Ask a New Question

if 20g of CaSiO3 is

CaSiO3(s) +6 HF (g)-> CaF2(aq) + SiF4 (g) + 3 H2O(l)If a 65.6 g sample of CaSiO3 is reacted in an inert 83 L container at
1. 1 answer
2. asked by Val22
3. 638 views
CaSiO3(s) +6 HF (g)-> CaF2(aq) + SiF4 (g) + 3 H2O(l)If a 65.6 g sample of CaSiO3 is reacted in an inert 83 L container at
1. 2 answers
2. asked by joe
3. 902 views
58% Ca3 (PO4) 2 how many phosphorus are in 10 kg bones?Ca3(po4)2+SiO2+C=CaSiO3+P4
1. 1 answer
2. asked by Diana
3. 735 views
if 20g of CaSiO3 is mixed with 15g of HF which of the two is the limiting reactant and how many grams of the other will be left
1. 0 answers
2. asked by Ernesto
3. 395 views
CO2(g)+CaSiO3(s)+H2O(l)→SiO2(s)+Ca(HCO3)2(aq) Balance using smallest multiples
1. 3 answers
2. asked by Anonymous
3. 4,697 views
Which chemical equation represents a redox reaction?CaO(s)+SiO2(s)→CaSiO3(l) CaCO3(s)→CaO(s)+CO2(g)
1. 1 answer
2. 167 views
Which chemical equation represents a redox reaction?(1 point)Responses CaCO3(s)→CaO(s)+CO2(g)
1. 1 answer
2. 139 views
Which chemical equation represents a redox reaction?(1 point) Responses CaO(s)+SiO2(s)→CaSiO3(l) cap c A cap o left
1. 1 answer
2. 107 views
check answer please10. 2 Ca3(PO4)2(s) + 6 SiO2(g) + 10 C(s) ---> P4(s) + 6 CaSiO3(s) + 10 CO(g) If 39.3 g of Ca3(PO4)2, 24.4 g
1. 2 answers
2. asked by Shine bright shine far
3. 2,559 views