Ask a New Question

Questions and answers by

Dan

Questions (605)

Authors use the specific technics of ..............a. analysis b. narrative structure c. figurative language d. dialogue
1. 5 answers
2. 23 views
if you are to start your own exercise routine,how you like it to be done?
1. 1 answer
2. 72 views
Speech about what my school need most
1. 1 answer
2. 90 views
A 14 ft. column is subjected to total compressive load of 550 kips.Design it as reinforced concrete square tied column. Use
1. 1 answer
2. 173 views
Solve the equation forx if 0≤x<2π . 4sin^2x+4cosx−5=0 theta =
1. 5 answers
2. 135 views
Hi, I need help with the Connexus Algebra 2 Semester B exam
1. 3 answers
2. 253 views
Find three cubed roots for the complex number:125/2+125/2 i√3. answer with r= and theta = ___degrees ___degrees and ___degrees
1. 3 answers
2. 113 views
Solve the equation forx if 0≤x<2π. 4sin^2x+4cosx−5=0 θ=
1. 3 answers
2. 136 views
Let tan A=−12/5 with A in QII and findcsc(2A)=
1. 3 answers
2. 154 views
Find the following product.(3+i)(3−i)=
1. 1 answer
2. 122 views
Use the unit circle to find all values ofθ between 0 and 2 π for which tan θ = − 1 Answer exactly in terms of π (enter
1. 1 answer
2. 124 views
Write the equation with polar coordinates. Use "theta" forθ x+y=10 r=
1. 3 answers
2. 130 views
Rewrite the expression as a sum or difference, then simplify if possible.4sin(6x)cos(5x)=
1. 1 answer
2. 147 views
Find the quotientz1/z2 in standard form. Convert to trigonometric form and find the quotient to check your answer. z1=2+2i ,
1. 1 answer
2. 157 views
Simplify the expression√81−y ^2 as much as possible after substituting 9 sin x for y.
1. 1 answer
2. 157 views
Indicate the quadrant(s) in which the terminal side ofθ must lie in order that: csc θ and sec θ have the same sign..
1. 3 answers
2. 166 views
14 ft. column is subjected to total compressive load of 550 kips.Design it as reinforced concrete square tied column. Use
1. 1 answer
2. 203 views
Given: A 20ft. Span, simple supported beam is uniformly loaded with 8kips/ft.-Find shear and bending stresses for a rectangular
1. 1 answer
2. 258 views
Connection as in Fig. 11.6 carries a total load of 200 kips. Plates of A992 with Fy=50ksi, Fu=65 ksi are attached with 6/8 in
1. 1 answer
2. 152 views
A coin is tossed three times. In a gambling game, a man is paid $10 if he gets all heads or all tails and he pays out $6 if
1. 1 answer
2. 397 views
The function f is defined by f(x)=4x^3+2ax^2+x+b, where a and b are constants.i) Given that x^2-3x-4 is a factor of f(x), find
1. 1 answer
2. 266 views
ii) Given that x^4-2x^3+ax^2-2 =x(x-1)(x+1)Q(x)+4x^2+bx+c is an identity, state the degree of the polynomial Q(x).ii) Find the
1. 1 answer
2. 264 views
A balloon is filled with hydrogen at a temperature of 22.0 C and a pressure of 812 mm Hg. If the balloon's original volume was
1. 1 answer
2. 489 views
If 35 mL of a 1.20 M solution of hydrogen peroxide completely decomposes, how many grams of oxygen are produced?
1. 1 answer
2. 405 views
Read the following description.Clusters of cells located near the carotid artery in the neck sense the amount of oxygen in the
1. 0 answers
2. 254 views
Water is draining from a small cylindrical tank into a larger one below it. The small cylindrical tank has a radius of 4 feet
1. 1 answer
2. 627 views
A mass of 0.750 kg is hung from a vertical spring with a spring constant of 20 N/m. After coming to equilibrium the mass is then
1. 1 answer
2. 419 views
Find the equation of the tangent line to f(x) = 1/√(x) at x = 4. Express your answer in both standard and y=mx+b form. Use
1. 1 answer
2. 275 views
A toy rocket is launched in the air so that its height, s, at time s(t) = -5t^2 + 30t + 2. What is the instantaneous velocity at
1. 1 answer
2. 318 views
Rationalize the numerator.((√(x+h)) -x)/x
1. 1 answer
2. 339 views
How many gr of Sodium sulfate need to be added to 100ml of destilled water in order to make a 100% saturated solution?
1. 1 answer
2. 279 views
Rationalize the numerator.((√a) -2)/(a-4)
1. 1 answer
2. 254 views
(√5+2)/(2√5-1)
1. 3 answers
2. 174 views
The inverse of an exponential function is a logarithmic function with the same basea) True b) False
1. 1 answer
2. 401 views
Here is a graph of the function y = r(t) = tan(cos(πt) + .5) + 2:ibb.co/9qQjRvJ (Link to image) Estimate the total area under
1. 3 answers
2. 398 views
