Is CH3CH=CHCOOH compound exist as

  1. Is CH3CH=CHCOOH compound exist as cis-trans isomers or does not, explain your answer
    1. answers icon 1 answer
    2. views icon 56 views
  2. name the compound CH3CH=C(CH3)CH(CH3)2.
    1. answers icon 1 answer
    2. Anonymous asked by Anonymous
    3. views icon 3,879 views
  3. I am trying to draw a constitutional isomer for the compound CH3CH=CHCH3 but I am having some trouble.H-C-C=C-C-H I drew the
    1. answers icon 1 answer
    2. Hannah asked by Hannah
    3. views icon 571 views
  4. name the following compound: CH3CH(NH2)CH2CH(CH3)OH
    1. answers icon 1 answer
    2. bob asked by bob
    3. views icon 184 views
  5. Using IUPAC nomenclature, name the following compound: CH3CH(NH2)CH2CH(CH3)OH
    1. answers icon 3 answers
    2. bob asked by bob
    3. views icon 211 views
  6. Using IUPAC nomenclature, name the following compound: CH3CH(NH2)CH2CH(CH3)OH
    1. answers icon 1 answer
    2. bob asked by bob
    3. views icon 249 views
  7. Name and draw the molecular structure of this compound CH3CH(C2H5)CH(CH3)CH(C3H7)CH2CH3
    1. answers icon 1 answer
    2. dan asked by dan
    3. views icon 1,312 views
  8. which of the following represents the best strategy for synthesizing 2-butanol, CH3CH2CH(OH)CH3a) CH3CH=CHCH3 + [H30]+ b)
    1. answers icon 3 answers
    2. michelle asked by michelle
    3. views icon 601 views
  9. 1. All of the following are structural isomers of CH2=CHCH2CH=CHCH3 EXCEPTa. CH2=CHCH2CH2CH=CH2 b. CH3CH=CHCH2CH=CH2 c.
    1. answers icon 1 answer
    2. anonymous asked by anonymous
    3. views icon 2,012 views
  10. For each compound, draw a line structural diagram of all isomers. Identify the kind(s) of isomers illustrated.A. CH3CH=CHCH3 B.
    1. answers icon 0 answers
    2. Neha asked by Neha
    3. views icon 1,220 views