Ask a New Question

Questions and answers by

Anne

Questions (455)

In an effort to help a student understand the concept of shading, which teaching strategy could an educator use to help someone
1. 5 answers
2. 949 views
In which sentence is the meaning of the word blackmail best represented?A. they hoped that her envy would not cause blackmail B.
1. 4 answers
2. 721 views
In the following sentence, what word does the participial phrase modify?Everyone in the annex heard her screaming loudly. A.
1. 5 answers
2. 1,154 views
A transformer has N1=709turns in the primary coil and N2=1848turns in the secondary coil. If the input voltage is
1. 0 answers
2. 553 views
An inductor (L=440mH), a capacitor (C=6.00μF), and a resistor (R=440Ω) are connected in series. A 75.0Hz ac generator produces
1. 0 answers
2. 670 views
A capacitor is rolled from two strips of aluminum separated by two strips of paraffin-coated paper. Each strip is 5.40cm wide.
1. 0 answers
2. 698 views
Whats chapter 2 the of mice and men about?
1. 7 answers
2. 677 views
What resources help with farming in Europe?
1. 2 answers
2. 660 views
a water tank is 10 m in diameter and 16m high. if the tank is to be completely filled, determine the minimum thickness of the
1. 0 answers
2. 860 views
Help!! I would greatly appreciate help with this question. Consider a pulse of laser light aimed at the Moon that bounces back
1. 1 answer
2. 1,760 views
Juan lives 2.5 miles to the park. It took him 12 minutes to ride his bike to the park. What was his average speed in miles per
1. 8 answers
2. 4,232 views
in the theory of learning the rate at which the subject is memorized is assumed to be directly proportional to the amount left
1. 1 answer
2. 2,870 views
The marks of 100 students in an examination are normally distributed with mean of 25 marks and a standard deviation of 10 marks.
1. 7 answers
2. 1,502 views
National Health Corporation (NHC) has a cumulative preferred stock issue outstanding, which has a stated annual dividend of $8
1. 0 answers
2. 1,019 views
your team has two x·sq-tiles, three x-tiles, and one unit tile on his desk and another person has one x·sq- tile, five
1. 1 answer
2. 511 views
Time: Saturday, from 9 A.M. to 6 P.M.Does this sentence need the comma after Saturday?
1. 1 answer
2. 493 views
Bid and buy wonderful prizes from around the world. Does this sentence need a comma?
1. 1 answer
2. 661 views
find equations for the osculating normal and rectifying planes to the curve x=3t-t^2, y=3t^2, z=3t+t^3 at point where t=1
1. 2 answers
2. 731 views
A 15g bullet is fired horizontally into a block of wood with a mass of 2.5 k and embedded in the block. Initially the block of
1. 2 answers
2. 4,089 views
Some types of fuses used to protect electric meters have resistances of several ohms. Is this objectionable (a) in ammeter
1. 1 answer
2. 2,426 views
The square of the sum of 2x and 3y is equal to the sum of the square of y and the square root of x. Which of the following
1. 1 answer
2. 450 views
Find the Exact Value of the Compositioncos(arcsin(1/4))
1. 1 answer
2. 518 views
Why might a business invest in another company's stock? Explain.
1. 1 answer
2. 462 views
a 12 V battery is made of 36 cells each rates at 2V and 1.5 A for a given duty cycle. what is the line current and power that
1. 1 answer
2. 450 views
a 12 V battery is made of 36 cells each rates at 2V and 1.5 A for a given duty cycle. what is the line current and power that
1. 4 answers
2. 494 views
How is the atomic structure of a Copper differ from Germanium, Silicon and Gallium Arsenide ?Tnx :))
1. 2 answers
2. 5,773 views
Let n = c x p, where p is a prime number, and c is a composite number less than p. The number c has three unique prime factors.
1. 1 answer
2. 602 views
In a hardware store the ratio of shovels to rakes is 3:5. If there are 10 more rakes than shovels, how many rakes are there in
1. 1 answer
2. 2,328 views
What is the main benefit of using scientific names instead of common names for organisms?Scientific names have been around for
1. 29 answers
2. 2,657 views
Read this passage by Booker T.Washington:I am in favor of every measure that will give to woman, the opportunity to develop to
1. 7 answers
2. 734 views
what are the advantages of privatization of Government Owned and Controlled Companies (GOCC)in a country?
1. 1 answer
2. 496 views
which property of nutrients shows that they are a type of matter?A. Nutrients are colorful B.Nutrients can do work C. Nutrients
1. 4 answers
2. 1,855 views
a certain 12v storage battery with an internal resistance of 12 ohms delivers 80 A when used to crank a gasoline engine. if the
1. 2 answers
2. 687 views
What is the integral of [(2x-y)^2]dx?
1. 0 answers
2. 341 views
