Ask a New Question

Acetic acid (CH3COOH) has a

Acetic acid is a weak acid with the formula , CH3COOH, the Ka for acetic acid is 1.76 x 10-5.In aqueous solution, acetic acid
1. 1 answer
2. asked by jhope
3. 1,407 views
The major component of vinegar is acetic acid CH3COOH. Which of the following reactions represents the balanced equation between
1. 1 answer
2. asked by GRACE
3. 864 views
Rank following acids frommost to least acidic:hydrocyanic acid (HCN) Ka = 6.2 × 10−10 hypoiodous acid (HOI) Ka = 2 × 10−11
1. 2 answers
2. asked by susan
3. 2,121 views
Make 50.0 mL of a 0.500 M solution of acetic acid (CH3COOH) from the 1.00 M CH3COOH using a 50.0 mL graduated cylinder.1. Show
1. 1 answer
2. asked by Kate
3. 541 views
1.) Quantify the pH for a solution prepared by dissolving 0.050 moles of Acetic Acid (CH3COOH) and 0.20 moles of Sodium Acetate
1. 2 answers
2. asked by Always
3. 848 views
1.) Quantify the pH for a solution prepared by dissolving 0.050 moles of Acetic Acid (CH3COOH) and 0.20 moles of Sodium Acetate
1. 2 answers
2. asked by Always
3. 1,053 views
A buffer is prepared using acetic acid, CH3COOH, (a weak acid, pKa = 4.75) and sodium acetate, CH3COONa (which provides acetate
1. 12 answers
2. asked by kevin
3. 3,255 views
A buffer is prepared using acetic acid, CH3COOH, (a weak acid) and sodium acetate, CH3COONa (which provides acetate ions, the
1. 4 answers
2. asked by kevin
3. 3,802 views
the acid-dissociation constanstant for acetic acidCH3COOH(aq)<->H+(aq)+CH3COO-(aq) is known to be 1.8X10^-5 at 25C Caclulate G0f
1. 0 answers
2. asked by o
3. 634 views
1 (A) This relation gives the dissociation constant of acetic acid (CH3COOH)Ka = [H3O+][CH3COO-]\[CH3COOH] Starting from this
1. 2 answers
2. asked by Petty
3. 829 views