Ask a New Question

Questions and answers by

Anne

Questions (455)

In an effort to help a student understand the concept of shading, which teaching strategy could an educator use to help someone
1. 5 answers
2. 958 views
In which sentence is the meaning of the word blackmail best represented?A. they hoped that her envy would not cause blackmail B.
1. 4 answers
2. 725 views
In the following sentence, what word does the participial phrase modify?Everyone in the annex heard her screaming loudly. A.
1. 5 answers
2. 1,156 views
A transformer has N1=709turns in the primary coil and N2=1848turns in the secondary coil. If the input voltage is
1. 0 answers
2. 560 views
An inductor (L=440mH), a capacitor (C=6.00μF), and a resistor (R=440Ω) are connected in series. A 75.0Hz ac generator produces
1. 0 answers
2. 674 views
A capacitor is rolled from two strips of aluminum separated by two strips of paraffin-coated paper. Each strip is 5.40cm wide.
1. 0 answers
2. 705 views
Whats chapter 2 the of mice and men about?
1. 7 answers
2. 681 views
What resources help with farming in Europe?
1. 2 answers
2. 664 views
a water tank is 10 m in diameter and 16m high. if the tank is to be completely filled, determine the minimum thickness of the
1. 0 answers
2. 866 views
Help!! I would greatly appreciate help with this question. Consider a pulse of laser light aimed at the Moon that bounces back
1. 1 answer
2. 1,764 views
Juan lives 2.5 miles to the park. It took him 12 minutes to ride his bike to the park. What was his average speed in miles per
1. 8 answers
2. 4,239 views
in the theory of learning the rate at which the subject is memorized is assumed to be directly proportional to the amount left
1. 1 answer
2. 2,875 views
The marks of 100 students in an examination are normally distributed with mean of 25 marks and a standard deviation of 10 marks.
1. 7 answers
2. 1,512 views
National Health Corporation (NHC) has a cumulative preferred stock issue outstanding, which has a stated annual dividend of $8
1. 0 answers
2. 1,022 views
your team has two x·sq-tiles, three x-tiles, and one unit tile on his desk and another person has one x·sq- tile, five
1. 1 answer
2. 515 views
Time: Saturday, from 9 A.M. to 6 P.M.Does this sentence need the comma after Saturday?
1. 1 answer
2. 496 views
Bid and buy wonderful prizes from around the world. Does this sentence need a comma?
1. 1 answer
2. 667 views
find equations for the osculating normal and rectifying planes to the curve x=3t-t^2, y=3t^2, z=3t+t^3 at point where t=1
1. 2 answers
2. 735 views
A 15g bullet is fired horizontally into a block of wood with a mass of 2.5 k and embedded in the block. Initially the block of
1. 2 answers
2. 4,096 views
Some types of fuses used to protect electric meters have resistances of several ohms. Is this objectionable (a) in ammeter
1. 1 answer
2. 2,437 views
The square of the sum of 2x and 3y is equal to the sum of the square of y and the square root of x. Which of the following
1. 1 answer
2. 454 views
Find the Exact Value of the Compositioncos(arcsin(1/4))
1. 1 answer
2. 524 views
Why might a business invest in another company's stock? Explain.
1. 1 answer
2. 465 views
a 12 V battery is made of 36 cells each rates at 2V and 1.5 A for a given duty cycle. what is the line current and power that
1. 1 answer
2. 457 views
a 12 V battery is made of 36 cells each rates at 2V and 1.5 A for a given duty cycle. what is the line current and power that
1. 4 answers
2. 502 views
How is the atomic structure of a Copper differ from Germanium, Silicon and Gallium Arsenide ?Tnx :))
1. 2 answers
2. 5,785 views
Let n = c x p, where p is a prime number, and c is a composite number less than p. The number c has three unique prime factors.
1. 1 answer
2. 607 views
In a hardware store the ratio of shovels to rakes is 3:5. If there are 10 more rakes than shovels, how many rakes are there in
1. 1 answer
2. 2,334 views
What is the main benefit of using scientific names instead of common names for organisms?Scientific names have been around for
1. 29 answers
2. 2,668 views
Read this passage by Booker T.Washington:I am in favor of every measure that will give to woman, the opportunity to develop to
1. 7 answers
2. 741 views
what are the advantages of privatization of Government Owned and Controlled Companies (GOCC)in a country?
1. 1 answer
2. 501 views
which property of nutrients shows that they are a type of matter?A. Nutrients are colorful B.Nutrients can do work C. Nutrients
1. 4 answers
2. 1,863 views
a certain 12v storage battery with an internal resistance of 12 ohms delivers 80 A when used to crank a gasoline engine. if the
1. 2 answers
2. 696 views
What is the integral of [(2x-y)^2]dx?
1. 0 answers
2. 345 views