Using the matrix [cosx -sinx][sinx cosx] rotate the parabola y=3x^2+2 by 45 degrees. State the equation of the rotated parabola
1. 1 answer
2. 506 views
The pet shop owner told Jean to fill her new fish tank 3/4 full with water. Jean filled it 9/12 full. What fraction of the tank
1. 2 answers
2. 608 views
what is the significance of the internment of Japanese Americans during World War II.
1. 3 answers
2. 642 views
how can you tell if an equal share is more than one whole?
1. 6 answers
2. 2,225 views
How does gravity keep the planets in motion around a star?
1. 2 answers
2. 467 views
Alice has two part-time jobs. One job she makes 8 dollars per hour and the other she makes 12 dollars per hour. One week she
1. 2 answers
2. 696 views
Source: "Brutus" Letter XVI April 10, 1788, "John DeWitt" Letter III Nov. 5, 1787, Anti-federalists PapersThey uniformly
1. 1 answer
2. 906 views
When graphing the integral of sin(x^2) is there a way to shift the graph vertically, without just tacking "+c" on the end?If it
1. 1 answer
2. 491 views
A trailer with a mass of 2.00x 10^3 kg is pulled by a truck with a mass of 3.00 x 10^3 kg. If the applied force is 8750 N and
1. 1 answer
2. 508 views
A trailer with a mass of 2.00x 10^3 kg is pulled by a truck with a mass of 3.00 x 10^3 kg. If the applied force is 8750 N and
1. 1 answer
2. 616 views
How many weeks does it take for a seed to start germinating? Does it depends?
1. 3 answers
2. 323 views
How many cups of water are needed for a plant to begin germinating?
1. 3 answers
2. 326 views
Water freezes at 0 Celisus. If a temperature drop is causing a glass of water to freeze, how would a thermometer in the water
1. 6 answers
2. 1,109 views
Scientific investigations involve many steps and processes. Which characteristics define a laboratory experiment?A. hypothesis,
1. 7 answers
2. 1,830 views
Astrologers relate the location of stars and planets to events in human lives. Many years ago, people classified astrology as a
1. 1 answer
2. 1,436 views
find the value of r so that the line that passes through each pair of points has the given slope(r,4), (7,1), m=
1. 1 answer
2. 596 views
The deciles of any distribution are the 10th, 20th,...90th percentiles. The first and last deciles are the 10th and 90th
1. 1 answer
2. 1,399 views
What is a object in which the electrons at one end spin in one direction and the electrons at the other end spin in an opposite
1. 0 answers
2. 452 views
What is a object in which the electrons at one end spin in one direction and the electrons at the other end spin in an opposite
1. 4 answers
2. 683 views
Suppose you had written 50 letters and addressed 50 envelopes and then inserted the letters randomly.What is the probability
1. 0 answers
2. 452 views
Suppose you walk 18.0m straight west and then 25.0 m straight north. How far are you from your starting point and what is the
1. 2 answers
2. 4,081 views
Four years ago, an art collector bought a painting for $32 500. He knows that this painting appreciates at15% a year. What is
1. 1 answer
2. 710 views
$20 000 is invested in a term deposit at 5.4% p.a. with monthly rests. What will be the value of thisinvestment after 3 years?
1. 1 answer
2. 411 views
Quarterly changes in population are converted to an annual change by multiplying growth factors. Agrowth factor = 1 + i where i
1. 0 answers
2. 490 views
In January this year, Kathryn bought a new computer for $6000. She estimates its useful life as 5 years and its scrap value as
1. 0 answers
2. 457 views
Electric charge charge is distributed uniformly along a thin rod of length "a", with total charge Q. Take the potential to be
1. 2 answers
2. 1,434 views
A rectangular field is to be enclose by 800 meters of fencing and the fourth side with be along the side of a barn.A) What
1. 1 answer
2. 1,096 views
Please could you help me unscramble each of the clue words in Spanish: issmpna os hewiaesIt is either a breakfast or lunch?
1. 0 answers
2. 546 views
1)An elastic material has a length of 36cm when a load of 40N is hung on it and a length of 45cm when a load of 60N is hung on
1. 1 answer
2. 1,440 views
Solve the trig equation exactly over the indicated interval.tanθ = 0, all real numbers I know the answer is πn, but I don't
1. 2 answers
2. 591 views
The number of red cards in Lyle's trading card collection is directly is proportional to the number of yellow cards. At one
1. 1 answer
2. 417 views
Ray wanted to put his tomato plants in rows with the same numbers of plants in each row. He knew that if he planted 5,6, or 7
1. 6 answers
2. 672 views
hailey wants to rake her entire yard. This morning she raked 1/3 of the yard, and this afternoon she raked another 3/5 of the
1. 3 answers
2. 889 views
There are 12 girls and 9 boys in Mrs. Johnson's classroom. She said that if she randomly selects one student from her classroom
