Ask a New Question
Menu

CH3 CH(C2H5 ) CH(CH3 )2

  1. Diethylamine, (C2H5)2NH, is a weak base with Kb = 6.92Ɨ10āˆ’4 at 25 oC.For a 0.133 mol Lāˆ’1 solution of (C2H5)2NH at 25 oC,
    1. answers icon 1 answer
    2. sara asked by sara
    3. views icon 1,309 views
  2. 5. The tetraethyl lead [Pb(C2H5)4] in a 25.00-mL sample of aviation gasoline was shaken with 15.00mL of 0.02095M I2. The
    1. answers icon 1 answer
    2. robie miranda asked by robie miranda
    3. views icon 1,641 views
  3. CH3(C2H5)CHC(C2H5)UCH(CH3)CH((C2H5)2)Looking for skeletal diagram and formula
    1. answers icon 3 answers
    2. Swati asked by Swati
    3. views icon 675 views
  4. What is the IUPAC name of CH3CH(C2H5)CH=CH(C2H5)CH3?
    1. answers icon 2 answers
    2. Izzy asked by Izzy
    3. views icon 1,722 views
  5. Diethylamine (C2H5)2NH, is a weak base that ionizes in water,a 0.600 M solution of (C2H5)2NH is 4.65% ionized at 25 degrees
    1. answers icon 1 answer
    2. Chris asked by Chris
    3. views icon 1,209 views
  6. A 4.86 kg sample of a solution of the solute chloroform in the solvent (C2H5)2O that has a concentration of 1.91 pph by mass
    1. answers icon 2 answers
    2. Scott asked by Scott
    3. views icon 732 views
  7. CH3 CH(C2H5 ) CH(CH3 )2
    1. answers icon 2 answers
    2. MD ABU KAWSAR AKANDO asked by MD ABU KAWSAR AKANDO
    3. views icon 341 views
  8. Calculate the pH of a 0.053 M (C2H5)2NH solution (Kb = 1.3 10-3).
    1. answers icon 2 answers
    2. Kaleen asked by Kaleen
    3. views icon 2,245 views
  9. Calculate the pH of a 0.063 M (C2H5)2NH solution (Kb = 1.3 10-3).
    1. answers icon 1 answer
    2. melissa asked by melissa
    3. views icon 689 views
  10. C2H5 O| || CH3--CH2--C--CH2--CH2--C--NH2 | CH3 What's the name of this organic structure
    1. answers icon 0 answers
    2. Evans asked by Evans
    3. views icon 488 views