Ask a New Question

Acetic acid, HC2H3O2, is the

Acetic acid, HC2H3O2, is the sour constituent of vinegar (acetum is Latin for "vinegar" ). In an experiment, 3.76 g of acetic
1. 1 answer
2. asked by Glenna
3. 1,233 views
C7H6O3(s) + C4H6O3(l) → C9H8O4(s) + HC2H3O2(l)is the equation. At 20 degree celsius, how many liters of acetic acid, HC2H3O2,
1. 6 answers
2. asked by Emat
3. 3,950 views
23.780 g of acetaldehyde (CH3CHO) reacts completely with oxygen to produce acetic acid (HC2H3O2) using manganese (II) acetate
1. 1 answer
2. asked by ezile
3. 219 views
At 20 degrees celsius ,if the equation is C7H6O3(s)+C4H6O3(l)=C9H8O4+HC2H3O2(l), then how many liters of acetic acid, HC2H3O2 ,
1. 1 answer
2. asked by Rene'
3. 826 views
help me..The pKa of acetic acid, HC2H3O2, is 4.76. A buffer solution was made using an unspecified amount of acetic acid and
1. 1 answer
2. asked by Azy
3. 3,196 views
Calculate the pH of a [Acid] M aqueous solution of each of the hydrochloric and acetic acids:Acid [Acid] pH HCl 0.10 HC2H3O2
1. 4 answers
2. asked by Renee
3. 829 views
Pure acetic acid (HC2H3O2) is a liquid and is known as glacial acetic acid. Calculate the molarity of a solution prepared by
1. 1 answer
2. 133 views
Acetic acid is 3% dissociated in a 0.02M solution. Give the concentrations of each of the two ions, the acetic acid, and the Ka
1. 0 answers
2. asked by Lizette
3. 573 views
A solution is prepared to be 0.10 M acetic acid, HC2H3O2, and 0.20 M sodium acetate, NaC2H3O2. What is the pH of this buffer? Ka
1. 0 answers
2. asked by Marlynda
3. 738 views
A professor found that there are 109 drops of glacial acetic acid in 2.00 mL. Calculate the number of drops of glacial acetic
1. 2 answers
2. asked by Sam
3. 781 views