2. 48 views
Which statement investigates the tension between Iran and the Kurds?a. The Kurds wish to have their own state since they have
1. 1 answer
2. 30 views
Which statement summarizes how Myanmar has been shaped by identity in modern daya. Discrimination against Romani people led to
1. 1 answer
2. 37 views
According to those who believe climate change is caused by individuals, what actions have led to climate change?The emphasis on
1. 1 answer
2. 36 views
Which statement correctly investigates the reason for disagreement on the causes of climate change?The evidence from some
1. 1 answer
2. 47 views
What statistical tool should be used to determine the influence of independent variable to dependent variable?
1. 1 answer
2. 441 views
Find the coordinates of point B on Line AC such that AB is 2/3 of AC (B is located in between A and C). A is (1,-5) and C is
1. 4 answers
2. 4,243 views
Which property is shown by 3+2 = 2+3 A Commutative property of addition B identity property of addition C distribute property D
1. 4 answers
2. 2,969 views
What do I mix to make a skin bomb?
1. 1 answer
2. 480 views
Show that f(x) = x3 and g(x) = 200x3 grow at the same rate
1. 3 answers
2. 1,402 views
a radio commercial for a loan company states: "You only pay 10 cents a day for each $500 you borrowed." If you borrow $2000 for
1. 3 answers
2. 1,165 views
A total of 8000 dollars is invested in two funds paying 4 percent and 5 percent annual interest,. The combined interest for the
1. 2 answers
2. 686 views
In 2003, NASA launched the rover Spirit onto the surface of Mars to explore our planetary neighbor. Near the end of January
1. 2 answers
2. 608 views
x -4 -3 -2 -1 0 1 2 3 4y 18 8 0 -6 -10 -12 -12 -10 -6 What is the vertex of the parabola? The x-coordinate is 1.5.
1. 3 answers
2. 516 views
In a class of 20 students, the average (arithmetic mean) score on a test is 84 points. If 6 students each scored 100 points and
1. 4 answers
2. 1,411 views
Find the measure of two complementary angles if the measure of one angle is 30˚ greater than the measure of the other. What is
1. 2 answers
2. 742 views
Using chemical equations, write the chemical reactions for the following; photosynthesis, combustion, corrosion of iron.
1. 2 answers
2. 537 views
How many atoms are there in one molecule of the following compounds?a. silver chloride- AgCl b. calcium oxide- CaO c. Magnesium
1. 3 answers
2. 1,153 views
In a state legislature there were 119 more members in the House of Representatives than in senate. If there were m members in
1. 2 answers
2. 840 views
Write a real world context for five to three
1. 4 answers
2. 519 views
C|\ | \ | \ | \ A | -----\ | | | |1.7m | | | | ------- B D AB = 1.7m CD:AB = 1.5 : 1 The angle of elevation of C from A is 52
1. 3 answers
2. 405 views
Show that the equation 3x^2 - x^3 + 3 = 0 can be rearranged to give:x = 3 + 3 ---- x^2 x^3 = Divide by ? = x = 3 + 3 ---- x^2
1. 1 answer
2. 847 views
Here is a right- angled triangle.|\ | \ x | \ |___\ x - 2 All measurements are in centimetres. The area if the triangle is
1. 5 answers
2. 1,373 views
The first 5 terms of an arithmetic sequence are:7 13 19 25 31 Prove that the difference between the squares of any two terms of
1. 4 answers
2. 2,392 views
Hi, can you please check my work? I really need to do well on this.1. What properties of a star are needed to calculate the
1. 4 answers
2. 3,020 views
Suppose the ice cream shop offers 9 different flavours, and we share 5 scoops. How many ways of ordering are there ifAll
1. 1 answer
2. 449 views
Tobi is training to run a marathon. In the first week she runs 25 km and increases this distance by 10% each week. This
1. 4 answers
2. 1,425 views
A nozzle which is attached to the end of a 4-in fire hose has a length of 1 ft and a diameter at the discharge end of 1 in. If
1. 4 answers
2. 673 views
How would you write the equation to represent "Nitrogen and Oxygen react to form Nitrogen Dioxide".