1. 6 answers
2. 1,502 views
The Bough and Bud Company combined an insect spray with a growth hormone to produce the MOP (More Oranges Production) Treatment,
1. 0 answers
2. 481 views
For the area shown on the attached chart, show/prove that the magnetic variation in 2013 would be 10°5’E.
1. 1 answer
2. 338 views
an example of play that relates to a curriculum standard in mathematics for preschoolers?
1. 0 answers
2. 326 views
Ms. Lewis is a chemist mixing two solutions together. A chemical reaction takes place, and the solution becomes warm. Which
1. 1 answer
2. 2,044 views
A club is selling mugs with three different sports logos. The club sold 2(4m-25) football mugs, 2(4m-15) basketball mugs, and
1. 1 answer
2. 512 views
Which of the following expressions is the simplified form of -8+3(2p-4)+10p ?A. 16p-20 B. 8p-10 C. 6p-12 D. 12p-9
1. 4 answers
2. 612 views
Which of the following expressions is the simplified form of 3y+8y-4+7-2y?A. 11y+3 B. 9y-11 C. 11y-3 D. 9y+3
1. 2 answers
2. 571 views
1.Which of the following accurately describes the relationship between cyanobacteria and halophiles?A.Cyanobacteria are
1. 2 answers
2. 1,536 views
The passage of the Civil War amendments—the Thirteenth, Fourteenth, and Fifteenth Amendments—did not end discrimination of
1. 2 answers
2. 1,219 views
Two out of every 10 students in a school have a dog. Expressed as a decimal to the nearest hundredth, what is the probability
1. 2 answers
2. 410 views
A robot probe drops a camera off the rim of a 455 m high cliff on Mars, where the free-fall acceleration is 3.7 m/s2.Find the
1. 1 answer
2. 1,195 views
A certain car is capable of accelerating at a uniform rate of 0.93 m/s2. What is the magnitude of the car’s displacement as it
1. 3 answers
2. 750 views
The SI unit of length is a meter, which is defined as the length equal to 1,650,763.73 wavelengths of light emitted by a
1. 3 answers
2. 3,017 views
Describe how to make 500.0 mL of 3.6 M acetone
1. 1 answer
2. 315 views
In an experiment to measure the solubility of Ba(OH)2 x 8H2O in water, an excess of solid Ba(OH)2 x 8H2O was stirred with water
1. 1 answer
2. 652 views
The solubility of CaSO4 is 0.209 g/100 mL of water at 30 degrees celsius. if 0.500 g CaSO4 is stirred overnight at 30 Degrees
1. 1 answer
2. 585 views
a 2.00 g sample of zinc was dissolved in 50.0 mL of 6.0 M HCL the final volume of solution was 50.2 mL...a. what was the
1. 1 answer
2. 548 views
assuming that each molecule contains one acidic hydrogen---that is, the formula is HCnHmOp?assumin gthat each molecule contains
1. 1 answer
2. 1,070 views
By titration 24.68mL of 0.1017 M NaOH is required to neutralize 0.1482 g of an unknown organic acid. what is the formula mass of
1. 1 answer
2. 506 views
Pluralists believe that the dominant player in American politics is (1 point)the president. groups. the government. rich
1. 6 answers
2. 974 views
A cannonball is fired with a velocity of 200 m/s at an angle of 25 degrees above the ground. After the total flight of 45.6
1. 2 answers
2. 1,091 views
A car of mass 1396 kg is parked on a very slippery hillside.To keep it from sliding down the hill (è = 15°), the owner
1. 0 answers
2. 480 views
Block 1 sits on a table with rope that is attached to block 2 hanging over the edge where m1 = 43 kg and m2 = 11 kg. Assume that
1. 0 answers
2. 470 views
Block 1 is up an incline and is attacthed to block 2 by a rope, with m2 = 5.0 kg and è = 33°.If the coefficient of static
1. 0 answers
2. 415 views
Consider a swimmer who wants to swim directly across a river. If the speed of the current is 0.31 m/s and the swimmer's speed
1. 1 answer
2. 1,109 views
A soccer ball is kicked with an initial speed of 23 m/s at an angle of 20° with respect to the horizontal.(a) Find the maximum
1. 0 answers
2. 1,006 views
A baseball is hit with an initial speed of 42 m/s at an angle of 30° relative to the x (horizontal) axis.(a) Find the speed of
1. 0 answers
2. 448 views
A bullet is fired from a rifle with a speed v0 at an angle è with respect to the horizontal axis from a cliff that is a height
1. 0 answers
2. 511 views
A block slides down an inclined plane that makes an angle of 23° with the horizontal. There is friction between the block and
1. 0 answers
2. 634 views
Critics argue that they slow down decision-making and create conflict. Evaluate the criticisms, and explain the justification
1. 1 answer
2. 534 views
Can someone correct my paragraph?Write a good, 6 sentence paragraph using both the passé compose and imparfait describing a
1. 5 answers
2. 827 views
An object is thrown vetically upward with an initial velocity of 14.7 m/s.How long does it take for the object to be 9.8 m from
1. 1 answer
2. 754 views

Pages

1
2
3
4
5

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2025