Ask a New Question

Questions and answers by

Destiny

Questions (225)

The firemen's ladder is 39 feet long (L).The firemen set the base of the ladder 12 feet away from the building (d). When the
1. 1 answer
2. 618 views
Please somebody help me with this question, I don’t really get it:The triangles are shown congruent. Find the measure of angle
1. 1 answer
2. 1,079 views
Please somebody help me with this question, I don’t really get it:The triangles are shown congruent. Find the measure of angle
1. 4 answers
2. 1,888 views
Please somebody help me with this question, I don’t really get it:The triangles are shown congruent. Find the measure of angle
1. 8 answers
2. 3,163 views
The fifth term of an arithmetic progression is 19 and the fourteenth term is 15. Find the, first term, common difference, and
1. 1 answer
2. 694 views
Which career will I be able to do if I study Geography, Mathematical literacy, Life sciences, History, English, setswana and
1. 17 answers
2. 8,499 views
In a downtown office building you notice each of the four sections of a rotating door has a mass of 85 kg. What is the width of
1. 0 answers
2. 665 views
What is the result if you multiply a number of cups by 8 fluid ounces over 1 cup and then multiply the result by 1 cup over 8
1. 4 answers
2. 756 views
A body moving with uniform acceleration has a velocity of 16.9 cm/s when its x coordinate is 3.1 cm. If its x coordinate 3.18 s
1. 0 answers
2. 452 views
A ball is kicked with an initial velocity of 21 m/s in the horizontal direction and 16 m/s in the vertical direction. (Assume
1. 1 answer
2. 6,388 views
17Min and 38mind explain the mental math
1. 1 answer
2. 581 views
A bag has 5 red marbles, 6 blue marbles and 4 black marbles. What is the probability of picking ablack marble, replacing it, and
1. 1 answer
2. 1,472 views
Suppose you have a mean standardized score of 1500 points with a standard deviation of 150 points. This data is normally
1. 1 answer
2. 3,064 views
The time required to finish a test in normally distributed with a mean of 40 minutes and a standard deviation of 8 minutes. What
1. 1 answer
2. 1,035 views
How does subduction change the ocean floor?a) subduction cause magma to accumulate on the ocean floor b) subduction causes
1. 15 answers
2. 2,207 views
How does subduction change the ocean floor?a) subduction cause magma to accumulate on the ocean floor b) subduction causes
1. 3 answers
2. 1,802 views
Which of the following illustrates conduction as a mode of heat transfer?a) A microwave oven produces electromagnetic waves that
1. 14 answers
2. 2,154 views
Which evidence from the sea floor shows that tectonic plates move?a) the sea floor is youngest near a mid-ocean ridge and older
1. 10 answers
2. 1,358 views
1. which of the following is not a method by which minerals form?a) crystallization b) decrystallization c) water evaporation
1. 4 answers
2. 4,745 views
What is the cost of laying carpet in a living room that measures 25ft by 15ft. If the cost of the carpet is $15 per square yard
1. 3 answers
2. 646 views
What is the density (in grams per liter) of a gas at STP if 1.97 L of the gas in a bulb at 23.8 °C, and 761.9 mm Hg weighs
1. 1 answer
2. 516 views
Fiber-optic cables are used widely for Internet wiring, data transmission, and surgeries. When light passes through a
1. 2 answers
2. 574 views
The price of products may increase due to inflation and decrease due to depreciation. David is studying the change in the price
1. 0 answers
2. 716 views
What is the average rate of change formula for exponential growth functions?
1. 1 answer
2. 1,156 views
November 21, 2009, was the day of a tragic fire in the MGM Grand Hotel in Las Vegas. At the time of the fire, the hotel had only
1. 0 answers
2. 508 views
November 21, 2009, was the day of a tragic fire in the MGM Grand Hotel in Las Vegas. At the time of the fire, the hotel had only
1. 0 answers
2. 477 views
How to write five times the width in algebraic expression
1. 1 answer
2. 416 views
How to right five times the width in algebraic expression
1. 1 answer
2. 355 views
Two cars traveled equal distances in different amounts of time. Car A traveled the distance in 2.4 h, and Car B traveled the
1. 2 answers
2. 1,501 views
Explain why this reaction is not feasible:CH3CHO^-Na^+ + CH3C(CH3)2Cl=CH3CH2O(CH3)2OCH3. ;->Becos of ion charge of Oxygen and Na
1. 1 answer
2. 456 views
In a large lot of electric light bulbs,5% of the bulbs are defective.calculate the probability that a random sample of 20 will
1. 0 answers
2. 587 views
Give reasons why the reaction between benzoylchloride and methanol do not attack carbon from the ring
