Ask a New Question

Questions and answers by

Albert

Questions (92)

counter in typography
1. 1 answer
2. 18 views
bowl in typography
1. 1 answer
2. 17 views
ascenders in typography
1. 1 answer
2. 29 views
san serif in typography
1. 1 answer
2. 19 views
san serif in typography simple answer
1. 1 answer
2. 17 views
serif in typography
1. 1 answer
2. 16 views
capline definition in art simple answer
1. 1 answer
2. 20 views
variety in art simple definition
1. 1 answer
2. 16 views
variety in art simple definition
1. 1 answer
2. 16 views
proximity in art simple definition
1. 1 answer
2. 18 views
suppose someoe told you that a jungle cat is clasified in the same genus as house cats. What characteristics and behaviors do
1. 0 answers
2. 130 views
What is 5x *5
1. 0 answers
2. 93 views
What is biology
1. 0 answers
2. 100 views
Identify the area of physics that is mostly relevant to playing in a school band
1. 1 answer
2. 135 views
If h(x) = log(x) -2log(x-1), and h(x) can be written as h(x) = f(g(x)), determine functions f(x) and g(x), where neither of them
1. 1 answer
2. 360 views
Function h(t) = sin (t) cos(pi/6)+sin(pi/6)cos(t) represents height of a wave in an ocean, where h, is height in meters, and t,
1. 1 answer
2. 432 views
What is the answer to __+6=__+7
1. 1 answer
2. 192 views
There are 10^10 photons per second incident on a photo-detector at wavelength 0.8 um. Compute the power incident on the
1. 0 answers
2. 362 views
Mendel’s law of independent assortment says that the inheritance of one trait is not influenced by inheritance of another
1. 1 answer
2. 441 views
A usted le gusta comer
1. 1 answer
2. 362 views
Find the slope and y- intercept of a line by writing the equation in slope- intercept form.Hint: Convert the given equation form
1. 3 answers
2. 3,071 views
a pulley system having 5 pulleys is used to raise a 450N load. find the mechanical advantage and hence the effort if the
1. 4 answers
2. 1,996 views
Consider an electron trapped in a box of side L, in one dimension. After making a measurement of the particle position, what is
1. 0 answers
2. 214 views
a is 2x as b , b is 100x than cwhat is a, b and c
1. 1 answer
2. 317 views
A map uses a scale of 1:500 000.If a road is 10 km long, how long will it be on the map?
1. 12 answers
2. 3,230 views
In A Geometric Sequence The 3rd Term Is 24 And The 5th Term Is 3. Write Down The First Four Terms In The Sequence.
1. 3 answers
2. 1,929 views
How to select logical numbers for mark six?
1. 1 answer
2. 367 views
if the interest rate is 8.25% and you borrowed $5000 for 30 days. How much interest would you pay
1. 1 answer
2. 549 views
Critically discuss six ways in which individual,groups and broader of South African community can be influenced by humans rights
1. 1 answer
2. 564 views
The reaction NO2(g) + NO2(g) → N2O4(g) is second order with a rate constant of 0.044 /M·s at a particular temperature and
1. 1 answer
2. 881 views
k such that 3 is the remainder when f(x)=x to the 4 power minus 4xcube minus 8xsquare minus 7x plus 1. Tapos which of the
1. 1 answer
2. 685 views
g=4 pi (l/t square)
1. 1 answer
2. 569 views
What should the molar concentrations of benzoic acid and sodium benzoate be in a solution that is buffered at a pH of 4.75 and
1. 0 answers
2. 730 views
Hello, I need some help with this physics problem. This was the only one I couldn't solve, and the teacher wouldn't help me
1. 1 answer
2. 446 views
A football is thrown down the field by a quarterback from a height of 1 foot with an initial velocity of 40 feet per second at
1. 3 answers
2. 623 views
A very large book has pages numbered from 1 to 11521. How many times is the digit 3 printed?
