provide the appropriate IUPAC name

  1. I've been asked to find the IUPAC name for polyvinyl acetate. when i type it in google i keep getting butan-2-yl acetate. but
    1. answers icon 1 answer
    2. Jeff asked by Jeff
    3. views icon 657 views
  2. provide the iupac name,ch3ch(c3h7)ch2ch2ch2ch2ch(c4h8)ch2ch(ch3)ch3
    1. answers icon 0 answers
    2. shakirudeen asked by shakirudeen
    3. views icon 526 views
  3. Provide the reference for:1. Aromatic compounds - assign IUPAC names 2. Haloalkanes
    1. answers icon 1 answer
    2. Jonathan Kila asked by Jonathan Kila
    3. views icon 123 views
  4. Hi, I'm trying to fix an incorrect IUPAC name of a molecule. It is given as trisecbutylmethane, and I have to draw it out to
    1. answers icon 3 answers
    2. Justin asked by Justin
    3. views icon 2,175 views
  5. provide the appropriate IUPAC name for the following alcohol. designate e or z8 carbon chain double bonds between 4 and 5 and 6
    1. answers icon 1 answer
    2. michelle asked by michelle
    3. views icon 726 views
  6. Amide formation: draw the structure (or provide the IUPAC name) of the amide formed (appropriate coupling reagent required)
    1. answers icon 0 answers
    2. meghan asked by meghan
    3. views icon 676 views
  7. Write the IUPAC name for straight-chain hydrocarbon with this formula: CH3CH2CH2CH2CH2CH2CH3Write the IUPAC name for any
    1. answers icon 1 answer
    2. Allison asked by Allison
    3. views icon 1,266 views
  8. What is the IUPAC name of CH2=C(CH3)CH(CH3)CH3?
    1. answers icon 1 answer
    2. mica asked by mica
    3. views icon 385 views
  9. IUPAC name of (CH3)3.C.CH2
    1. answers icon 2 answers
    2. ZulFi asked by ZulFi
    3. views icon 446 views
  10. what is the IUPAC name for this: H-CH3-H-H-C-C-C-H-H-OH-H
    1. answers icon 0 answers
    2. Samantha Cregan asked by Samantha Cregan
    3. views icon 696 views