1. 0 answers
2. 548 views
a line segment has end point P(3,6) and Q(12,18) and is dilated so that's its new endpoints are Q' (8,12). What is the scale
1. 3 answers
2. 1,303 views
Bubble wrap sells in sheets, and each sheet has 1 million individual spherical bubbles, each with a diameter of 0.01 m. What is
1. 2 answers
2. 1,215 views
The article is at the bottom for this question:Skim the article “Cruise Control” to find the name of the bumper sticker
1. 2 answers
2. 550 views
Which verb correctly completes the below sentence?The collection written by several of my favorite authors _____ research in the
1. 10 answers
2. 1,161 views
1. What act did Congress pass in order to relocate Native Americans?a.) Naturalization Act b.) Alien Act c.) Relocation Act d.)
1. 20 answers
2. 1,342 views
Is carbon phosphate an ionic, polar covalent, or non polar covalent bond?
1. 1 answer
2. 569 views
What is y if 6y+1=21y+13
1. 1 answer
2. 508 views
Marlon has 4 cards, jake has 4 cards, and Sam has 3 cards. Can u write a multiplication sentence to find how many cards they
1. 2 answers
2. 1,755 views
How many grams of CaCl2 are required to prepare 2.00 liters of 7.00 M CaCl2?
1. 0 answers
2. 599 views
I REALLY NEED HELP PLEASE PLEASE HELP ME WITH THIS JUST CHECK IF THERE RIGHT IF NOT THEN GIVE ME THE RIGHT ANSWER PLEASE PLEASE
1. 5 answers
2. 1,472 views
1) Find the surface area for a sphere with a radius of 10 feet. Round to the nearest whole number.a. 1,256 ft2 b. 4,189 ft2 c.
1. 8 answers
2. 1,239 views
Analyze the causes of anorexia in hospitalized patients.Provide two patient scenarios that commonly result in decreased food
1. 1 answer
2. 462 views
How is an inequality different from an equation? Give a real-world scenario in which you would write an inequality rather than
1. 3 answers
2. 851 views
How is an inequality different from an equation? Give a real-world scenario in which you would write an inequality rather than
1. 16 answers
2. 5,193 views
How is an inequality different from an equation? Give a real-world scenario in which you would write an inequality rather than
1. 2 answers
2. 606 views
How is an inequality different from an equation? Give a real-world scenario in which you would write an inequality rather than
1. 2 answers
2. 672 views
I am writing a persuasive essay and I need some tips on making it persuasive. It is turning out to be just an essay, not a
1. 1 answer
2. 779 views
Answer the following question in your discussion group: Sometimes people say “Give 110% of your effort.” Is it possible to
1. 4 answers
2. 929 views
Find the percent of markup. Round to the nearest whole percent.6. Store's Cost: $136.50 Selling Price: $184.70 (1 point) 48% 26%
1. 5 answers
2. 1,042 views
Find the interest earned on each account.$970 at 4 1/2% simple interest for 2 years. I don't know if I solved the problem
1. 5 answers
2. 977 views
In the Earth's Sourthern Hemisphere, what season begins in March?Spring Summer Fall Winter
1. 4 answers
2. 345 views
What are Two examples of Internet Vandalism
1. 2 answers
2. 384 views
1.What are the equivalent fraction and decimal for thirty-three and one-third%? (1 point) one over thirty-three and 0.3 one over
1. 25 answers
2. 7,462 views
Hi,I am doing a paper for school and I need to know what are some Negative and Positive Impacts of the Telegraph? I know some
1. 3 answers
2. 497 views
Find the change in temperature or elevation.1) From -16 degrees C to 23 degrees C 2) From -47 degrees C to -38 degrees C 3) From
1. 2 answers
2. 2,088 views
1) x-4-92) 15-y-7 3) 31-35-y
1. 1 answer
2. 216 views
I need to observe and identify variables and I'm in 6th grade!!! Help, this work is killing me....It's scenario 1-4 and I have
1. 2 answers
2. 448 views
All are True/False1. After WWI, Ho Chi Minh tried to get the U.S. to support independence for Vietnam. 2. Ho Chi Minh's forces
1. 2 answers
2. 624 views
5x-9y=113x+7y=19.......plz help serious..........
1. 2 answers
2. 389 views
plz help with equation 5x-9y=11=3x+7y=19
1. 1 answer
2. 488 views
Write a 150- to 200-word paragraph to explain how purpose, audience, tone, and content would impact the following topic: What do
1. 2 answers
2. 1,009 views
What do you hope to accomplish COM 155?
1. 1 answer
2. 362 views
find the intervals on which the function is increasing or decreasing and find any relative minima or maxima.f(x)=0.2x^3-0.2x^2-5
1. 1 answer
2. 637 views
what is the solution of this inequality?: x+3/x^2-5x+4>_0?
1. 0 answers
2. 282 views
what is the solution of this inequality?: x+3/x^2-5x+4>_0?
1. 0 answers
2. 289 views