1. 3 answers
2. 943 views
The graph of y-7 cosθ + 24 sinθ would be a sinusoid if it were plotted. What would be the first positive value of θ at which
1. 4 answers
2. 520 views
An object is placed to the left of a lens, and a real image is formed to the right of the lens. The image is inverted relative
1. 1 answer
2. 924 views
An object is placed in front of a converging lens in such a position that the lens (f = 13.2 cm) produces a real image located
1. 2 answers
2. 1,201 views
Whars 189.80. Times 6.25% less 33 1/3 %Is it 189.80 + 11.86 = 201.66 - 67.22 = $134..44
1. 1 answer
2. 869 views
A flat circular coil with 193 turns, a radius of 5.50 x 10-2 m, and a resistance of 0.241 Ω is exposed to an external magnetic
1. 1 answer
2. 445 views
A circular coil (660 turns, radius = 0.037 m) is rotating in a uniform magnetic field. At t = 0 s, the normal to the coil is
1. 2 answers
2. 597 views
A flat circular coil with 193 turns, a radius of 5.50 x 10-2 m, and a resistance of 0.241 Ω is exposed to an external magnetic
1. 1 answer
2. 464 views
A flat circular coil with 193 turns, a radius of 5.50 x 10-2 m, and a resistance of 0.241 Ω is exposed to an external magnetic
1. 3 answers
2. 609 views
A long solenoid has 1400 turns per meter of length, and it carries a current of 2.0 A. A small circular coil of wire is placed
1. 1 answer
2. 1,219 views
A 61.5-Ω resistor is connected in parallel with a 146.6-Ω resistor. This parallel group is connected in series with a 16.0-Ω
1. 3 answers
2. 778 views
21.0cm^3=___in^3
1. 1 answer
2. 394 views
Suppose a single electron orbits about a nucleus containing two protons (+2e), as would be the case for a helium atom from which
1. 2 answers
2. 943 views
Suppose a single electron orbits about a nucleus containing two protons (+2e), as would be the case for a helium atom from which
1. 1 answer
2. 652 views
What are the physcial characteristics for humans?
1. 2 answers
2. 518 views
A 74.2-kg climber is scaling the vertical wall of a mountain. His safety rope is made of a material that, when stretched,
1. 3 answers
2. 1,055 views
A 4.07 x 10-2-kg block is resting on a horizontal frictionless surface and is attached to a horizontal spring whose spring
1. 4 answers
2. 3,403 views
A 4.07 x 10-2-kg block is resting on a horizontal frictionless surface and is attached to a horizontal spring whose spring
1. 1 answer
2. 764 views
When subjected to a force of compression, the length of a bone (compression Young's modulus 9.4 x 109 N/m2, tensile Young's
1. 4 answers
2. 4,218 views
When subjected to a force of compression, the length of a bone (compression Young's modulus 9.4 x 109 N/m2, tensile Young's
1. 1 answer
2. 798 views
A spring (k = 905 N/m) is hanging from the ceiling of an elevator, and a 4.8-kg object is attached to the lower end. By how much
1. 1 answer
2. 823 views
A ball of mass m=0.25 kg is dropped from rest. What is the speed of the ball after it falls two meters?
