Ask a New Question

is c2h5 polar or non

Diethylamine, (C2H5)2NH, is a weak base with Kb = 6.92×10−4 at 25 oC.For a 0.133 mol L−1 solution of (C2H5)2NH at 25 oC,
1. 1 answer
2. asked by sara
3. 1,331 views
5. The tetraethyl lead [Pb(C2H5)4] in a 25.00-mL sample of aviation gasoline was shaken with 15.00mL of 0.02095M I2. The
1. 1 answer
2. asked by robie miranda
3. 1,669 views
CH3(C2H5)CHC(C2H5)UCH(CH3)CH((C2H5)2)Looking for skeletal diagram and formula
1. 3 answers
2. asked by Swati
3. 704 views
is c2h5 polar or non polar?
1. 2 answers
2. asked by kailyn
3. 2,108 views
What is the IUPAC name of CH3CH(C2H5)CH=CH(C2H5)CH3?
1. 2 answers
2. asked by Izzy
3. 1,745 views
Determine if it is polar or non-polar molecule:C3H6O C2H5OH SiCl4 NH3 CO2 C3H8 H2O N2 My ans are: Polar Polar Polar polar
1. 1 answer
2. asked by nadira
3. 1,454 views
I understand that the plasma membrane is composed of a polar head and non polar tail. I read in my textbook that small non-polar
1. 1 answer
2. asked by lou
3. 843 views
Determine if it is polar or non-polar molecule:C3H6O C2H5OH SiCl4 NH3 CO2 C3H8 H2O N2 My ans are: Polar Polar Polar polar
1. 1 answer
2. asked by nidscorection
3. 1,687 views
Determine if it is polar or non-polar molecule:C3H6O C2H5OH SiCl4 NH3 CO2 C3H8 H2O N2 My ans are: Polar Polar Polar Nonpolar
1. 1 answer
2. asked by nidscorection
3. 3,147 views
Diethylamine (C2H5)2NH, is a weak base that ionizes in water,a 0.600 M solution of (C2H5)2NH is 4.65% ionized at 25 degrees
1. 1 answer
2. asked by Chris
3. 1,232 views