Marie measured angle KLM.She said it was 60 degrees.What mistake did she make?
1. 2 answers
2. 451 views
statistical midels predict that price p (in dollars) of a new smartphone will change according to the function p= 900-4t^2,
1. 0 answers
2. 650 views
Whats is a legal ststem based on custom and court descicons?
1. 1 answer
2. 373 views
if you are riding on a ferris wheel that is 60 ft tall and it takes you 5 minutes to make 1 revolution, what is your linear
1. 1 answer
2. 640 views
the gaseous product of a reaction is collected in a 25.0L container at 27c. the pressure in the container is 300.0 kpa and the
1. 1 answer
2. 1,514 views
Tartaric acid has two acidic (ionizable) hydrogens. The acid is often present in wines and precipitates from solution as wine
1. 0 answers
2. 1,364 views
When a mixture of 10.0 g of acetylene and 10.0 g of oxygen is ignited, a complete combustion of the reactants takes place. What
1. 0 answers
2. 606 views
If a jogger's velocity begins at 2 m/s and changes to 1.5 m/s uphill, how do you know that the hiker has a negative acceleration
1. 1 answer
2. 383 views
Add polynomials0.15x^4 + 0.10x^3 - 0.01x^3 + 0.01x^2 + x 1.25x^4 + 0.11x^2 + 0.01 027x^3 + 0.99 -0.35x^4 + 15x^2 - 0.03 I don't
1. 1 answer
2. 1,282 views
Use scientific to divde the following two numbers. Express the answer using scientific notation; retain at least three decimal
1. 1 answer
2. 491 views
Sovle using the elimination method. Show your work. If the system has no solution or an infinite number of solutions, state this
1. 1 answer
2. 719 views
1,Sovle using the substitution method. Show your work. If the system has no solution or an infinite number of solutions,state
1. 1 answer
2. 538 views
An automobile with an initial speed of 4.82 m/s accelerates uniformly at the rate of 2.2 m/s2. Find the displacement of the car
1. 1 answer
2. 739 views
The size of a certain cell is 2.5 × 10–9 m. Another cell is 1.5 × 103 times larger. How large is the larger cell in
1. 5 answers
2. 3,725 views
Identify the strategy decisions a marketing manager must make in the Price area. Illustrate your answer for a local retailer.
1. 1 answer
2. 1,146 views
Discuss the type of media that might be most suitable for promoting (a) tomato soup, (b) greeting cards, (c) a business
1. 0 answers
2. 646 views
Identify the strategy decisions a marketing manager must make in the Price area. Illustrate your answer for a local retailer.
1. 0 answers
2. 1,144 views
Explain the importance of an organized new-product development process and illustrate how it might b used for (a) a new hair
1. 0 answers
2. 591 views
Discuss the dimensions for segmenting markets
1. 0 answers
2. 392 views
Read Chapter 21 and provide a succinct overview of the key components of a marketing plan.
1. 0 answers
2. 443 views
Discuss the universal functions of marketing and those functions that would apply to the products/services provided by a
1. 0 answers
2. 464 views
List and discuss the 4 P’s (marketing mix) The 4 P’s in the marketing mix consist of
1. 1 answer
2. 609 views
How many calories are absorbed by a copper spoon with a mass of 200 grams as it changes from 28°C to 33°C?A) 0.00027 B) 3 C)
1. 1 answer
2. 1,024 views
List the types of potential segmenting dimensions, and explain which you would try to apply first, second, and third in a
1. 1 answer
2. 1,424 views
write an expression that tells how to find the perimeter of a triangle with each side 2 inches long
1. 1 answer
2. 419 views
write an expression that tells how to find the perimeter of a triangle with each side 2 inches long
1. 2 answers
2. 460 views
What is the area of a rhombus with a 60 degree angle and sides 5 cm long?
1. 1 answer
2. 560 views
Blockbust video collected data to figure out how many movies they were renting per month. After 5 months, the store wanted to
1. 3 answers
2. 573 views
Which statistical measure would you use if an outlier is present (mean, median, mode, or rang)? Explain.
1. 1 answer
2. 360 views
1.At what age does exercise begin to result in strength in boys and girls?a)between ages 1 and 2 b)between ages 3 and 4
1. 3 answers
2. 554 views
Two rectangular boxes are similar. One box has the length of 24 inches. and a width of 9 inches. If the other box has a length
1. 2 answers
2. 510 views
Hey, Im doing a short essay and my teacher wants me to use high level words, so not simple ones. Is there a good site which I
1. 5 answers
2. 548 views
What is the rule for this input output tabel?Input Output 5 12 8 24 11 36 14 48
1. 1 answer
2. 424 views

Pages

1
2
3

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2025