1. 2 answers
2. 581 views
Can you help me ?I need to figure formula if I have $2023.60 what percent is it of $55,953.77? Also need to figure formula if I
1. 3 answers
2. 562 views
A space probe is traveling in outer space with a momentum that has a magnitude of 7.84 x 107 kg·m/s. A retrorocket is fired to
1. 1 answer
2. 752 views
A pitcher throws a 0.192-kg baseball, and it approaches the bat at a speed of 43.2 m/s. The bat does 69.8 J of work on the ball
1. 2 answers
2. 696 views
An asteroid is moving along a straight line. A force acts along the displacement of the asteroid and slows it down. The asteroid
1. 4 answers
2. 8,180 views
two groups of paddlers meet in the middle of a lake. after a brief visit a person in canoe 1 pushes on canoe 2 with a force of
1. 3 answers
2. 721 views
A skater with an initial speed of 5.90 m/s stops propelling himself and begins to coast across the ice, eventually coming to
1. 1 answer
2. 833 views
A 39.7-kg crate rests on a horizontal floor, and a 65.3-kg person is standing on the crate. Determine the magnitude of the
1. 4 answers
2. 2,307 views
How do you solve 49.05 divided by 2.5. Need to see step by step process.
1. 3 answers
2. 574 views
A planet has a mass of 6.15 × 1023 kg and a radius of 3.25 × 106 m. (a) What is the acceleration due to gravity on this
1. 3 answers
2. 932 views
A skateboarder shoots off a ramp with a velocity of 5.7 m/s, directed at an angle of 58° above the horizontal. The end of the
1. 2 answers
2. 1,297 views
A volleyball is spiked so that it has an initial velocity of 15.6 m/s directed downward at an angle of 56.9 ° below the
1. 2 answers
2. 1,058 views
An airplane has a mass of 3.25 × 104 kg and takes off under the influence of a constant net force of 2.38 × 104 N. What is the
1. 2 answers
2. 613 views
A speeder traveling at 30 m/s passes a motorcycle policeman at rest at the side of the road. The policeman accelerates at 2.4
1. 3 answers
2. 3,295 views
solve for xx-3(x-1)=6x-3-8x a) infinite solutions b)no solution c)0 d)-1 (x-3)(x-1)=-2x-3 so I believe from the information
1. 3 answers
2. 431 views
a light year is the distance light travels in one year. one light year is about 5.9x10^12 mi. If it takes light 3 months to
1. 7 answers
2. 3,580 views
Which best describes a polynomial?A) a decimal that is non-terminating or non-repeating B) a close-planed figure formed by three
1. 3 answers
2. 579 views
simplify (x^2-3x+6)-(36x^2-18x+6/6)(x^2-3x+6)-(6(6x^2-3x+1/6) cancel the two 6's in the second part of equation x^2-3x-6x^2+3x-1
1. 3 answers
2. 486 views
Hannah plans on going hiking most of the day. It is recommended that she takes at least 3 liters of water with her. She packed 3
1. 4 answers
2. 529 views
one candy bar contains 220 calories. If this represents 10% of the total calories a person consumes in one day, find the total
1. 2 answers
2. 732 views
Sarah collects money for charity while treat-or-treating. This year she collected $15.80. Last year she collected $14.25. Find
1. 1 answer
2. 458 views
solve3/2x-3=5/2x-5 3(2x-5)=5(2x-3) 6x-15=10x-15 minus 6x to both sides -15=4x-15 add 15 to both sides 0=4x 0/4=4x/4 x=0 Is this
1. 1 answer
2. 378 views
when 7x^4-49x^3+7x^2 is divided by 7x^2, the quotient iswhen I divided I got x^2-7x+1 Is this correct?
1. 2 answers
2. 901 views
Jake buys a bicycle for $200 down and$20 a month for 2 years.What is the expression that represents the total amount he will pay
1. 1 answer
2. 401 views
The average temperature in the artic circle is -25degrees Celsius.To the nearest integer, what is the average temperature in the
1. 4 answers
2. 614 views
simplify 4^8/4^-4Would this be 4^4 the correct answer?