The radius of a wheel rolling on the ground is 65 cm. If the wheel rotates through an angle of 900 degrees in 5 seconds, how far
1. 1 answer
2. 462 views
Use square method to solve this quadratic equation:X^2+8x=0
1. 1 answer
2. 201 views
Below is the graph of y = g'(x), (which looks like the following):f(x) { 3 x<2} x-3 x>2 Here are the questions: Answer the
1. 3 answers
2. 784 views
An even function has 3 distinct roots and end behaviours where f(x) -> - infinity as x-> +- infinity. State one possible
1. 3 answers
2. 254 views
State the equation of a reciprocal function that meets the following conditions by justifying your choices:-vertical asymptote
1. 1 answer
2. 274 views
When investing money in stock markets, often investors look at the net profit margin ratio for a company. The net profit margin
1. 1 answer
2. 295 views
Scott and Ian design a cool T- shirt for snow boarders. Their friends are very impressed and everyone wants one. So, Scott and
1. 1 answer
2. 397 views
After an accident, the concentration, C, in grams per litres, of a pollutant after t minutes in a 5,000,000 litres lake can be
1. 2 answers
2. 250 views
Describe how the graph of y=-2f(3x+9)+4 can be obtained from the graph of f(x) = x^4. Be sure to use full sentences when
1. 1 answer
2. 319 views
Solve the rational inequality (1/x+2)+(1/2-x)<= (3x+8/x^2-4) by providing full algebraic solutions using an interval chart.
1. 1 answer
2. 366 views
Without graphing the function f(x)=(2x+1)(x-4)^2 determine:a) the degree of the function b) the type of polynomial function c)
1. 4 answers
2. 351 views
Determine an expression for f(x) in which:f(x) is a cubic function, has two roots, f(x) >= 0 when x <= 2, f(x)<0 when x>2
1. 1 answer
2. 286 views
Given the function y= (2x-3)(3x-1), which finite differences will be constant?a) first differences b) second differences c)
1. 1 answer
2. 1,169 views
The relationship between velocity , force, radius and viscosity
1. 1 answer
2. 290 views
A plane progressive wave is given by y=0.1sin(2000πt-20πx\17)
1. 1 answer
2. 291 views
Hello, I don't know how I would do this question: Expand the first 3 (three) terms of the following: (2z^3-3y^3)^6How would I do
1. 2 answers
2. 254 views
Calculate the sum of the following series: -6 + 24 – 96 + … + 98304
1. 1 answer
2. 245 views
Expand the first 3 (three) terms of the following: (2z^3-3y^3)^6
1. 2 answers
2. 251 views
Calculate the sum of the following series: -6 + 24 – 96 + … + 98304
1. 2 answers
2. 459 views
The point P(-4,9) is on the terminal arm of ∠A(a) Find the primary trigonometric ratios (sinA, cosA, tanA) in exact values.
1. 1 answer
2. 1,219 views
A sail boat on lake Huron leaves Southampton and sails 20 degrees west of north for 20km. At the same time, a fishing boat
1. 2 answers
2. 419 views
Given that the graph of f(x) passes through the point ( 9, 7 ) and that the slope of its tangent line at (x,f(x)) is 3 x + 5,
1. 1 answer
2. 1,666 views
calculate work done using machine to raise a load of 10kg through height of 2m and effenciency is 70%
1. 1 answer
2. 614 views
If θ is an angle in standard position and its terminal side passes through the point (12,35), find the exact value of cotθ in
1. 1 answer
2. 514 views
You start at 3 ¾ on the number line. Choose a distance that you are jumping between ½ and 1. Where would you land if you made
1. 1 answer
2. 414 views
Choose a fraction between ½ and 1. Suppose you make 7 ½ jumps of that amount. On the number line, you START at ½ . Where do
1. 1 answer
2. 546 views
Explain why multiplying a fraction by5/6 results in a value that is less than the original fraction.
1. 1 answer
2. 635 views
I really need help. Thank you!!1.Explain (not describe) the solubility behavior of table salt in water. 2. Explain (not
1. 1 answer
2. 361 views
After the melting point determination it is not advisable to use the used capillary with the solidified sample for a subsequent
1. 1 answer
2. 317 views
150g of ice is removed from a freezer at a temperature of -15°C. The ice is left, eventually reaching thermal equilibrium with
1. 1 answer
2. 601 views
How do you do the multiplication table from 0 - 10 with nested loops ?
1. 1 answer
2. 311 views
Write a program to display a multiplication table that shows products of all numbers from 0 to 10. Use nested loops to created
1. 0 answers
2. 348 views
I need to complete some important questions for math, but I am unsure of how to complete them. Here are the questions I need