Using the matrix [cosx -sinx][sinx cosx] rotate the parabola y=3x^2+2 by 45 degrees. State the equation of the rotated parabola
1. 1 answer
2. 510 views
The pet shop owner told Jean to fill her new fish tank 3/4 full with water. Jean filled it 9/12 full. What fraction of the tank
1. 2 answers
2. 612 views
what is the significance of the internment of Japanese Americans during World War II.
1. 3 answers
2. 648 views
how can you tell if an equal share is more than one whole?
1. 6 answers
2. 2,233 views
How does gravity keep the planets in motion around a star?
1. 2 answers
2. 477 views
Alice has two part-time jobs. One job she makes 8 dollars per hour and the other she makes 12 dollars per hour. One week she
1. 2 answers
2. 702 views
Source: "Brutus" Letter XVI April 10, 1788, "John DeWitt" Letter III Nov. 5, 1787, Anti-federalists PapersThey uniformly
1. 1 answer
2. 910 views
When graphing the integral of sin(x^2) is there a way to shift the graph vertically, without just tacking "+c" on the end?If it
1. 1 answer
2. 495 views
A trailer with a mass of 2.00x 10^3 kg is pulled by a truck with a mass of 3.00 x 10^3 kg. If the applied force is 8750 N and
1. 1 answer
2. 513 views
A trailer with a mass of 2.00x 10^3 kg is pulled by a truck with a mass of 3.00 x 10^3 kg. If the applied force is 8750 N and
1. 1 answer
2. 621 views
How many weeks does it take for a seed to start germinating? Does it depends?
1. 3 answers
2. 326 views
How many cups of water are needed for a plant to begin germinating?
1. 3 answers
2. 330 views
Water freezes at 0 Celisus. If a temperature drop is causing a glass of water to freeze, how would a thermometer in the water
1. 6 answers
2. 1,116 views
Scientific investigations involve many steps and processes. Which characteristics define a laboratory experiment?A. hypothesis,
1. 7 answers
2. 1,836 views
Astrologers relate the location of stars and planets to events in human lives. Many years ago, people classified astrology as a
1. 1 answer
2. 1,442 views
find the value of r so that the line that passes through each pair of points has the given slope(r,4), (7,1), m=
1. 1 answer
2. 601 views
The deciles of any distribution are the 10th, 20th,...90th percentiles. The first and last deciles are the 10th and 90th
1. 1 answer
2. 1,404 views
What is a object in which the electrons at one end spin in one direction and the electrons at the other end spin in an opposite
1. 0 answers
2. 458 views
What is a object in which the electrons at one end spin in one direction and the electrons at the other end spin in an opposite
1. 4 answers
2. 689 views
Suppose you had written 50 letters and addressed 50 envelopes and then inserted the letters randomly.What is the probability
1. 0 answers
2. 457 views
Suppose you walk 18.0m straight west and then 25.0 m straight north. How far are you from your starting point and what is the
1. 2 answers
2. 4,085 views
Four years ago, an art collector bought a painting for $32 500. He knows that this painting appreciates at15% a year. What is
1. 1 answer
2. 714 views
$20 000 is invested in a term deposit at 5.4% p.a. with monthly rests. What will be the value of thisinvestment after 3 years?
1. 1 answer
2. 416 views
Quarterly changes in population are converted to an annual change by multiplying growth factors. Agrowth factor = 1 + i where i
1. 0 answers
2. 497 views
In January this year, Kathryn bought a new computer for $6000. She estimates its useful life as 5 years and its scrap value as
1. 0 answers
2. 461 views
Electric charge charge is distributed uniformly along a thin rod of length "a", with total charge Q. Take the potential to be
1. 2 answers
2. 1,440 views
A rectangular field is to be enclose by 800 meters of fencing and the fourth side with be along the side of a barn.A) What
1. 1 answer
2. 1,102 views
Please could you help me unscramble each of the clue words in Spanish: issmpna os hewiaesIt is either a breakfast or lunch?
1. 0 answers
2. 552 views
1)An elastic material has a length of 36cm when a load of 40N is hung on it and a length of 45cm when a load of 60N is hung on
1. 1 answer
2. 1,445 views
Solve the trig equation exactly over the indicated interval.tanθ = 0, all real numbers I know the answer is πn, but I don't
1. 2 answers
2. 596 views
The number of red cards in Lyle's trading card collection is directly is proportional to the number of yellow cards. At one
1. 1 answer
2. 421 views
Ray wanted to put his tomato plants in rows with the same numbers of plants in each row. He knew that if he planted 5,6, or 7
1. 6 answers
2. 677 views
hailey wants to rake her entire yard. This morning she raked 1/3 of the yard, and this afternoon she raked another 3/5 of the
1. 3 answers
2. 895 views
There are 12 girls and 9 boys in Mrs. Johnson's classroom. She said that if she randomly selects one student from her classroom