1. 3 answers
2. 652 views
the expression 10x^2+6x^3 is the result of applying the distributive property to the expression 2x^2(5+3x). write the expression
1. 2 answers
2. 601 views
divide 12a^4+a^3-2a by 2a.I got the quotient of 6a^3+.5a^2-1 Is this correct
1. 1 answer
2. 389 views
Verify the identity.1/(tanx-secx) + 1/(tanx+secx) = -2tanx
1. 1 answer
2. 526 views
A club consists of 8 seniors, 7 juniors, and 4 sophomores. A subcommittee consisting of 3 seniors, 2 juniors, and 1 sophomore
1. 5 answers
2. 2,799 views
I can't get this right! Please help...Based on the formula below, what quantities of each are needed to make 180 ml of this
1. 2 answers
2. 864 views
Two objects are connected by a string with a mass less, friction less pulley. The coefficient of friction is .298. The block on
1. 1 answer
2. 514 views
A 1.1 kg lizard lies on a flat rock tilted. A person decides to tilt the rock hoping that the lizard falls off. The rock is
1. 2 answers
2. 651 views
What factor led the English to attempt to kill off entire Native American peoples?A. Native Americans provided a good labor
1. 3 answers
2. 1,192 views
A coffee-cup calorimeter initially contains 125 g water at 24.2 degrees celsius. Potassium bromide (10.5 g), also at 24.2 degree
1. 5 answers
2. 3,973 views
In ion exchange chromatography, why do you have to be careful not to disturb the resin bed or let air enter the resin bed?I get
1. 1 answer
2. 473 views
A portable electric water heater transfers 255 watts (W) of power to 5.5 L of water, where 1 W = 1 J/s. How much time (in
1. 2 answers
2. 1,302 views
25.0 mL of ethanol (density = 0.789 g/mL) initially at 7.0 degrees celsius is mixed with 35.0 mL of water (density = 1.0 g/mL)
1. 4 answers
2. 1,732 views
Determine the theoretical and percent yield of hydrogen gas is 36 g of water undergoes electrolysis to produce hydrogen and
1. 5 answers
2. 2,366 views
How would you make 100mL of tartrate buffer, pH 3.5, from 0.100 M tartaric acid, 1M NaOH and deionized and distilled H2O? You
1. 2 answers
2. 555 views
16.72g of sodium acetate trihydride (MW=136 g/mol) is dissolved in 100mL water. To this, 4.00g glacial acetic acid (Ka=2.2x10-5,
1. 2 answers
2. 835 views
How would you make 100mL of tartrate buffer, pH 3.5, from 0.100 M tartaric acid, 1M NaOH and deionized and distilled H2O? You
1. 1 answer
2. 826 views
PQR is congruent to DJE. complete the statement belowPR is congruent to __, DJ is congruent to __ angle E is congruent to __ 1)
1. 3 answers
2. 1,039 views
You are sky diving and are trying to land on a target with a radius of 15 m. You land 10 m west and 10 m north of the center of
1. 3 answers
2. 720 views
A team of dogs drags a 150 kg sled 1.39 kmover a horizontal surface at a constant speed. The coeﬃcient of friction between the
1. 3 answers
2. 1,096 views
Two bullets have masses of 2.4 g and 5.2 g, respectively. Each is ﬁred with a speed of 37.0 m/s.a) What is the kinetic energy
1. 5 answers
2. 650 views
A crate is pulled to the right with a force of 80 N, to the left with a force of 125.8 N, upward with a force of 615.4 N, and
1. 4 answers
2. 2,895 views
A crate is pulled to the right with a force of 80 N, to the left with a force of 125.8 N, upward with a force of 615.4 N, and
1. 3 answers
2. 749 views
A ball of mass 0.4 kg, initially at rest, is kicked directly toward a fence from a point 20 m away, as shown below.The velocity
1. 4 answers
2. 4,152 views
A person walks 28.2◦ north of east for 3.33 km.Another person walks due north, then due east to arrive at the same location.
1. 3 answers
2. 612 views
The identities cos(a-b)=cos(a)cos(b)sin(a)sin(b) and sin(a-b)=sin(a)cos(b)-cos(a)sin(b) are occasionally useful. Justify them.
1. 3 answers
2. 1,128 views

Pages

1
2

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2024