1. 1 answer
2. 1,088 views
A parabola has the root of √13 and passes through (-5,4) Determine the equation of the parabola.
1. 1 answer
2. 417 views
Inventions that revolutionised food preservation in the 19th century
1. 1 answer
2. 363 views
A teacher asks each student to pick a four or five digit password using the numbers 0 to 9. If repetition is not allowed, how
1. 1 answer
2. 354 views
Hello, I am not sure how to do this one. Thanks!List the transformations in words, of f(x) for the following function: g(x) =
1. 2 answers
2. 291 views
An unknown element X forms a compound with bromine: XBr. Predict the chemical formula of the compound that element X makes with
1. 4 answers
2. 2,051 views
(arcsin(x/2)+arccos(x/2))/arctan(x) = 3/2, solve for x if x >0. Thanks.
1. 1 answer
2. 670 views
a,b,c shared pencils in the ratio 3:5:7 respectively. If c got 12 pencils more than a, how many pencils did they share
1. 1 answer
2. 452 views
What is the sum of 500 gonna
1. 1 answer
2. 345 views
It is known that a>0 and b<0. Compare the values of the following expressions to zero:a^3b -ab^3 (a+b)^2 I need help
1. 1 answer
2. 294 views
What was known as Hitler's Final Solution?I think it's the genocide of European Jews
1. 1 answer
2. 841 views
One cause of the outbreak of World War I was caused by1:The outbreak of the Russian Revolution 2:Rising tensions among European
1. 4 answers
2. 855 views
910 students in a class 2/5 are girls and 2/7 of the girls play netball. How many girls play netball
1. 2 answers
2. 1,055 views
A sales lady is paid on commission 4%on the first sh2000006%on next sh300000 8%on any sales above sh 500000 On one month her
1. 1 answer
2. 467 views
A force of 0.8N stretches an elastic spring by 4cm. Calculate the elastic constant.
1. 1 answer
2. 681 views
For Mary’s party, she asked her dad to buy 18 bottles of soft drink. Each bottle contained 1 1/4 litres. The glasses they had
1. 3 answers
2. 2,000 views
Ginas bathroom needs new tile. At the tile store 4 cm x 4 cm squares cost 19 cents each, 8 cm x 8 cm squares cost 73 cents each,
1. 2 answers
2. 459 views
A box contains 8 red marbles, 8 green marbles, and 10 black marbles. A sample of 12 marbles is to be picked from the box. How
1. 1 answer
2. 902 views
Find the equation of the circle that passes through the point of intersection of the circles x^2+y^2=2x, x^2+y^2=2y and contains
1. 1 answer
2. 434 views
7. Which of the following is a way that Native Americans in Washington have become moreeconomically self-sufficient? 1.canoe
1. 8 answers
2. 1,164 views
"In this lesson, you learned about renewable energy resources and nonrenewable energy resources. Think about the resources
1. 3 answers
2. 1,461 views
Solve the system of equations algebraically. Show all of your steps.y=x^2+2x y=3x+20
1. 2 answers
2. 3,752 views
(a) If your relaxed eye has a refractive power of 56.0 D, and your lens-to-retina distance is 2.35 cm, determine if you are
1. 1 answer
2. 713 views
how do i answer this. A series RL circuit contains two resistors and two inductors.the resistors are 33 ohms and 47 ohms the
1. 1 answer
2. 4,047 views
Which religion was prominent to much of North Africa in the early 1800s?
1. 1 answer
2. 801 views
A golfer hits a shot to an elevated green. The ball leaves the club with an initial speed of 16 m/s at an angle of 58' above the
1. 6 answers
2. 5,153 views
the value of a machine depreciates each year by 15%of its value at the beginning of that year. if its value when new on 1st
1. 1 answer
2. 503 views
I have two questions and I have answers for them and I don't know if there right or not. The ones that have stars by the answers
1. 1 answer
2. 694 views
Given:WBC count is 10,000 per cubic millimeter of blood; Blood volume is 5 liters; 60% of WBC are neutrophils; Their average
1. 0 answers
2. 523 views
Finddy/dt where y = 2 sqrt(2)− 4 and dx/dt = 9 when x = 4. I found the derivative of y=2sqrt(2)-4 but I am stuck as to where
1. 1 answer
2. 379 views
Convert the information described below into balanced equation:(a) When a mixture of copper(II) oxide and carbon is heated,
1. 1 answer
2. 877 views
a large pizza costs $6.80 plus $.90 per topping. a different pizza costs $7.30 plus $.65 per topping. How many toppings need to
1. 1 answer
2. 522 views
What is a modern form of paper.
1. 3 answers
2. 556 views

Pages

1
2
3
4
5
6
7

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2025