1. 6 answers
2. 3,180 views
A wheel makes6 1/12 revolution per minute. If it rotates 45 minutes,how many revolutions does it make
1. 1 answer
2. 469 views
can someone help me prove the identities on this:1- 1/2 sin2θ = sin^3θ + cos^3θ / sinθ + cosθ
1. 1 answer
2. 496 views
sina^2θcos^2θ= 1/8 (1-cos4θ)
1. 1 answer
2. 456 views
When you solve the system shown by the elimination method, which statement is true?y + 3x = 10 −y − 3x = 10 A. You eliminate
1. 4 answers
2. 1,873 views
Solve the system using substitution.6x + y = 12 4x + 6y = −8 A. (2 1/2,3) B. (−2 1/2,−3) C. (2 1/2,−3) D. no solution I
1. 1 answer
2. 855 views
Solve the system using substitution.x = y − 6 y = 6 − 3x A. (0, 6) B. (6, 0) C. (0, −6) D. (−6, 0)
1. 2 answers
2. 623 views
Solve the system using substitution.y = 4x − 5 y = 2x + 1 A. (−2, −3) B. (1, 3) C. (−2, −13) D. (3, 7)
1. 1 answer
2. 469 views
from a point 3 m above the water surface, the angle of elevation of the top of a certain tree is 30°40', while the angle of
1. 1 answer
2. 641 views
Forty-nine items are randomly selected from a population of 500 items. The sample mean is 40 and the sample standard deviation
1. 1 answer
2. 937 views
Evans Technology has the following capital structure.Debt ............................................ 40% Common equity
1. 0 answers
2. 1,242 views
To what decimal place should each answer be rounded? and how many significant figures does the rounded answer have?a) 9cm + 2.8
1. 2 answers
2. 1,673 views
convert 40.0m^3 to liters. note that 1mL = 1cm^3.can you show me how to do this problem?
1. 1 answer
2. 433 views
To what decimal place should each answer be rounded? and how many significant figures does the rounded answer have?a) 9cm + 2.8
1. 1 answer
2. 1,004 views
The number of items on two grocery list differs by seven.the total number of items is 33 how many items on each list
1. 1 answer
2. 565 views
A train accelerates from the rest at the station A at a rate of 0.8 m/s2 for 25 s, the travels at constant velocity for 77.5 s
1. 1 answer
2. 1,466 views
A ball of mass M1 moves with a velocity U1, collides perfectly elastically with a stationary ball of mass M2 . After the
1. 0 answers
2. 643 views
A block initially at rest, slides down from the top of an inclined plane 30degrees above the horizontal. The plane is 100feet
1. 0 answers
2. 1,047 views
I'm doing a redox potential/lead acid cell experiment and one of the questions that were asked was:-What were the identities of
1. 1 answer
2. 772 views
Please help me set up these problems. I have been staring at them for hours and I can't tell where I went wrong.Question:
1. 2 answers
2. 838 views
Phisic
1. 0 answers
2. 331 views
How many grams of water at 20°C are necessary to change 800g of water at 90°C to 50°C?
1. 2 answers
2. 637 views
from 25 feet away from the base of a building, the angle of elevation from the ground to the top of a building is measured 38
1. 2 answers
2. 1,874 views
a kite is being flown 150 yards of string. the kite has an angle of elevation with the ground 65 degrees. how high above the
1. 3 answers
2. 1,857 views
What are welfare payment or consumer?
1. 1 answer
2. 484 views
Please, critique this critique:Very dramatic interactions in a world novel to me, with canine preening for competitive
1. 1 answer
2. 474 views
What is parallelism, please?
1. 2 answers
2. 553 views
A man and a woman's ages total 98.He is twice as old as she was when he was her age now. What are their ages?
1. 2 answers
2. 733 views
How Mali Build 0n Ghana Empire
1. 0 answers
2. 379 views
3/4x^2 x 2x^2y x 23xy^3
1. 1 answer
2. 336 views
How do you differentiate between fluorene and acetanilide? Suggest procedures and steps involved other than melting point and
