Draw the line structure for

  1. Hope you don't mind I have3 more that I don't understand 1)Draw the structure of the reaction product of 2-methyl-1pentene with
    1. answers icon 0 answers
    2. Kellie asked by Kellie
    3. views icon 824 views
  2. draw the skeletal structure line-angle (line-bond) mode of 2-isopropyltoluene. Identify the number of hydrogen atoms bound to
    1. answers icon 1 answer
    2. sarah asked by sarah
    3. views icon 4,786 views
  3. You could draw me to fire, you could draw me to water, you could draw me to the gallows, you could draw me to any death, you
    1. answers icon 1 answer
    2. Anonymous asked by Anonymous
    3. views icon 1,477 views
  4. Draw the line bond structure of the following compounds:(HO)3C(CH2)2N(CH2CHO)CH(CH2CH3)2 (All numbers are subscripts) Could
    1. answers icon 1 answer
    2. Anonymous asked by Anonymous
    3. views icon 1,389 views
  5. 1. Draw a vertical line down the middle of the page.2. Draw 3 horizontal lines as shown. For this step, Use the straight edge to
    1. answers icon 1 answer
    2. views icon 105 views
  6. I need to draw the structure of 4-Hexenal. I understand that "hex" means it is a 6 carbon chain and the 4 tells me the aldehyde
    1. answers icon 1 answer
    2. AMY asked by AMY
    3. views icon 1,213 views
  7. Draw the Lewis dot structure for Ca. Use the periodic table to help you determine the number of valence electrons.You can draw
    1. answers icon 1 answer
    2. views icon 69 views
  8. Draw a line and label it XY . Draw Ray XZ that does not lie on line XY. Draw segment PQ . That intersects line XY and point X
    1. answers icon 0 answers
    2. Harlem asked by Harlem
    3. views icon 184 views
  9. I need to draw a line angle structure of ibuprofen that shows hydrogen bonding and I am stuck. Can anyone help?
    1. answers icon 2 answers
    2. Breanne asked by Breanne
    3. views icon 806 views
  10. Describe the subatomic structure of the nucleus, including the structure of each nucleon. Draw a picture.Describe the forces
    1. answers icon 1 answer
    2. Paige asked by Paige
    3. views icon 876 views