is c2h5 polar or non

  1. Diethylamine, (C2H5)2NH, is a weak base with Kb = 6.92Ɨ10āˆ’4 at 25 oC.For a 0.133 mol Lāˆ’1 solution of (C2H5)2NH at 25 oC,
    1. answers icon 1 answer
    2. sara asked by sara
    3. views icon 1,353 views
  2. 5. The tetraethyl lead [Pb(C2H5)4] in a 25.00-mL sample of aviation gasoline was shaken with 15.00mL of 0.02095M I2. The
    1. answers icon 1 answer
    2. robie miranda asked by robie miranda
    3. views icon 1,692 views
  3. CH3(C2H5)CHC(C2H5)UCH(CH3)CH((C2H5)2)Looking for skeletal diagram and formula
    1. answers icon 3 answers
    2. Swati asked by Swati
    3. views icon 726 views
  4. is c2h5 polar or non polar?
    1. answers icon 2 answers
    2. kailyn asked by kailyn
    3. views icon 2,126 views
  5. What is the IUPAC name of CH3CH(C2H5)CH=CH(C2H5)CH3?
    1. answers icon 2 answers
    2. Izzy asked by Izzy
    3. views icon 1,775 views
  6. Determine if it is polar or non-polar molecule:C3H6O C2H5OH SiCl4 NH3 CO2 C3H8 H2O N2 My ans are: Polar Polar Polar polar
    1. answers icon 1 answer
    2. nadira asked by nadira
    3. views icon 1,494 views
  7. I understand that the plasma membrane is composed of a polar head and non polar tail. I read in my textbook that small non-polar
    1. answers icon 1 answer
    2. lou asked by lou
    3. views icon 884 views
  8. Determine if it is polar or non-polar molecule:C3H6O C2H5OH SiCl4 NH3 CO2 C3H8 H2O N2 My ans are: Polar Polar Polar polar
    1. answers icon 1 answer
    2. nidscorection asked by nidscorection
    3. views icon 1,722 views
  9. Determine if it is polar or non-polar molecule:C3H6O C2H5OH SiCl4 NH3 CO2 C3H8 H2O N2 My ans are: Polar Polar Polar Nonpolar
    1. answers icon 1 answer
    2. nidscorection asked by nidscorection
    3. views icon 3,185 views
  10. Diethylamine (C2H5)2NH, is a weak base that ionizes in water,a 0.600 M solution of (C2H5)2NH is 4.65% ionized at 25 degrees
    1. answers icon 1 answer
    2. Chris asked by Chris
    3. views icon 1,259 views