1. 1 answer
2. 2,100 views
How do you distinguish between fluorene and acetanilide? Suggest methods other than melting point and chromatography.
1. 1 answer
2. 1,242 views
Carlos goes to a local deli for lunch and orders a sandwich. He needs to choose a bread, a meat, a vegetable, a cheese and a
1. 1 answer
2. 544 views
Reading The Stranger by the lovely Albert Camus.Just need help understanding this question: -After I listed some themes I
1. 1 answer
2. 575 views
Please let me know if I answered these correctly. thank you,#2. Add: 3p^2 – 5p – 4 and 9p^2 + 10p – 2 A. 12p2 + 15p – 6
1. 1 answer
2. 1,188 views
PLEASE HELP , I DON'T UNDERSTANDfind dy/dx by implicit differentiation a) xy + x^5y^2 + 3x^3 - 4 = 1 b) lny = cos x thank you
1. 4 answers
2. 1,435 views
find the slope of the tangent line to y^4 = 3x^2 - 2x at the point (1,1)
1. 2 answers
2. 308 views
find dy/dx by implicit differentiationa) xy + x^5y^2 + 3x^3 - 4 = 1 b) lny = cos x thank you
1. 2 answers
2. 437 views
hi i need help differentiating these..1. y = cos(3x^2 + 2x) 2. y = ln(3x^2 + 5) thank you
1. 1 answer
2. 430 views
A rectangle field with area of 1,500,000 needs to be fenced. 2W+2L=5,000. solve for L and W
1. 1 answer
2. 351 views
when 25.0 mL of a solution containing both Fe2+ and Fe3+ ions is titrated with 23.0 mL of 0.0200 M KMnO4 (in dilute sulfuric
1. 3 answers
2. 4,503 views
calculate the energy associated with a photon whose wavelength is 14.5*10^-8cm.
1. 1 answer
2. 524 views
Estimate products of fractions.2/9x26
1. 1 answer
2. 412 views
A 15 kg block of wood is sitting on a 1.5 meter high shelf. Calculate its gravitational potential energy
1. 0 answers
2. 432 views
A man enters a tall tower, needing to know its height. He notes that a long pendulum extends from the ceiling almost to the
1. 1 answer
2. 806 views
The free-fall acceleration on Mars is 3.7 m/s2.(a) What length pendulum has a period of 4 s on the earth? cm What length
1. 1 answer
2. 931 views
The perimeter of a rectangle is 76 feet. If the width is doubled and the length is halved, the new rectangle will have a
1. 1 answer
2. 1,243 views
Consider the solid obtained by rotating the region bounded by the given curves about the x-axis.y=6x^5, y=6x, x>or equal to 0
1. 0 answers
2. 541 views
If I have a garden that is square with sides of length x feet and next spring I plan to make it rectangular by lengthening one
1. 3 answers
2. 540 views
3 different drugs are under consideration for trating a given ailment. in the past 10,000 applications, drug A was sed 2500
1. 0 answers
2. 574 views
Find the zeros of the polynomial function and state the multiplicity of eachf(x) = (x^2-5x+6)^2
1. 1 answer
2. 458 views
If the density of ice is 0.92 g/cm^3, what percent of an ice cube’s (or iceberg’s) mass is above water.
1. 1 answer
2. 706 views
How does the apparent weight loss of the an object compare with the weight of the water displaced by the object?
1. 1 answer
2. 634 views
A 5 meter, 100 N/m spring is at a 30 degree angle to the horizontal. If a 10 kg weight is placed on the spring when it is
1. 2 answers
2. 393 views
Find the area between each curve and the x-axis for the given interval.y=6x^2+5 from x=0 to x=5 I'm just starting to learn about
1. 1 answer
2. 491 views
how do you take the fourth root? Please refer to the example below?Using Amount = Present Value(1+i)^n we do not know i.
1. 0 answers
2. 515 views
You are an economic consultant to the International Monetary Fund, engaged to report on macroeconomic policy in various
1. 0 answers
2. 469 views

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2025