These boards don't handle spaces so you can't draw structural formulas. You will need to do line formulas.
CH3CH2CH(OH)CH2CtriplebondN or something like that.
What is the lowest energy alternative resonance structure for this compound:
-HC-N+///N
/
H3C
Where /// is a triple bond connecting N+ and N
2 answers
CH3-CH-N<triple bond>N
There is a negative charge on CH and a positive charge on the central N
There is a negative charge on CH and a positive charge on the central N
0 answers