1. 6 answers
2. 1,508 views
The Bough and Bud Company combined an insect spray with a growth hormone to produce the MOP (More Oranges Production) Treatment,
1. 0 answers
2. 486 views
For the area shown on the attached chart, show/prove that the magnetic variation in 2013 would be 10°5’E.
1. 1 answer
2. 343 views
an example of play that relates to a curriculum standard in mathematics for preschoolers?
1. 0 answers
2. 333 views
Ms. Lewis is a chemist mixing two solutions together. A chemical reaction takes place, and the solution becomes warm. Which
1. 1 answer
2. 2,052 views
A club is selling mugs with three different sports logos. The club sold 2(4m-25) football mugs, 2(4m-15) basketball mugs, and
1. 1 answer
2. 520 views
Which of the following expressions is the simplified form of -8+3(2p-4)+10p ?A. 16p-20 B. 8p-10 C. 6p-12 D. 12p-9
1. 4 answers
2. 618 views
Which of the following expressions is the simplified form of 3y+8y-4+7-2y?A. 11y+3 B. 9y-11 C. 11y-3 D. 9y+3
1. 2 answers
2. 578 views
1.Which of the following accurately describes the relationship between cyanobacteria and halophiles?A.Cyanobacteria are
1. 2 answers
2. 1,542 views
The passage of the Civil War amendments—the Thirteenth, Fourteenth, and Fifteenth Amendments—did not end discrimination of
1. 2 answers
2. 1,224 views
Two out of every 10 students in a school have a dog. Expressed as a decimal to the nearest hundredth, what is the probability
1. 2 answers
2. 415 views
A robot probe drops a camera off the rim of a 455 m high cliff on Mars, where the free-fall acceleration is 3.7 m/s2.Find the
1. 1 answer
2. 1,201 views
A certain car is capable of accelerating at a uniform rate of 0.93 m/s2. What is the magnitude of the car’s displacement as it
1. 3 answers
2. 753 views
The SI unit of length is a meter, which is defined as the length equal to 1,650,763.73 wavelengths of light emitted by a
1. 3 answers
2. 3,028 views
Describe how to make 500.0 mL of 3.6 M acetone
1. 1 answer
2. 320 views
In an experiment to measure the solubility of Ba(OH)2 x 8H2O in water, an excess of solid Ba(OH)2 x 8H2O was stirred with water
1. 1 answer
2. 660 views
The solubility of CaSO4 is 0.209 g/100 mL of water at 30 degrees celsius. if 0.500 g CaSO4 is stirred overnight at 30 Degrees
1. 1 answer
2. 595 views
a 2.00 g sample of zinc was dissolved in 50.0 mL of 6.0 M HCL the final volume of solution was 50.2 mL...a. what was the
1. 1 answer
2. 553 views
assuming that each molecule contains one acidic hydrogen---that is, the formula is HCnHmOp?assumin gthat each molecule contains
1. 1 answer
2. 1,075 views
By titration 24.68mL of 0.1017 M NaOH is required to neutralize 0.1482 g of an unknown organic acid. what is the formula mass of
1. 1 answer
2. 510 views
Pluralists believe that the dominant player in American politics is (1 point)the president. groups. the government. rich
1. 6 answers
2. 979 views
A cannonball is fired with a velocity of 200 m/s at an angle of 25 degrees above the ground. After the total flight of 45.6
1. 2 answers
2. 1,098 views
A car of mass 1396 kg is parked on a very slippery hillside.To keep it from sliding down the hill (è = 15°), the owner
1. 0 answers
2. 485 views
Block 1 sits on a table with rope that is attached to block 2 hanging over the edge where m1 = 43 kg and m2 = 11 kg. Assume that
1. 0 answers
2. 476 views
Block 1 is up an incline and is attacthed to block 2 by a rope, with m2 = 5.0 kg and è = 33°.If the coefficient of static
1. 0 answers
2. 419 views
Consider a swimmer who wants to swim directly across a river. If the speed of the current is 0.31 m/s and the swimmer's speed
1. 1 answer
2. 1,116 views
A soccer ball is kicked with an initial speed of 23 m/s at an angle of 20° with respect to the horizontal.(a) Find the maximum
1. 0 answers
2. 1,012 views
A baseball is hit with an initial speed of 42 m/s at an angle of 30° relative to the x (horizontal) axis.(a) Find the speed of
1. 0 answers
2. 453 views
A bullet is fired from a rifle with a speed v0 at an angle è with respect to the horizontal axis from a cliff that is a height
1. 0 answers
2. 518 views
A block slides down an inclined plane that makes an angle of 23° with the horizontal. There is friction between the block and
1. 0 answers
2. 639 views
Critics argue that they slow down decision-making and create conflict. Evaluate the criticisms, and explain the justification
1. 1 answer
2. 540 views
Can someone correct my paragraph?Write a good, 6 sentence paragraph using both the passé compose and imparfait describing a
1. 5 answers
2. 832 views
An object is thrown vetically upward with an initial velocity of 14.7 m/s.How long does it take for the object to be 9.8 m from
1. 1 answer
2. 758 views

Pages

1
2
3
4
5

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2025